Sync to upstream/release/676 (#1856)

We're back on track after the long weekend!

## General 
- `clang-format`ed new code. Keep your code tidy!
- Disable some Luau tests that are broken currently.
- Enable fragment autocomplete to do tagged union completion for modules
typechecked in the old solver.

## New Type Solver
- Fix false positives on generic type packs in non-strict mode.
- Update type signature of `setmetatable` to be `<T, MT>(T, MT) ->
setmetatable<T, MT>`.
- Make local type aliases available in type functions. For example:
```
type Foo = number
type Array<T> = {T}

type function Bar(t)
  return types.unionof(Foo, Array(t))
end
```

## VM/Runtime
- Make sure `lua_unref` doesn't accept refs which did not exist in the
table.

---

Co-authored-by: Andy Friesen <afriesen@roblox.com>
Co-authored-by: Ariel Weiss <aaronweiss@roblox.com>
Co-authored-by: Hunter Goldstein <hgoldstein@roblox.com>
Co-authored-by: Sora Kanosue <skanosue@roblox.com>
Co-authored-by: Talha Pathan <tpathan@roblox.com>
Co-authored-by: Vighnesh Vijay <vvijay@roblox.com>
Co-authored-by: Vyacheslav Egorov <vegorov@roblox.com>

---------

Co-authored-by: Hunter Goldstein <hgoldstein@roblox.com>
Co-authored-by: Varun Saini <61795485+vrn-sn@users.noreply.github.com>
Co-authored-by: Menarul Alam <malam@roblox.com>
Co-authored-by: Aviral Goel <agoel@roblox.com>
Co-authored-by: Vighnesh <vvijay@roblox.com>
Co-authored-by: Vyacheslav Egorov <vegorov@roblox.com>
Co-authored-by: Ariel Weiss <aaronweiss@roblox.com>
Co-authored-by: Andy Friesen <afriesen@roblox.com>

Analysis/include/Luau/ConstraintGenerator.h

@@ -10,12 +10,12 @@
 #include "Luau/InsertionOrderedMap.h"
 #include "Luau/Module.h"
 #include "Luau/ModuleResolver.h"
-#include "Luau/Normalize.h"
 #include "Luau/NotNull.h"
 #include "Luau/Polarity.h"
 #include "Luau/Refinement.h"
 #include "Luau/Symbol.h"
 #include "Luau/TypeFwd.h"
+#include "Luau/TypeIds.h"
 #include "Luau/TypeUtils.h"
 
 #include <memory>
@@ -93,7 +93,7 @@ struct ConstraintGenerator
     std::vector<ConstraintPtr> constraints;
 
     // The set of all free types introduced during constraint generation.
-    DenseHashSet<TypeId> freeTypes{nullptr};
+    TypeIds freeTypes;
 
     // Map a function's signature scope back to its signature type.
     DenseHashMap<Scope*, TypeId> scopeToFunction{nullptr};

Analysis/include/Luau/ConstraintSet.h

@@ -3,7 +3,7 @@
 #pragma once
 
 #include "Luau/Constraint.h"
-#include "Luau/DenseHash.h"
+#include "Luau/TypeIds.h"
 #include "Luau/Error.h"
 
 #include <vector>
@@ -18,7 +18,7 @@ struct ConstraintSet
     std::vector<ConstraintPtr> constraints;
 
     // The set of all free types created during constraint generation
-    DenseHashSet<TypeId> freeTypes{nullptr};
+    TypeIds freeTypes;
 
     // Map a function's signature scope back to its signature type.   Once we've
     // dispatched all of the constraints pertaining to a particular free type,
@@ -29,4 +29,4 @@ struct ConstraintSet
     std::vector<TypeError> errors;
 };
 
-}
+} // namespace Luau

Analysis/include/Luau/ConstraintSolver.h

@@ -456,6 +456,14 @@ public:
  */
 std::vector<NotNull<Constraint>> borrowConstraints(const std::vector<ConstraintPtr>& constraints);
 
+std::pair<std::vector<TypeId>, std::vector<TypePackId>> saturateArguments(
+    TypeArena* arena,
+    NotNull<BuiltinTypes> builtinTypes,
+    const TypeFun& fn,
+    const std::vector<TypeId>& rawTypeArguments,
+    const std::vector<TypePackId>& rawPackArguments
+);
+
 void dump(NotNull<Scope> rootScope, struct ToStringOptions& opts);
 
 } // namespace Luau

Analysis/include/Luau/Error.h

@@ -464,7 +464,10 @@ struct ReservedIdentifier
 
 struct UnexpectedArrayLikeTableItem
 {
-    bool operator==(const UnexpectedArrayLikeTableItem&) const { return true; }
+    bool operator==(const UnexpectedArrayLikeTableItem&) const
+    {
+        return true;
+    }
 };
 
 using TypeErrorData = Variant<

Analysis/include/Luau/ExpectedTypeVisitor.h

@@ -0,0 +1,74 @@
+// This file is part of the Luau programming language and is licensed under MIT License; see LICENSE.txt for details
+#pragma once
+
+#include "Luau/Ast.h"
+#include "Luau/DenseHash.h"
+#include "Luau/NotNull.h"
+#include "Luau/Type.h"
+
+namespace Luau
+{
+
+struct ExpectedTypeVisitor : public AstVisitor
+{
+
+    explicit ExpectedTypeVisitor(
+        NotNull<DenseHashMap<const AstExpr*, TypeId>> astTypes,
+        NotNull<DenseHashMap<const AstExpr*, TypeId>> astExpectedTypes,
+        NotNull<DenseHashMap<const AstType*, TypeId>> astResolvedTypes,
+        NotNull<TypeArena> arena,
+        NotNull<BuiltinTypes> builtinTypes,
+        NotNull<Scope> rootScope
+    );
+
+    // When we have an assignment, we grab the type of the left-hand-side
+    // and we use it to inform what the type of the right-hand-side ought
+    // to be. This is important for something like:
+    //
+    //
+    //    local function foobar(tbl: { prop: boolean })
+    //        tbl.prop = [autocomplete here]
+    //    end
+    //
+    // ... where the right hand side _must_ be a subtype of `boolean`
+    bool visit(AstStatAssign* stat) override;
+
+    // Similar to an assignment, we can apply expected types to the
+    // right-hand-side of a local based on the annotated type of the
+    // left-hand-side.
+    bool visit(AstStatLocal* stat) override;
+
+    // Compound assignments have the curious property that they do not change
+    // type state, so we can use the left-hand-side to inform the
+    // right-hand-side.
+    bool visit(AstStatCompoundAssign* stat) override;
+
+    // When we are returning something, and we've inferred a return type (or have
+    // a written return type), then we need to apply the expected types to the
+    // return type expression.
+    bool visit(AstStatReturn* stat) override;
+
+    // When we have a function call, we can apply expected types to all the
+    // parameters.
+    bool visit(AstExprCall* expr) override;
+
+    // If we have an expression of type:
+    //
+    //   return X :: Y
+    //
+    // Then surely the expected type of `X` is `Y`
+    bool visit(AstExprTypeAssertion* expr) override;
+
+private:
+    NotNull<DenseHashMap<const AstExpr*, TypeId>> astTypes;
+    NotNull<DenseHashMap<const AstExpr*, TypeId>> astExpectedTypes;
+    NotNull<DenseHashMap<const AstType*, TypeId>> astResolvedTypes;
+    NotNull<TypeArena> arena;
+    NotNull<BuiltinTypes> builtinTypes;
+    NotNull<Scope> rootScope;
+
+    void applyExpectedType(const TypeId expectedType, const AstExpr* expr);
+};
+
+
+} // namespace Luau

Analysis/include/Luau/Module.h

@@ -126,6 +126,9 @@ struct Module
     // we need a sentinel value for the map.
     DenseHashMap<const AstNode*, Scope*> astScopes{nullptr};
 
+    // Stable references for type aliases registered in the environment
+    std::vector<std::unique_ptr<TypeFun>> typeFunctionAliases;
+
     std::unordered_map<Name, TypeId> declaredGlobals;
     ErrorVec errors;
     LintResult lintResult;

Analysis/include/Luau/Normalize.h

@@ -5,9 +5,9 @@
 #include "Luau/NotNull.h"
 #include "Luau/Set.h"
 #include "Luau/TypeFwd.h"
+#include "Luau/TypeIds.h"
 #include "Luau/UnifierSharedState.h"
 
-#include <initializer_list>
 #include <map>
 #include <memory>
 #include <unordered_map>
@@ -39,57 +39,6 @@ bool isSubtype(
     InternalErrorReporter& ice
 );
 
-class TypeIds
-{
-private:
-    DenseHashMap<TypeId, bool> types{nullptr};
-    std::vector<TypeId> order;
-    std::size_t hash = 0;
-
-public:
-    using iterator = std::vector<TypeId>::iterator;
-    using const_iterator = std::vector<TypeId>::const_iterator;
-
-    TypeIds() = default;
-    ~TypeIds() = default;
-
-    TypeIds(std::initializer_list<TypeId> tys);
-
-    TypeIds(const TypeIds&) = default;
-    TypeIds& operator=(const TypeIds&) = default;
-
-    TypeIds(TypeIds&&) = default;
-    TypeIds& operator=(TypeIds&&) = default;
-
-    void insert(TypeId ty);
-    /// Erase every element that does not also occur in tys
-    void retain(const TypeIds& tys);
-    void clear();
-
-    TypeId front() const;
-    iterator begin();
-    iterator end();
-    const_iterator begin() const;
-    const_iterator end() const;
-    iterator erase(const_iterator it);
-    void erase(TypeId ty);
-
-    size_t size() const;
-    bool empty() const;
-    size_t count(TypeId ty) const;
-
-    template<class Iterator>
-    void insert(Iterator begin, Iterator end)
-    {
-        for (Iterator it = begin; it != end; ++it)
-            insert(*it);
-    }
-
-    bool operator==(const TypeIds& there) const;
-    size_t getHash() const;
-    bool isNever() const;
-};
-
 } // namespace Luau
 
 template<>
@@ -302,7 +251,7 @@ struct NormalizedType
     // we'd be reusing bad, stale data.
     bool isCacheable = true;
 
-    NormalizedType(NotNull<BuiltinTypes> builtinTypes);
+    explicit NormalizedType(NotNull<BuiltinTypes> builtinTypes);
 
     NormalizedType() = delete;
     ~NormalizedType() = default;

Analysis/include/Luau/Scope.h

@@ -101,6 +101,8 @@ struct Scope
 
     std::optional<std::vector<TypeId>> interiorFreeTypes;
     std::optional<std::vector<TypePackId>> interiorFreeTypePacks;
+
+    NotNull<Scope> findNarrowestScopeContaining(Location);
 };
 
 // Returns true iff the left scope encloses the right scope.  A Scope* equal to

Analysis/include/Luau/Subtyping.h

@@ -234,8 +234,14 @@ private:
     SubtypingResult isCovariantWith(SubtypingEnvironment& env, const TableType* subTable, const TableType* superTable, NotNull<Scope> scope);
     SubtypingResult isCovariantWith(SubtypingEnvironment& env, const MetatableType* subMt, const MetatableType* superMt, NotNull<Scope> scope);
     SubtypingResult isCovariantWith(SubtypingEnvironment& env, const MetatableType* subMt, const TableType* superTable, NotNull<Scope> scope);
-    SubtypingResult isCovariantWith(SubtypingEnvironment& env, const ExternType* subExternType, const ExternType* superExternType, NotNull<Scope> scope);
-    SubtypingResult isCovariantWith(SubtypingEnvironment& env, TypeId subTy, const ExternType* subExternType, TypeId superTy, const TableType* superTable, NotNull<Scope>);
+    SubtypingResult isCovariantWith(
+        SubtypingEnvironment& env,
+        const ExternType* subExternType,
+        const ExternType* superExternType,
+        NotNull<Scope> scope
+    );
+    SubtypingResult
+    isCovariantWith(SubtypingEnvironment& env, TypeId subTy, const ExternType* subExternType, TypeId superTy, const TableType* superTable, NotNull<Scope>);
     SubtypingResult isCovariantWith(
         SubtypingEnvironment& env,
         const FunctionType* subFunction,
@@ -267,7 +273,12 @@ private:
         const NormalizedExternType& superExternType,
         NotNull<Scope> scope
     );
-    SubtypingResult isCovariantWith(SubtypingEnvironment& env, const NormalizedExternType& subExternType, const TypeIds& superTables, NotNull<Scope> scope);
+    SubtypingResult isCovariantWith(
+        SubtypingEnvironment& env,
+        const NormalizedExternType& subExternType,
+        const TypeIds& superTables,
+        NotNull<Scope> scope
+    );
     SubtypingResult isCovariantWith(
         SubtypingEnvironment& env,
         const NormalizedStringType& subString,

Analysis/include/Luau/Type.h

@@ -34,6 +34,7 @@ using ScopePtr = std::shared_ptr<Scope>;
 struct Module;
 
 struct TypeFunction;
+struct TypeFun;
 struct Constraint;
 struct Subtyping;
 struct TypeChecker2;
@@ -608,7 +609,8 @@ struct UserDefinedFunctionData
     // References to AST elements are owned by the Module allocator which also stores this type
     AstStatTypeFunction* definition = nullptr;
 
-    DenseHashMap<Name, std::pair<AstStatTypeFunction*, size_t>> environment{""};
+    DenseHashMap<Name, std::pair<AstStatTypeFunction*, size_t>> environmentFunction{""};
+    DenseHashMap<Name, std::pair<TypeFun*, size_t>> environmentAlias{""};
 };
 
 /**

Analysis/include/Luau/TypeFunction.h

@@ -21,6 +21,8 @@ namespace Luau
 struct TypeArena;
 struct TxnLog;
 struct ConstraintSolver;
+struct TypeFunctionRuntimeBuilderState;
+struct TypeFunctionContext;
 class Normalizer;
 
 using StateRef = std::unique_ptr<lua_State, void (*)(lua_State*)>;
@@ -54,6 +56,9 @@ struct TypeFunctionRuntime
     // Output created by 'print' function
     std::vector<std::string> messages;
 
+    // Type builder, valid for the duration of a single evaluation
+    TypeFunctionRuntimeBuilderState* runtimeBuilder = nullptr;
+
 private:
     void prepareState();
 };

Analysis/include/Luau/TypeFunctionRuntime.h

@@ -15,6 +15,8 @@ using lua_State = struct lua_State;
 namespace Luau
 {
 
+struct TypeFunctionRuntime;
+
 void* typeFunctionAlloc(void* ud, void* ptr, size_t osize, size_t nsize);
 
 // Replica of types from Type.h
@@ -274,6 +276,8 @@ T* getMutable(TypeFunctionTypeId tv)
 
 std::optional<std::string> checkResultForError(lua_State* L, const char* typeFunctionName, int luaResult);
 
+TypeFunctionRuntime* getTypeFunctionRuntime(lua_State* L);
+
 TypeFunctionType* allocateTypeFunctionType(lua_State* L, TypeFunctionTypeVariant type);
 TypeFunctionTypePackVar* allocateTypeFunctionTypePack(lua_State* L, TypeFunctionTypePackVariant type);
 

Analysis/include/Luau/TypeIds.h

@@ -0,0 +1,67 @@
+// This file is part of the Luau programming language and is licensed under MIT License; see LICENSE.txt for details
+#pragma once
+
+#include "Luau/DenseHash.h"
+#include "Luau/TypeFwd.h"
+
+#include <vector>
+#include <initializer_list>
+
+namespace Luau
+{
+
+/*
+ * An ordered, hashable set of TypeIds.
+ */
+class TypeIds
+{
+private:
+    DenseHashMap<TypeId, bool> types{nullptr};
+    std::vector<TypeId> order;
+    std::size_t hash = 0;
+
+public:
+    using iterator = std::vector<TypeId>::iterator;
+    using const_iterator = std::vector<TypeId>::const_iterator;
+
+    TypeIds() = default;
+    ~TypeIds() = default;
+
+    TypeIds(std::initializer_list<TypeId> tys);
+
+    TypeIds(const TypeIds&) = default;
+    TypeIds& operator=(const TypeIds&) = default;
+
+    TypeIds(TypeIds&&) = default;
+    TypeIds& operator=(TypeIds&&) = default;
+
+    void insert(TypeId ty);
+    /// Erase every element that does not also occur in tys
+    void retain(const TypeIds& tys);
+    void clear();
+
+    TypeId front() const;
+    iterator begin();
+    iterator end();
+    const_iterator begin() const;
+    const_iterator end() const;
+    iterator erase(const_iterator it);
+    void erase(TypeId ty);
+
+    size_t size() const;
+    bool empty() const;
+    size_t count(TypeId ty) const;
+
+    template<class Iterator>
+    void insert(Iterator begin, Iterator end)
+    {
+        for (Iterator it = begin; it != end; ++it)
+            insert(*it);
+    }
+
+    bool operator==(const TypeIds& there) const;
+    size_t getHash() const;
+    bool isNever() const;
+};
+
+} // namespace Luau

Analysis/include/Luau/TypeUtils.h

@@ -301,4 +301,21 @@ bool fastIsSubtype(TypeId subTy, TypeId superTy);
  */
 std::optional<TypeId> extractMatchingTableType(std::vector<TypeId>& tables, TypeId exprType, NotNull<BuiltinTypes> builtinTypes);
 
+/**
+ * @param item A member of a table in an AST
+ * @return Whether the item is a key-value pair with a statically defined string key.
+ *
+ * ```
+ * {
+ *      ["foo"] = ..., -- is a record
+ *      bar = ..., -- is a record
+ *      ..., -- not a record: non-string key (number)
+ *      [true] = ..., -- not a record: non-string key (boolean)
+ *      [ foobar() ] = ..., -- not a record: unknown key value.
+ *      ["foo" .. "bar"] = ..., -- not a record (don't make us handle it).
+ * }
+ * ```
+ */
+bool isRecord(const AstExprTable::Item& item);
+
 } // namespace Luau

Analysis/src/AutocompleteCore.cpp

@@ -173,12 +173,7 @@ static bool checkTypeMatch(
         unifierState.counters.iterationLimit = FInt::LuauTypeInferIterationLimit;
 
         Subtyping subtyping{
-            builtinTypes,
-            NotNull{typeArena},
-            NotNull{simplifier.get()},
-            NotNull{&normalizer},
-            NotNull{&typeFunctionRuntime},
-            NotNull{&iceReporter}
+            builtinTypes, NotNull{typeArena}, NotNull{simplifier.get()}, NotNull{&normalizer}, NotNull{&typeFunctionRuntime}, NotNull{&iceReporter}
         };
 
         return subtyping.isSubtype(subTy, superTy, scope).isSubtype;

Analysis/src/BuiltinDefinitions.cpp

@@ -13,7 +13,6 @@
 #include "Luau/NotNull.h"
 #include "Luau/Subtyping.h"
 #include "Luau/Symbol.h"
-#include "Luau/ToString.h"
 #include "Luau/Type.h"
 #include "Luau/TypeChecker2.h"
 #include "Luau/TypeFunction.h"
@@ -30,10 +29,11 @@
  */
 
 LUAU_FASTFLAG(LuauSolverV2)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAGVARIABLE(LuauTableCloneClonesType3)
 LUAU_FASTFLAGVARIABLE(LuauMagicFreezeCheckBlocked2)
 LUAU_FASTFLAGVARIABLE(LuauFormatUseLastPosition)
+LUAU_FASTFLAGVARIABLE(LuauUpdateSetMetatableTypeSignature)
 
 namespace Luau
 {
@@ -310,8 +310,8 @@ void registerBuiltinGlobals(Frontend& frontend, GlobalTypes& globals, bool typeC
 
     TypeArena& arena = globals.globalTypes;
     NotNull<BuiltinTypes> builtinTypes = globals.builtinTypes;
-    Scope* globalScope = nullptr; // NotNull<Scope> when removing FFlag::LuauEagerGeneralization
-    if (FFlag::LuauEagerGeneralization)
+    Scope* globalScope = nullptr; // NotNull<Scope> when removing FFlag::LuauEagerGeneralization2
+    if (FFlag::LuauEagerGeneralization2)
         globalScope = globals.globalScope.get();
 
     if (FFlag::LuauSolverV2)
@@ -386,19 +386,30 @@ void registerBuiltinGlobals(Frontend& frontend, GlobalTypes& globals, bool typeC
         TypeId genericT = arena.addType(GenericType{globalScope, "T"});
         TypeId tMetaMT = arena.addType(MetatableType{genericT, genericMT});
 
-        // clang-format off
-        // setmetatable<T: {}, MT>(T, MT) -> { @metatable MT, T }
-        addGlobalBinding(globals, "setmetatable",
-            arena.addType(
-                FunctionType{
-                    {genericT, genericMT},
-                    {},
-                    arena.addTypePack(TypePack{{genericT, genericMT}}),
-                    arena.addTypePack(TypePack{{tMetaMT}})
-                }
-            ), "@luau"
-        );
-        // clang-format on
+        if (FFlag::LuauUpdateSetMetatableTypeSignature)
+        {
+            // setmetatable<T: {}, MT>(T, MT) -> setmetatable<T, MT>
+            TypeId setmtReturn = arena.addType(TypeFunctionInstanceType{builtinTypeFunctions().setmetatableFunc, {genericT, genericMT}});
+            addGlobalBinding(
+                globals, "setmetatable", makeFunction(arena, std::nullopt, {genericT, genericMT}, {}, {genericT, genericMT}, {setmtReturn}), "@luau"
+            );
+        }
+        else
+        {
+            // clang-format off
+            // setmetatable<T: {}, MT>(T, MT) -> { @metatable MT, T }
+            addGlobalBinding(globals, "setmetatable",
+                arena.addType(
+                    FunctionType{
+                        {genericT, genericMT},
+                        {},
+                        arena.addTypePack(TypePack{{genericT, genericMT}}),
+                        arena.addTypePack(TypePack{{tMetaMT}})
+                    }
+                ), "@luau"
+            );
+            // clang-format on
+        }
     }
     else
     {
@@ -701,9 +712,10 @@ bool MagicFormat::typeCheck(const MagicFunctionTypeCheckContext& context)
     {
         TypeId actualTy = params[i + paramOffset];
         TypeId expectedTy = expected[i];
-        Location location = FFlag::LuauFormatUseLastPosition
-            ? context.callSite->args.data[std::min(context.callSite->args.size - 1, i + (calledWithSelf ? 0 : paramOffset))]->location
-            : context.callSite->args.data[i + (calledWithSelf ? 0 : paramOffset)]->location;
+        Location location =
+            FFlag::LuauFormatUseLastPosition
+                ? context.callSite->args.data[std::min(context.callSite->args.size - 1, i + (calledWithSelf ? 0 : paramOffset))]->location
+                : context.callSite->args.data[i + (calledWithSelf ? 0 : paramOffset)]->location;
         // use subtyping instead here
         SubtypingResult result = context.typechecker->subtyping->isSubtype(actualTy, expectedTy, context.checkScope);
 

Analysis/src/Constraint.cpp

@@ -3,7 +3,7 @@
 #include "Luau/Constraint.h"
 #include "Luau/VisitType.h"
 
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 namespace Luau
 {
@@ -51,7 +51,7 @@ struct ReferenceCountInitializer : TypeOnceVisitor
 
     bool visit(TypeId, const TypeFunctionInstanceType&) override
     {
-        return FFlag::LuauEagerGeneralization && traverseIntoTypeFunctions;
+        return FFlag::LuauEagerGeneralization2 && traverseIntoTypeFunctions;
     }
 };
 
@@ -104,7 +104,7 @@ DenseHashSet<TypeId> Constraint::getMaybeMutatedFreeTypes() const
     {
         rci.traverse(fchc->argsPack);
     }
-    else if (auto fcc = get<FunctionCallConstraint>(*this); fcc && FFlag::LuauEagerGeneralization)
+    else if (auto fcc = get<FunctionCallConstraint>(*this); fcc && FFlag::LuauEagerGeneralization2)
     {
         rci.traverseIntoTypeFunctions = false;
         rci.traverse(fcc->fn);
@@ -118,12 +118,12 @@ DenseHashSet<TypeId> Constraint::getMaybeMutatedFreeTypes() const
     else if (auto hpc = get<HasPropConstraint>(*this))
     {
         rci.traverse(hpc->resultType);
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
             rci.traverse(hpc->subjectType);
     }
     else if (auto hic = get<HasIndexerConstraint>(*this))
     {
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
             rci.traverse(hic->subjectType);
         rci.traverse(hic->resultType);
         // `HasIndexerConstraint` should not mutate `indexType`.

Analysis/src/ConstraintGenerator.cpp

@@ -11,6 +11,7 @@
 #include "Luau/DenseHash.h"
 #include "Luau/InferPolarity.h"
 #include "Luau/ModuleResolver.h"
+#include "Luau/Normalize.h"
 #include "Luau/NotNull.h"
 #include "Luau/RecursionCounter.h"
 #include "Luau/Refinement.h"
@@ -33,11 +34,8 @@
 LUAU_FASTINT(LuauCheckRecursionLimit)
 LUAU_FASTFLAG(DebugLuauLogSolverToJson)
 LUAU_FASTFLAG(DebugLuauMagicTypes)
-LUAU_FASTFLAG(LuauEagerGeneralization)
-LUAU_FASTFLAG(LuauEagerGeneralization)
-
-LUAU_FASTFLAGVARIABLE(LuauRetainDefinitionAliasLocations)
-
+LUAU_FASTFLAG(LuauEagerGeneralization2)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAGVARIABLE(LuauWeakNilRefinementType)
 LUAU_FASTFLAG(LuauStoreReturnTypesAsPackOnAst)
 LUAU_FASTFLAG(LuauGlobalVariableModuleIsolation)
@@ -51,6 +49,7 @@ LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
 LUAU_FASTFLAG(LuauDfgAllowUpdatesInLoops)
 LUAU_FASTFLAGVARIABLE(LuauDisablePrimitiveInferenceInLargeTables)
 LUAU_FASTINTVARIABLE(LuauPrimitiveInferenceInTableLimit, 500)
+LUAU_FASTFLAGVARIABLE(LuauUserTypeFunctionAliases)
 
 namespace Luau
 {
@@ -180,6 +179,22 @@ bool hasFreeType(TypeId ty)
     return hft.result;
 }
 
+struct GlobalNameCollector : public AstVisitor
+{
+    DenseHashSet<AstName> names;
+
+    GlobalNameCollector()
+        : names(AstName())
+    {
+    }
+
+    bool visit(AstExprGlobal* node) override
+    {
+        names.insert(node->name);
+        return true;
+    }
+};
+
 } // namespace
 
 ConstraintGenerator::ConstraintGenerator(
@@ -220,26 +235,14 @@ ConstraintSet ConstraintGenerator::run(AstStatBlock* block)
 {
     visitModuleRoot(block);
 
-    return ConstraintSet{
-        NotNull{rootScope},
-        std::move(constraints),
-        std::move(freeTypes),
-        std::move(scopeToFunction),
-        std::move(errors)
-    };
+    return ConstraintSet{NotNull{rootScope}, std::move(constraints), std::move(freeTypes), std::move(scopeToFunction), std::move(errors)};
 }
 
 ConstraintSet ConstraintGenerator::runOnFragment(const ScopePtr& resumeScope, AstStatBlock* block)
 {
     visitFragmentRoot(resumeScope, block);
 
-    return ConstraintSet{
-        NotNull{rootScope},
-        std::move(constraints),
-        std::move(freeTypes),
-        std::move(scopeToFunction),
-        std::move(errors)
-    };
+    return ConstraintSet{NotNull{rootScope}, std::move(constraints), std::move(freeTypes), std::move(scopeToFunction), std::move(errors)};
 }
 
 void ConstraintGenerator::visitModuleRoot(AstStatBlock* block)
@@ -254,7 +257,7 @@ void ConstraintGenerator::visitModuleRoot(AstStatBlock* block)
     rootScope->location = block->location;
     module->astScopes[block] = NotNull{scope.get()};
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.emplace_back();
     else
         DEPRECATED_interiorTypes.emplace_back();
@@ -290,7 +293,7 @@ void ConstraintGenerator::visitModuleRoot(AstStatBlock* block)
         }
     );
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         scope->interiorFreeTypes = std::move(interiorFreeTypes.back().types);
         scope->interiorFreeTypePacks = std::move(interiorFreeTypes.back().typePacks);
@@ -309,7 +312,7 @@ void ConstraintGenerator::visitModuleRoot(AstStatBlock* block)
         }
     );
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.pop_back();
     else
         DEPRECATED_interiorTypes.pop_back();
@@ -347,13 +350,13 @@ void ConstraintGenerator::visitFragmentRoot(const ScopePtr& resumeScope, AstStat
     // We prepopulate global data in the resumeScope to avoid writing data into the old modules scopes
     prepopulateGlobalScopeForFragmentTypecheck(globalScope, resumeScope, block);
     // Pre
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.emplace_back();
     else
         DEPRECATED_interiorTypes.emplace_back();
     visitBlockWithoutChildScope(resumeScope, block);
     // Post
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.pop_back();
     else
         DEPRECATED_interiorTypes.pop_back();
@@ -383,12 +386,12 @@ void ConstraintGenerator::visitFragmentRoot(const ScopePtr& resumeScope, AstStat
 
 TypeId ConstraintGenerator::freshType(const ScopePtr& scope, Polarity polarity)
 {
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         auto ft = Luau::freshType(arena, builtinTypes, scope.get(), polarity);
         interiorFreeTypes.back().types.push_back(ft);
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
             freeTypes.insert(ft);
 
         return ft;
@@ -405,7 +408,7 @@ TypePackId ConstraintGenerator::freshTypePack(const ScopePtr& scope, Polarity po
 {
     FreeTypePack f{scope.get(), polarity};
     TypePackId result = arena->addTypePack(TypePackVar{std::move(f)});
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.back().typePacks.push_back(result);
     return result;
 }
@@ -818,8 +821,7 @@ void ConstraintGenerator::checkAliases(const ScopePtr& scope, AstStatBlock* bloc
                 initialFun.typePackParams.push_back(genPack);
             }
 
-            if (FFlag::LuauRetainDefinitionAliasLocations)
-                initialFun.definitionLocation = alias->location;
+            initialFun.definitionLocation = alias->location;
 
             if (alias->exported)
                 scope->exportedTypeBindings[alias->name.value] = std::move(initialFun);
@@ -873,8 +875,7 @@ void ConstraintGenerator::checkAliases(const ScopePtr& scope, AstStatBlock* bloc
 
             TypeFun typeFunction{std::move(quantifiedTypeParams), typeFunctionTy};
 
-            if (FFlag::LuauRetainDefinitionAliasLocations)
-                typeFunction.definitionLocation = function->location;
+            typeFunction.definitionLocation = function->location;
 
             // Set type bindings and definition locations for this user-defined type function
             if (function->exported)
@@ -903,8 +904,7 @@ void ConstraintGenerator::checkAliases(const ScopePtr& scope, AstStatBlock* bloc
 
             TypeId initialType = arena->addType(BlockedType{});
             TypeFun initialFun{initialType};
-            if (FFlag::LuauRetainDefinitionAliasLocations)
-                initialFun.definitionLocation = classDeclaration->location;
+            initialFun.definitionLocation = classDeclaration->location;
             scope->exportedTypeBindings[classDeclaration->name.value] = std::move(initialFun);
 
             classDefinitionLocations[classDeclaration->name.value] = classDeclaration->location;
@@ -936,20 +936,24 @@ void ConstraintGenerator::checkAliases(const ScopePtr& scope, AstStatBlock* bloc
                     mainTypeFun = getMutable<TypeFunctionInstanceType>(it->second.type);
             }
 
-            // Fill it with all visible type functions
+            // Fill it with all visible type functions and referenced type aliases
             if (mainTypeFun)
             {
+                GlobalNameCollector globalNameCollector;
+                stat->visit(&globalNameCollector);
+
                 UserDefinedFunctionData& userFuncData = mainTypeFun->userFuncData;
                 size_t level = 0;
 
-                auto addToEnvironment = [this](UserDefinedFunctionData& userFuncData, ScopePtr scope, const Name& name, TypeId type, size_t level)
+                auto addToEnvironment =
+                    [this, &globalNameCollector](UserDefinedFunctionData& userFuncData, ScopePtr scope, const Name& name, TypeFun tf, size_t level)
                 {
-                    if (userFuncData.environment.find(name))
-                        return;
-
-                    if (auto ty = get<TypeFunctionInstanceType>(type); ty && ty->userFuncData.definition)
+                    if (auto ty = get<TypeFunctionInstanceType>(tf.type); ty && ty->userFuncData.definition)
                     {
-                        userFuncData.environment[name] = std::make_pair(ty->userFuncData.definition, level);
+                        if (userFuncData.environmentFunction.find(name))
+                            return;
+
+                        userFuncData.environmentFunction[name] = std::make_pair(ty->userFuncData.definition, level);
 
                         if (auto it = astTypeFunctionEnvironmentScopes.find(ty->userFuncData.definition))
                         {
@@ -957,15 +961,35 @@ void ConstraintGenerator::checkAliases(const ScopePtr& scope, AstStatBlock* bloc
                                 scope->bindings[ty->userFuncData.definition->name] = Binding{existing->typeId, ty->userFuncData.definition->location};
                         }
                     }
+                    else if (FFlag::LuauUserTypeFunctionAliases && !get<TypeFunctionInstanceType>(tf.type))
+                    {
+                        if (userFuncData.environmentAlias.find(name))
+                            return;
+
+                        AstName astName = module->names->get(name.c_str());
+
+                        // Only register globals that we have detected to be used
+                        if (!globalNameCollector.names.find(astName))
+                            return;
+
+                        // Function evaluation environment needs a stable reference to the alias
+                        module->typeFunctionAliases.push_back(std::make_unique<TypeFun>(tf));
+
+                        userFuncData.environmentAlias[name] = std::make_pair(module->typeFunctionAliases.back().get(), level);
+
+                        // TODO: create a specific type alias type
+                        scope->bindings[astName] = Binding{builtinTypes->anyType, tf.definitionLocation.value_or(Location())};
+                    }
                 };
 
-                for (Scope* curr = scope.get(); curr; curr = curr->parent.get())
+                // Go up the scopes to register type functions and alises, but without reaching into the global scope
+                for (Scope* curr = scope.get(); curr && (!FFlag::LuauUserTypeFunctionAliases || curr != globalScope.get()); curr = curr->parent.get())
                 {
                     for (auto& [name, tf] : curr->privateTypeBindings)
-                        addToEnvironment(userFuncData, typeFunctionEnvScope, name, tf.type, level);
+                        addToEnvironment(userFuncData, typeFunctionEnvScope, name, tf, level);
 
                     for (auto& [name, tf] : curr->exportedTypeBindings)
-                        addToEnvironment(userFuncData, typeFunctionEnvScope, name, tf.type, level);
+                        addToEnvironment(userFuncData, typeFunctionEnvScope, name, tf, level);
 
                     level++;
                 }
@@ -1396,7 +1420,7 @@ ControlFlow ConstraintGenerator::visit(const ScopePtr& scope, AstStatLocalFuncti
     FunctionSignature sig = checkFunctionSignature(scope, function->func, /* expectedType */ std::nullopt, function->name->location);
     sig.bodyScope->bindings[function->name] = Binding{sig.signature, function->name->location};
 
-    bool sigFullyDefined = FFlag::LuauEagerGeneralization ? false : !hasFreeType(sig.signature);
+    bool sigFullyDefined = FFlag::LuauEagerGeneralization2 ? false : !hasFreeType(sig.signature);
     if (sigFullyDefined)
         emplaceType<BoundType>(asMutable(functionType), sig.signature);
 
@@ -1456,7 +1480,7 @@ ControlFlow ConstraintGenerator::visit(const ScopePtr& scope, AstStatFunction* f
 
     Checkpoint start = checkpoint(this);
     FunctionSignature sig = checkFunctionSignature(scope, function->func, /* expectedType */ std::nullopt, function->name->location);
-    bool sigFullyDefined = FFlag::LuauEagerGeneralization ? false : !hasFreeType(sig.signature);
+    bool sigFullyDefined = FFlag::LuauEagerGeneralization2 ? false : !hasFreeType(sig.signature);
 
     DefId def = dfg->getDef(function->name);
 
@@ -1770,7 +1794,7 @@ ControlFlow ConstraintGenerator::visit(const ScopePtr& scope, AstStatTypeFunctio
     // Place this function as a child of the non-type function scope
     scope->children.push_back(NotNull{sig.signatureScope.get()});
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.emplace_back();
     else
         DEPRECATED_interiorTypes.push_back(std::vector<TypeId>{});
@@ -1788,7 +1812,7 @@ ControlFlow ConstraintGenerator::visit(const ScopePtr& scope, AstStatTypeFunctio
         }
     );
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         sig.signatureScope->interiorFreeTypes = std::move(interiorFreeTypes.back().types);
         sig.signatureScope->interiorFreeTypePacks = std::move(interiorFreeTypes.back().typePacks);
@@ -1797,7 +1821,7 @@ ControlFlow ConstraintGenerator::visit(const ScopePtr& scope, AstStatTypeFunctio
         sig.signatureScope->interiorFreeTypes = std::move(DEPRECATED_interiorTypes.back());
 
     getMutable<BlockedType>(generalizedTy)->setOwner(gc);
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.pop_back();
     else
         DEPRECATED_interiorTypes.pop_back();
@@ -1884,7 +1908,8 @@ ControlFlow ConstraintGenerator::visit(const ScopePtr& scope, AstStatDeclareExte
         {
             reportError(
                 declaredExternType->location,
-                GenericError{format("Cannot use non-class type '%s' as a superclass of class '%s'", superName.c_str(), declaredExternType->name.value)}
+                GenericError{format("Cannot use non-class type '%s' as a superclass of class '%s'", superName.c_str(), declaredExternType->name.value)
+                }
             );
 
             return ControlFlow::None;
@@ -2466,7 +2491,7 @@ Inference ConstraintGenerator::check(const ScopePtr& scope, AstExprConstantStrin
         return Inference{builtinTypes->stringType};
 
     TypeId freeTy = nullptr;
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         freeTy = freshType(scope, Polarity::Positive);
         FreeType* ft = getMutable<FreeType>(freeTy);
@@ -2507,7 +2532,7 @@ Inference ConstraintGenerator::check(const ScopePtr& scope, AstExprConstantBool*
         return Inference{builtinTypes->booleanType};
 
     TypeId freeTy = nullptr;
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         freeTy = freshType(scope, Polarity::Positive);
         FreeType* ft = getMutable<FreeType>(freeTy);
@@ -2605,9 +2630,7 @@ Inference ConstraintGenerator::checkIndexName(
     {
         result = arena->addType(BlockedType{});
 
-        auto c = addConstraint(
-            scope, indexee->location, HasPropConstraint{result, obj, std::move(index), ValueContext::RValue, inConditional(typeContext)}
-        );
+        auto c = addConstraint(scope, indexee->location, HasPropConstraint{result, obj, index, ValueContext::RValue, inConditional(typeContext)});
         getMutable<BlockedType>(result)->setOwner(c);
     }
 
@@ -2668,7 +2691,7 @@ Inference ConstraintGenerator::check(const ScopePtr& scope, AstExprFunction* fun
     Checkpoint startCheckpoint = checkpoint(this);
     FunctionSignature sig = checkFunctionSignature(scope, func, expectedType);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.emplace_back();
     else
         DEPRECATED_interiorTypes.push_back(std::vector<TypeId>{});
@@ -2686,7 +2709,7 @@ Inference ConstraintGenerator::check(const ScopePtr& scope, AstExprFunction* fun
         }
     );
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         sig.signatureScope->interiorFreeTypes = std::move(interiorFreeTypes.back().types);
         sig.signatureScope->interiorFreeTypePacks = std::move(interiorFreeTypes.back().typePacks);
@@ -3190,10 +3213,11 @@ Inference ConstraintGenerator::check(const ScopePtr& scope, AstExprTable* expr,
     ttv->definitionLocation = expr->location;
     ttv->scope = scope.get();
 
-    if (FFlag::LuauDisablePrimitiveInferenceInLargeTables && FInt::LuauPrimitiveInferenceInTableLimit > 0 && expr->items.size > size_t(FInt::LuauPrimitiveInferenceInTableLimit))
+    if (FFlag::LuauDisablePrimitiveInferenceInLargeTables && FInt::LuauPrimitiveInferenceInTableLimit > 0 &&
+        expr->items.size > size_t(FInt::LuauPrimitiveInferenceInTableLimit))
         largeTableDepth++;
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         interiorFreeTypes.back().types.push_back(ty);
     else
         DEPRECATED_interiorTypes.back().push_back(ty);
@@ -3301,7 +3325,8 @@ Inference ConstraintGenerator::check(const ScopePtr& scope, AstExprTable* expr,
         );
     }
 
-    if (FFlag::LuauDisablePrimitiveInferenceInLargeTables && FInt::LuauPrimitiveInferenceInTableLimit > 0 && expr->items.size > size_t(FInt::LuauPrimitiveInferenceInTableLimit))
+    if (FFlag::LuauDisablePrimitiveInferenceInLargeTables && FInt::LuauPrimitiveInferenceInTableLimit > 0 &&
+        expr->items.size > size_t(FInt::LuauPrimitiveInferenceInTableLimit))
         largeTableDepth--;
 
     return Inference{ty};
@@ -3453,7 +3478,7 @@ ConstraintGenerator::FunctionSignature ConstraintGenerator::checkFunctionSignatu
 
     LUAU_ASSERT(nullptr != varargPack);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         // Some of the types in argTypes will eventually be generics, and some
         // will not. The ones that are not generic will be pruned when
@@ -3518,7 +3543,7 @@ ConstraintGenerator::FunctionSignature ConstraintGenerator::checkFunctionSignatu
     if (expectedType && get<FreeType>(*expectedType))
         bindFreeType(*expectedType, actualFunctionType);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         scopeToFunction[signatureScope.get()] = actualFunctionType;
 
     return {
@@ -3809,33 +3834,33 @@ TypeId ConstraintGenerator::resolveType_(const ScopePtr& scope, AstType* ty, boo
     }
     else if (auto unionAnnotation = ty->as<AstTypeUnion>())
     {
-            if (unionAnnotation->types.size == 1)
-                result = resolveType_(scope, unionAnnotation->types.data[0], inTypeArguments);
-            else
+        if (unionAnnotation->types.size == 1)
+            result = resolveType_(scope, unionAnnotation->types.data[0], inTypeArguments);
+        else
+        {
+            std::vector<TypeId> parts;
+            for (AstType* part : unionAnnotation->types)
             {
-                std::vector<TypeId> parts;
-                for (AstType* part : unionAnnotation->types)
-                {
-                    parts.push_back(resolveType_(scope, part, inTypeArguments));
-                }
-
-                result = arena->addType(UnionType{parts});
+                parts.push_back(resolveType_(scope, part, inTypeArguments));
             }
+
+            result = arena->addType(UnionType{parts});
+        }
     }
     else if (auto intersectionAnnotation = ty->as<AstTypeIntersection>())
     {
-            if (intersectionAnnotation->types.size == 1)
-                result = resolveType_(scope, intersectionAnnotation->types.data[0], inTypeArguments);
-            else
+        if (intersectionAnnotation->types.size == 1)
+            result = resolveType_(scope, intersectionAnnotation->types.data[0], inTypeArguments);
+        else
+        {
+            std::vector<TypeId> parts;
+            for (AstType* part : intersectionAnnotation->types)
             {
-                std::vector<TypeId> parts;
-                for (AstType* part : intersectionAnnotation->types)
-                {
-                    parts.push_back(resolveType_(scope, part, inTypeArguments));
-                }
-
-                result = arena->addType(IntersectionType{parts});
+                parts.push_back(resolveType_(scope, part, inTypeArguments));
             }
+
+            result = arena->addType(IntersectionType{parts});
+        }
     }
     else if (auto typeGroupAnnotation = ty->as<AstTypeGroup>())
     {

Analysis/src/ConstraintSolver.cpp

@@ -33,9 +33,8 @@ LUAU_FASTFLAGVARIABLE(DebugLuauLogBindings)
 LUAU_FASTINTVARIABLE(LuauSolverRecursionLimit, 500)
 LUAU_FASTFLAGVARIABLE(DebugLuauEqSatSimplification)
 LUAU_FASTFLAGVARIABLE(LuauHasPropProperBlock)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauDeprecatedAttribute)
-LUAU_FASTFLAG(LuauEagerGeneralization)
 LUAU_FASTFLAGVARIABLE(LuauTrackInferredFunctionTypeFromCall)
 LUAU_FASTFLAGVARIABLE(LuauAddCallConstraintForIterableFunctions)
 LUAU_FASTFLAGVARIABLE(LuauGuardAgainstMalformedTypeAliasExpansion2)
@@ -43,6 +42,7 @@ LUAU_FASTFLAGVARIABLE(LuauInsertErrorTypesIntoIndexerResult)
 LUAU_FASTFLAGVARIABLE(LuauClipVariadicAnysFromArgsToGenericFuncs2)
 LUAU_FASTFLAG(LuauSubtypeGenericsAndNegations)
 LUAU_FASTFLAG(LuauNoMoreInjectiveTypeFunctions)
+LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
 
 namespace Luau
 {
@@ -103,7 +103,7 @@ size_t HashBlockedConstraintId::operator()(const BlockedConstraintId& bci) const
     return true;
 }
 
-static std::pair<std::vector<TypeId>, std::vector<TypePackId>> saturateArguments(
+std::pair<std::vector<TypeId>, std::vector<TypePackId>> saturateArguments(
     TypeArena* arena,
     NotNull<BuiltinTypes> builtinTypes,
     const TypeFun& fn,
@@ -418,7 +418,7 @@ void ConstraintSolver::run()
     }
 
     // Free types that have no constraints at all can be generalized right away.
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         for (TypeId ty : constraintSet.freeTypes)
         {
@@ -479,7 +479,7 @@ void ConstraintSolver::run()
                         // expansion types, etc, so we need to follow it.
                         ty = follow(ty);
 
-                        if (FFlag::LuauEagerGeneralization)
+                        if (FFlag::LuauEagerGeneralization2)
                         {
                             if (seen.contains(ty))
                                 continue;
@@ -498,7 +498,7 @@ void ConstraintSolver::run()
                         if (refCount <= 1)
                             unblock(ty, Location{});
 
-                        if (FFlag::LuauEagerGeneralization && refCount == 0)
+                        if (FFlag::LuauEagerGeneralization2 && refCount == 0)
                             generalizeOneType(ty);
                     }
                 }
@@ -676,7 +676,7 @@ void ConstraintSolver::initFreeTypeTracking()
             auto [refCount, _] = unresolvedConstraints.try_insert(ty, 0);
             refCount += 1;
 
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
             {
                 auto [it, fresh] = mutatedFreeTypeToConstraint.try_emplace(ty, nullptr);
                 it->second.insert(c.get());
@@ -691,7 +691,7 @@ void ConstraintSolver::initFreeTypeTracking()
     }
 
     // Also check flag integrity while we're here
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         LUAU_ASSERT(FFlag::LuauSubtypeGenericsAndNegations);
         LUAU_ASSERT(FFlag::LuauNoMoreInjectiveTypeFunctions);
@@ -739,7 +739,7 @@ void ConstraintSolver::bind(NotNull<const Constraint> constraint, TypeId ty, Typ
             constraint, ty, constraint->scope, builtinTypes->neverType, builtinTypes->unknownType, Polarity::Mixed
         ); // FIXME?  Is this the right polarity?
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
             trackInteriorFreeType(constraint->scope, ty);
 
         return;
@@ -900,7 +900,7 @@ bool ConstraintSolver::tryDispatch(const GeneralizationConstraint& c, NotNull<co
     {
         for (TypeId ty : *constraint->scope->interiorFreeTypes) // NOLINT(bugprone-unchecked-optional-access)
         {
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
             {
                 ty = follow(ty);
                 if (auto freeTy = get<FreeType>(ty))
@@ -922,7 +922,7 @@ bool ConstraintSolver::tryDispatch(const GeneralizationConstraint& c, NotNull<co
         }
     }
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         if (constraint->scope->interiorFreeTypePacks)
         {
@@ -942,7 +942,7 @@ bool ConstraintSolver::tryDispatch(const GeneralizationConstraint& c, NotNull<co
         }
     }
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         if (c.noGenerics)
         {
@@ -1378,7 +1378,6 @@ void ConstraintSolver::fillInDiscriminantTypes(NotNull<const Constraint> constra
         // We also need to unconditionally unblock these types, otherwise
         // you end up with funky looking "Blocked on *no-refine*."
         unblock(*ty, constraint->location);
-
     }
 }
 
@@ -1388,7 +1387,7 @@ bool ConstraintSolver::tryDispatch(const FunctionCallConstraint& c, NotNull<cons
     TypePackId argsPack = follow(c.argsPack);
     TypePackId result = follow(c.result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         if (isBlocked(fn))
             return block(c.fn, constraint);
@@ -1528,7 +1527,7 @@ bool ConstraintSolver::tryDispatch(const FunctionCallConstraint& c, NotNull<cons
 
     const bool occursCheckPassed = u2.unify(overloadToUse, inferredTy);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         for (TypeId freeTy : u2.newFreshTypes)
             trackInteriorFreeType(constraint->scope, freeTy);
@@ -1942,7 +1941,7 @@ bool ConstraintSolver::tryDispatchHasIndexer(
         TypeId upperBound =
             arena->addType(TableType{/* props */ {}, TableIndexer{indexType, resultType}, TypeLevel{}, ft->scope, TableState::Unsealed});
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             TypeId sr = follow(simplifyIntersection(constraint->scope, constraint->location, ft->upperBound, upperBound));
 
@@ -1973,7 +1972,7 @@ bool ConstraintSolver::tryDispatchHasIndexer(
 
             FreeType freeResult{tt->scope, builtinTypes->neverType, builtinTypes->unknownType, Polarity::Mixed};
             emplace<FreeType>(constraint, resultType, freeResult);
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
                 trackInteriorFreeType(constraint->scope, resultType);
 
             tt->indexer = TableIndexer{indexType, resultType};
@@ -2056,7 +2055,6 @@ bool ConstraintSolver::tryDispatchHasIndexer(
             r = follow(r);
             if (FFlag::LuauInsertErrorTypesIntoIndexerResult || !get<ErrorType>(r))
                 results.insert(r);
-
         }
 
         if (0 == results.size())
@@ -2163,7 +2161,7 @@ bool ConstraintSolver::tryDispatch(const AssignPropConstraint& c, NotNull<const
     {
         auto lhsFreeUpperBound = follow(lhsFree->upperBound);
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             const auto [blocked, maybeTy, isIndex] = lookupTableProp(constraint, lhsType, propName, ValueContext::LValue);
             if (!blocked.empty())
@@ -3064,7 +3062,7 @@ TablePropLookupResult ConstraintSolver::lookupTableProp(
     {
         const TypeId upperBound = follow(ft->upperBound);
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             if (get<TableType>(upperBound) || get<PrimitiveType>(upperBound))
             {
@@ -3532,7 +3530,7 @@ void ConstraintSolver::shiftReferences(TypeId source, TypeId target)
 
     // Any constraint that might have mutated source may now mutate target
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         auto it = mutatedFreeTypeToConstraint.find(source);
         if (it != mutatedFreeTypeToConstraint.end())

Analysis/src/Error.cpp

@@ -18,7 +18,7 @@
 #include <unordered_set>
 
 LUAU_FASTINTVARIABLE(LuauIndentTypeMismatchMaxTypeLength, 10)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 LUAU_FASTFLAGVARIABLE(LuauBetterCannotCallFunctionPrimitive)
 
@@ -663,7 +663,7 @@ struct ErrorConverter
         }
 
         // binary operators
-        const auto binaryOps = FFlag::LuauEagerGeneralization ? kBinaryOps : DEPRECATED_kBinaryOps;
+        const auto binaryOps = FFlag::LuauEagerGeneralization2 ? kBinaryOps : DEPRECATED_kBinaryOps;
         if (auto binaryString = binaryOps.find(tfit->function->name); binaryString != binaryOps.end())
         {
             std::string result = "Operator '" + std::string(binaryString->second) + "' could not be applied to operands of types ";
@@ -718,10 +718,10 @@ struct ErrorConverter
                        "'";
         }
 
-        if ((FFlag::LuauEagerGeneralization ? kUnreachableTypeFunctions : DEPRECATED_kUnreachableTypeFunctions).count(tfit->function->name))
+        if ((FFlag::LuauEagerGeneralization2 ? kUnreachableTypeFunctions : DEPRECATED_kUnreachableTypeFunctions).count(tfit->function->name))
         {
             return "Type function instance " + Luau::toString(e.ty) + " is uninhabited\n" +
-                "This is likely to be a bug, please report it at https://github.com/luau-lang/luau/issues";
+                   "This is likely to be a bug, please report it at https://github.com/luau-lang/luau/issues";
         }
 
         // Everything should be specialized above to report a more descriptive error that hopefully does not mention "type functions" explicitly.

Analysis/src/ExpectedTypeVisitor.cpp

@@ -0,0 +1,213 @@
+// This file is part of the Luau programming language and is licensed under MIT License; see LICENSE.txt for details
+#include "Luau/ExpectedTypeVisitor.h"
+
+#include "Luau/Scope.h"
+#include "Luau/TypeArena.h"
+#include "Luau/TypePack.h"
+#include "Luau/TypeUtils.h"
+
+namespace Luau
+{
+
+ExpectedTypeVisitor::ExpectedTypeVisitor(
+    NotNull<DenseHashMap<const AstExpr*, TypeId>> astTypes,
+    NotNull<DenseHashMap<const AstExpr*, TypeId>> astExpectedTypes,
+    NotNull<DenseHashMap<const AstType*, TypeId>> astResolvedTypes,
+    NotNull<TypeArena> arena,
+    NotNull<BuiltinTypes> builtinTypes,
+    NotNull<Scope> rootScope
+)
+    : astTypes(astTypes)
+    , astExpectedTypes(astExpectedTypes)
+    , astResolvedTypes(astResolvedTypes)
+    , arena(arena)
+    , builtinTypes(builtinTypes)
+    , rootScope(rootScope)
+{
+}
+
+bool ExpectedTypeVisitor::visit(AstStatAssign* stat)
+{
+    for (size_t idx = 0; idx < std::min(stat->vars.size, stat->values.size); idx++)
+    {
+        if (auto lhsType = astTypes->find(stat->vars.data[idx]))
+            applyExpectedType(*lhsType, stat->values.data[idx]);
+    }
+    return true;
+}
+
+bool ExpectedTypeVisitor::visit(AstStatLocal* stat)
+{
+    for (size_t idx = 0; idx < std::min(stat->vars.size, stat->values.size); idx++)
+    {
+        if (auto annot = astResolvedTypes->find(stat->vars.data[idx]->annotation))
+            applyExpectedType(*annot, stat->values.data[idx]);
+    }
+    return true;
+}
+
+bool ExpectedTypeVisitor::visit(AstStatCompoundAssign* stat)
+{
+    if (auto lhsType = astTypes->find(stat->var))
+        applyExpectedType(*lhsType, stat->value);
+    return true;
+}
+
+bool ExpectedTypeVisitor::visit(AstStatReturn* stat)
+{
+    auto scope = rootScope->findNarrowestScopeContaining(stat->location);
+
+    auto it = begin(scope->returnType);
+    size_t idx = 0;
+
+    while (idx < stat->list.size && it != end(scope->returnType))
+    {
+        applyExpectedType(*it, stat->list.data[idx]);
+        it++;
+        idx++;
+    }
+
+    return true;
+}
+
+bool ExpectedTypeVisitor::visit(AstExprCall* expr)
+{
+    auto ty = astTypes->find(expr->func);
+    if (!ty)
+        return true;
+
+    const FunctionType* ftv = get<FunctionType>(follow(*ty));
+
+    // FIXME: Bidirectional type checking of overloaded functions is not yet
+    // supported, which means we *also* do not provide autocomplete for
+    // the arguments of overloaded functions.
+    if (!ftv)
+        return true;
+
+    auto it = begin(ftv->argTypes);
+    size_t idx = 0;
+
+    if (expr->self && it != end(ftv->argTypes))
+    {
+        // If we have a `foo:bar(...)` call, then the first type in the arg
+        // pack will be the type of `self`, so we just skip that.
+        it++;
+    }
+
+    while (idx < expr->args.size && it != end(ftv->argTypes))
+    {
+        applyExpectedType(*it, expr->args.data[idx]);
+        it++;
+        idx++;
+    }
+
+    return true;
+}
+
+bool ExpectedTypeVisitor::visit(AstExprTypeAssertion* expr)
+{
+    if (auto annot = astResolvedTypes->find(expr->annotation))
+        applyExpectedType(*annot, expr->expr);
+
+    return true;
+}
+
+void ExpectedTypeVisitor::applyExpectedType(TypeId expectedType, const AstExpr* expr)
+{
+    expectedType = follow(expectedType);
+
+    // No matter what, we set the expected type of the current expression to
+    // whatever was just passed in. We may traverse the type and do more.
+    (*astExpectedTypes)[expr] = expectedType;
+
+    if (const auto exprTable = expr->as<AstExprTable>())
+    {
+        const auto expectedTableType = get<TableType>(expectedType);
+        if (!expectedTableType)
+        {
+            if (auto utv = get<UnionType>(expectedType))
+            {
+                if (auto exprType = astTypes->find(expr))
+                {
+                    std::vector<TypeId> parts{begin(utv), end(utv)};
+                    if (auto tt = extractMatchingTableType(parts, *exprType, builtinTypes))
+                    {
+                        applyExpectedType(*tt, expr);
+                        return;
+                    }
+                }
+            }
+            return;
+        }
+
+        // If we have a table, then the expected type for any given key is a
+        // union between all the possible keys and an indexer type (if it exists).
+        std::vector<TypeId> possibleKeyTypes;
+        possibleKeyTypes.reserve(expectedTableType->props.size() + (expectedTableType->indexer ? 1 : 0));
+        for (const auto& [name, _] : expectedTableType->props)
+        {
+            possibleKeyTypes.push_back(arena->addType(SingletonType{StringSingleton{name}}));
+        }
+
+        if (expectedTableType->indexer)
+            possibleKeyTypes.push_back(expectedTableType->indexer->indexType);
+
+        TypeId expectedKeyType = nullptr;
+        if (possibleKeyTypes.size() == 0)
+            expectedKeyType = builtinTypes->neverType;
+        else if (possibleKeyTypes.size() == 1)
+            expectedKeyType = possibleKeyTypes[0];
+        else
+            expectedKeyType = arena->addType(UnionType{std::move(possibleKeyTypes)});
+
+        for (const AstExprTable::Item& item : exprTable->items)
+        {
+            if (isRecord(item))
+            {
+                const AstArray<char>& s = item.key->as<AstExprConstantString>()->value;
+                std::string keyStr{s.data, s.data + s.size};
+
+                // No mater what, we can claim that the expected key type is the
+                // union of all possible props plus the indexer.
+                applyExpectedType(expectedKeyType, item.key);
+
+                // - If the property is defined and has a read type, apply it
+                //   as an expected type. e.g.:
+                //
+                //      -- _ will have expected type `number`
+                //      local t: { [string]: number, write foo: boolean } = { foo = _ }
+                //
+                // - Otherwise if the property has an indexer, apply the result type.
+                // - Otherwise do nothing.
+                if (auto it = expectedTableType->props.find(keyStr); it != expectedTableType->props.end() && it->second.readTy)
+                {
+                    applyExpectedType(*it->second.readTy, item.value);
+                }
+                else if (expectedTableType->indexer)
+                {
+                    applyExpectedType(expectedTableType->indexer->indexResultType, item.value);
+                }
+            }
+            else if (item.kind == AstExprTable::Item::List && expectedTableType->indexer)
+            {
+                applyExpectedType(expectedTableType->indexer->indexResultType, item.value);
+            }
+            else if (item.kind == AstExprTable::Item::General && expectedTableType->indexer)
+            {
+                applyExpectedType(expectedTableType->indexer->indexResultType, item.value);
+                applyExpectedType(expectedKeyType, item.key);
+            }
+        }
+    }
+    else if (auto group = expr->as<AstExprGroup>())
+    {
+        applyExpectedType(expectedType, group->expr);
+    }
+    else if (auto ternary = expr->as<AstExprIfElse>())
+    {
+        applyExpectedType(expectedType, ternary->trueExpr);
+        applyExpectedType(expectedType, ternary->falseExpr);
+    }
+}
+
+} // namespace Luau

Analysis/src/FragmentAutocomplete.cpp

@@ -6,6 +6,7 @@
 #include "Luau/Autocomplete.h"
 #include "Luau/Common.h"
 #include "Luau/EqSatSimplification.h"
+#include "Luau/ExpectedTypeVisitor.h"
 #include "Luau/ModuleResolver.h"
 #include "Luau/Parser.h"
 #include "Luau/ParseOptions.h"
@@ -35,6 +36,8 @@ LUAU_FASTFLAGVARIABLE(LuauFragmentAcMemoryLeak)
 LUAU_FASTFLAGVARIABLE(LuauGlobalVariableModuleIsolation)
 LUAU_FASTFLAG(LuauStoreReturnTypesAsPackOnAst)
 LUAU_FASTFLAGVARIABLE(LuauFragmentAutocompleteIfRecommendations)
+LUAU_FASTFLAG(LuauExpectedTypeVisitor)
+LUAU_FASTFLAGVARIABLE(LuauPopulateRefinedTypesInFragmentFromOldSolver)
 
 namespace Luau
 {
@@ -669,6 +672,7 @@ void cloneTypesFromFragment(
             destScope->lvalueTypes[d] = Luau::cloneIncremental(*lValue, *destArena, cloneState, destScope);
         }
     }
+
     for (const auto& [d, loc] : f.localBindingsReferenced)
     {
         if (std::optional<std::pair<Symbol, Binding>> pair = staleScope->linearSearchForBindingPair(loc->name.value, true))
@@ -685,6 +689,21 @@ void cloneTypesFromFragment(
         }
     }
 
+    if (FFlag::LuauPopulateRefinedTypesInFragmentFromOldSolver && !staleModule->checkedInNewSolver)
+    {
+        for (const auto& [d, loc] : f.localBindingsReferenced)
+        {
+            for (const Scope* stale = staleScope; stale; stale = stale->parent.get())
+            {
+                if (auto res = stale->refinements.find(Symbol(loc)); res != stale->refinements.end())
+                {
+                    destScope->rvalueRefinements[d] = Luau::cloneIncremental(res->second, *destArena, cloneState, destScope);
+                    break;
+                }
+            }
+        }
+    }
+
     // Second - any referenced type alias bindings need to be placed in scope so type annotation can be resolved.
     // If the actual type alias appears in the fragment on the lhs as a definition (in declaredAliases), it will be processed during typechecking
     // anyway
@@ -1191,6 +1210,19 @@ FragmentTypeCheckResult typecheckFragment_(
 
     reportWaypoint(reporter, FragmentAutocompleteWaypoint::ConstraintSolverEnd);
 
+    if (FFlag::LuauExpectedTypeVisitor)
+    {
+        ExpectedTypeVisitor etv{
+            NotNull{&incrementalModule->astTypes},
+            NotNull{&incrementalModule->astExpectedTypes},
+            NotNull{&incrementalModule->astResolvedTypes},
+            NotNull{&incrementalModule->internalTypes},
+            frontend.builtinTypes,
+            NotNull{freshChildOfNearestScope.get()}
+        };
+        root->visit(&etv);
+    }
+
     // In frontend we would forbid internal types
     // because this is just for autocomplete, we don't actually care
     // We also don't even need to typecheck - just synthesize types as best as we can
@@ -1243,7 +1275,8 @@ std::pair<FragmentTypeCheckStatus, FragmentTypeCheckResult> typecheckFragment(
     FrontendOptions frontendOptions = opts.value_or(frontend.options);
     const ScopePtr& closestScope = FFlag::LuauBetterScopeSelection ? findClosestScope(module, parseResult.scopePos)
                                                                    : findClosestScope_DEPRECATED(module, parseResult.nearestStatement);
-    FragmentTypeCheckResult result = typecheckFragment_(frontend, parseResult.root, module, closestScope, cursorPos, std::move(parseResult.alloc), frontendOptions, reporter);
+    FragmentTypeCheckResult result =
+        typecheckFragment_(frontend, parseResult.root, module, closestScope, cursorPos, std::move(parseResult.alloc), frontendOptions, reporter);
     result.ancestry = std::move(parseResult.ancestry);
     reportFragmentString(reporter, tryParse->fragmentToParse);
     return {FragmentTypeCheckStatus::Success, result};

Analysis/src/Frontend.cpp

@@ -10,6 +10,7 @@
 #include "Luau/DataFlowGraph.h"
 #include "Luau/DcrLogger.h"
 #include "Luau/EqSatSimplification.h"
+#include "Luau/ExpectedTypeVisitor.h"
 #include "Luau/FileResolver.h"
 #include "Luau/NonStrictTypeChecker.h"
 #include "Luau/NotNull.h"
@@ -39,13 +40,14 @@ LUAU_FASTINT(LuauTarjanChildLimit)
 LUAU_FASTFLAG(LuauInferInNoCheckMode)
 LUAU_FASTFLAGVARIABLE(LuauKnowsTheDataModel3)
 LUAU_FASTFLAG(LuauSolverV2)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAGVARIABLE(DebugLuauLogSolverToJson)
 LUAU_FASTFLAGVARIABLE(DebugLuauLogSolverToJsonFile)
 LUAU_FASTFLAGVARIABLE(DebugLuauForbidInternalTypes)
 LUAU_FASTFLAGVARIABLE(DebugLuauForceStrictMode)
 LUAU_FASTFLAGVARIABLE(DebugLuauForceNonStrictMode)
 LUAU_FASTFLAGVARIABLE(LuauNewSolverTypecheckCatchTimeouts)
+LUAU_FASTFLAGVARIABLE(LuauExpectedTypeVisitor)
 
 namespace Luau
 {
@@ -1436,13 +1438,13 @@ ModulePtr check(
         requireCycles
     };
 
-    // FIXME: Delete this flag when clipping FFlag::LuauEagerGeneralization.
+    // FIXME: Delete this flag when clipping FFlag::LuauEagerGeneralization2.
     //
     // This optional<> only exists so that we can run one constructor when the flag
     // is set, and another when it is unset.
     std::optional<ConstraintSolver> cs;
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         ConstraintSet constraintSet = cg.run(sourceModule.root);
         result->errors = std::move(constraintSet.errors);
@@ -1610,6 +1612,19 @@ ModulePtr check(
         };
     }
 
+    if (FFlag::LuauExpectedTypeVisitor)
+    {
+        ExpectedTypeVisitor etv{
+            NotNull{&result->astTypes},
+            NotNull{&result->astExpectedTypes},
+            NotNull{&result->astResolvedTypes},
+            NotNull{&result->internalTypes},
+            builtinTypes,
+            NotNull{parentScope.get()}
+        };
+        sourceModule.root->visit(&etv);
+    }
+
     unfreeze(result->interfaceTypes);
     result->clonePublicInterface(builtinTypes, *iceHandler);
 

Analysis/src/Generalization.cpp

@@ -16,7 +16,7 @@
 
 LUAU_FASTFLAG(LuauEnableWriteOnlyProperties)
 
-LUAU_FASTFLAGVARIABLE(LuauEagerGeneralization)
+LUAU_FASTFLAGVARIABLE(LuauEagerGeneralization2)
 
 namespace Luau
 {
@@ -469,7 +469,7 @@ struct FreeTypeSearcher : TypeVisitor
 
     bool visit(TypeId ty, const FreeType& ft) override
     {
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             if (!subsumes(scope, ft.scope))
                 return true;
@@ -520,7 +520,7 @@ struct FreeTypeSearcher : TypeVisitor
 
         if ((tt.state == TableState::Free || tt.state == TableState::Unsealed) && subsumes(scope, tt.scope))
         {
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
                 unsealedTables.insert(ty);
             else
             {
@@ -574,7 +574,6 @@ struct FreeTypeSearcher : TypeVisitor
                     traverse(*prop.writeTy);
                     polarity = p;
                 }
-
             }
             else
             {
@@ -594,7 +593,7 @@ struct FreeTypeSearcher : TypeVisitor
 
         if (tt.indexer)
         {
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
             {
                 // {[K]: V} is equivalent to three functions: get, set, and iterate
                 //
@@ -652,7 +651,7 @@ struct FreeTypeSearcher : TypeVisitor
         if (!subsumes(scope, ftp.scope))
             return true;
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             GeneralizationParams<TypePackId>& params = typePacks[tp];
             ++params.useCount;
@@ -1247,8 +1246,7 @@ struct RemoveType : Substitution // NOLINT
  * @param needle The type to be removed.
  */
 [[nodiscard]]
-static std::optional<
-    TypeId> removeType(NotNull<TypeArena> arena, NotNull<BuiltinTypes> builtinTypes, TypeId haystack, TypeId needle)
+static std::optional<TypeId> removeType(NotNull<TypeArena> arena, NotNull<BuiltinTypes> builtinTypes, TypeId haystack, TypeId needle)
 {
     RemoveType rt{builtinTypes, arena, needle};
     return rt.substitute(haystack);
@@ -1276,7 +1274,7 @@ GeneralizationResult<TypeId> generalizeType(
 
     if (!hasLowerBound && !hasUpperBound)
     {
-        if (!isWithinFunction || (!FFlag::LuauEagerGeneralization && (params.polarity != Polarity::Mixed && params.useCount == 1)))
+        if (!isWithinFunction || (!FFlag::LuauEagerGeneralization2 && (params.polarity != Polarity::Mixed && params.useCount == 1)))
             emplaceType<BoundType>(asMutable(freeTy), builtinTypes->unknownType);
         else
         {
@@ -1308,7 +1306,7 @@ GeneralizationResult<TypeId> generalizeType(
 
         if (follow(lb) != freeTy)
             emplaceType<BoundType>(asMutable(freeTy), lb);
-        else if (!isWithinFunction || (!FFlag::LuauEagerGeneralization && params.useCount == 1))
+        else if (!isWithinFunction || (!FFlag::LuauEagerGeneralization2 && params.useCount == 1))
             emplaceType<BoundType>(asMutable(freeTy), builtinTypes->unknownType);
         else
         {
@@ -1425,7 +1423,7 @@ std::optional<TypeId> generalize(
     FreeTypeSearcher fts{scope, cachedTypes};
     fts.traverse(ty);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         FunctionType* functionTy = getMutable<FunctionType>(ty);
         auto pushGeneric = [&](TypeId t)
@@ -1586,7 +1584,6 @@ struct GenericCounter : TypeVisitor
                     traverse(*prop.writeTy);
                     polarity = p;
                 }
-
             }
             else
             {
@@ -1653,7 +1650,7 @@ void pruneUnnecessaryGenerics(
     TypeId ty
 )
 {
-    if (!FFlag::LuauEagerGeneralization)
+    if (!FFlag::LuauEagerGeneralization2)
         return;
 
     ty = follow(ty);

Analysis/src/InferPolarity.cpp

@@ -5,7 +5,7 @@
 #include "Luau/Scope.h"
 #include "Luau/VisitType.h"
 
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 namespace Luau
 {
@@ -133,7 +133,7 @@ struct InferPolarity : TypeVisitor
 template<typename TID>
 static void inferGenericPolarities_(NotNull<TypeArena> arena, NotNull<Scope> scope, TID ty)
 {
-    if (!FFlag::LuauEagerGeneralization)
+    if (!FFlag::LuauEagerGeneralization2)
         return;
 
     InferPolarity infer{arena, scope};

Analysis/src/Linter.cpp

@@ -2294,36 +2294,36 @@ private:
 
     bool visit(AstExprLocal* node) override
     {
-            const FunctionType* fty = getFunctionType(node);
-            bool shouldReport = fty && fty->isDeprecatedFunction && !inScope(fty);
+        const FunctionType* fty = getFunctionType(node);
+        bool shouldReport = fty && fty->isDeprecatedFunction && !inScope(fty);
 
-            if (shouldReport)
-                report(node->location, node->local->name.value);
+        if (shouldReport)
+            report(node->location, node->local->name.value);
 
         return true;
     }
 
     bool visit(AstExprGlobal* node) override
     {
-            const FunctionType* fty = getFunctionType(node);
-            bool shouldReport = fty && fty->isDeprecatedFunction && !inScope(fty);
+        const FunctionType* fty = getFunctionType(node);
+        bool shouldReport = fty && fty->isDeprecatedFunction && !inScope(fty);
 
-            if (shouldReport)
-                report(node->location, node->name.value);
+        if (shouldReport)
+            report(node->location, node->name.value);
 
         return true;
     }
 
     bool visit(AstStatLocalFunction* node) override
     {
-            check(node->func);
-            return false;
+        check(node->func);
+        return false;
     }
 
     bool visit(AstStatFunction* node) override
     {
-            check(node->func);
-            return false;
+        check(node->func);
+        return false;
     }
 
     bool visit(AstExprIndexName* node) override

Analysis/src/Module.cpp

@@ -15,7 +15,7 @@
 #include <algorithm>
 
 LUAU_FASTFLAG(LuauSolverV2);
-LUAU_FASTFLAG(LuauRetainDefinitionAliasLocations)
+LUAU_FASTFLAG(LuauUserTypeFunctionAliases)
 
 namespace Luau
 {
@@ -265,10 +265,7 @@ struct ClonePublicInterface : Substitution
 
         TypeId type = cloneType(tf.type);
 
-        if (FFlag::LuauRetainDefinitionAliasLocations)
-            return TypeFun{typeParams, typePackParams, type, tf.definitionLocation};
-        else
-            return TypeFun{typeParams, typePackParams, type};
+        return TypeFun{typeParams, typePackParams, type, tf.definitionLocation};
     }
 };
 
@@ -309,6 +306,14 @@ void Module::clonePublicInterface(NotNull<BuiltinTypes> builtinTypes, InternalEr
         ty = clonePublicInterface.cloneType(ty);
     }
 
+    if (FFlag::LuauUserTypeFunctionAliases)
+    {
+        for (auto& tf : typeFunctionAliases)
+        {
+            *tf = clonePublicInterface.cloneTypeFun(*tf);
+        }
+    }
+
     // Copy external stuff over to Module itself
     this->returnType = moduleScope->returnType;
     this->exportedTypeBindings = moduleScope->exportedTypeBindings;

Analysis/src/NonStrictTypeChecker.cpp

@@ -24,6 +24,7 @@ LUAU_FASTFLAG(DebugLuauMagicTypes)
 
 LUAU_FASTFLAGVARIABLE(LuauNewNonStrictVisitTypes2)
 LUAU_FASTFLAG(LuauStoreReturnTypesAsPackOnAst)
+LUAU_FASTFLAGVARIABLE(LuauNewNonStrictFixGenericTypePacks)
 
 namespace Luau
 {
@@ -1091,23 +1092,42 @@ struct NonStrictTypeChecker
         Scope* scope = findInnermostScope(tp->location);
         LUAU_ASSERT(scope);
 
-        std::optional<TypePackId> alias = scope->lookupPack(tp->genericName.value);
-        if (!alias.has_value())
+        if (FFlag::LuauNewNonStrictFixGenericTypePacks)
         {
+            if (std::optional<TypePackId> alias = scope->lookupPack(tp->genericName.value))
+                return;
+
             if (scope->lookupType(tp->genericName.value))
-            {
-                reportError(
+                return reportError(
                     SwappedGenericTypeParameter{
                         tp->genericName.value,
                         SwappedGenericTypeParameter::Kind::Pack,
                     },
                     tp->location
                 );
-            }
+
+            reportError(UnknownSymbol{tp->genericName.value, UnknownSymbol::Context::Type}, tp->location);
         }
         else
         {
-            reportError(UnknownSymbol{tp->genericName.value, UnknownSymbol::Context::Type}, tp->location);
+            std::optional<TypePackId> alias = scope->lookupPack(tp->genericName.value);
+            if (!alias.has_value())
+            {
+                if (scope->lookupType(tp->genericName.value))
+                {
+                    reportError(
+                        SwappedGenericTypeParameter{
+                            tp->genericName.value,
+                            SwappedGenericTypeParameter::Kind::Pack,
+                        },
+                        tp->location
+                    );
+                }
+            }
+            else
+            {
+                reportError(UnknownSymbol{tp->genericName.value, UnknownSymbol::Context::Type}, tp->location);
+            }
         }
     }
 

Analysis/src/Normalize.cpp

@@ -33,150 +33,6 @@ static bool shouldEarlyExit(NormalizationResult res)
     return false;
 }
 
-TypeIds::TypeIds(std::initializer_list<TypeId> tys)
-{
-    for (TypeId ty : tys)
-        insert(ty);
-}
-
-void TypeIds::insert(TypeId ty)
-{
-    ty = follow(ty);
-
-    // get a reference to the slot for `ty` in `types`
-    bool& entry = types[ty];
-
-    // if `ty` is fresh, we can set it to `true`, add it to the order and hash and be done.
-    if (!entry)
-    {
-        entry = true;
-        order.push_back(ty);
-        hash ^= std::hash<TypeId>{}(ty);
-    }
-}
-
-void TypeIds::clear()
-{
-    order.clear();
-    types.clear();
-    hash = 0;
-}
-
-TypeId TypeIds::front() const
-{
-    return order.at(0);
-}
-
-TypeIds::iterator TypeIds::begin()
-{
-    return order.begin();
-}
-
-TypeIds::iterator TypeIds::end()
-{
-    return order.end();
-}
-
-TypeIds::const_iterator TypeIds::begin() const
-{
-    return order.begin();
-}
-
-TypeIds::const_iterator TypeIds::end() const
-{
-    return order.end();
-}
-
-TypeIds::iterator TypeIds::erase(TypeIds::const_iterator it)
-{
-    TypeId ty = *it;
-    types[ty] = false;
-    hash ^= std::hash<TypeId>{}(ty);
-    return order.erase(it);
-}
-
-void TypeIds::erase(TypeId ty)
-{
-    const_iterator it = std::find(order.begin(), order.end(), ty);
-    if (it == order.end())
-        return;
-
-    erase(it);
-}
-
-size_t TypeIds::size() const
-{
-    return order.size();
-}
-
-bool TypeIds::empty() const
-{
-    return order.empty();
-}
-
-size_t TypeIds::count(TypeId ty) const
-{
-    ty = follow(ty);
-    const bool* val = types.find(ty);
-    return (val && *val) ? 1 : 0;
-}
-
-void TypeIds::retain(const TypeIds& there)
-{
-    for (auto it = begin(); it != end();)
-    {
-        if (there.count(*it))
-            it++;
-        else
-            it = erase(it);
-    }
-}
-
-size_t TypeIds::getHash() const
-{
-    return hash;
-}
-
-bool TypeIds::isNever() const
-{
-    return std::all_of(
-        begin(),
-        end(),
-        [&](TypeId i)
-        {
-            // If each typeid is never, then I guess typeid's is also never?
-            return get<NeverType>(i) != nullptr;
-        }
-    );
-}
-
-bool TypeIds::operator==(const TypeIds& there) const
-{
-    // we can early return if the hashes don't match.
-    if (hash != there.hash)
-        return false;
-
-    // we have to check equality of the sets themselves if not.
-
-    // if the sets are unequal sizes, then they cannot possibly be equal.
-    // it is important to use `order` here and not `types` since the mappings
-    // may have different sizes since removal is not possible, and so erase
-    // simply writes `false` into the map.
-    if (order.size() != there.order.size())
-        return false;
-
-    // otherwise, we'll need to check that every element we have here is in `there`.
-    for (auto ty : order)
-    {
-        // if it's not, we'll return `false`
-        if (there.count(ty) == 0)
-            return false;
-    }
-
-    // otherwise, we've proven the two equal!
-    return true;
-}
-
 NormalizedStringType::NormalizedStringType() {}
 
 NormalizedStringType::NormalizedStringType(bool isCofinite, std::map<std::string, TypeId> singletons)

Analysis/src/Scope.cpp

@@ -255,6 +255,29 @@ bool Scope::shouldWarnGlobal(std::string name) const
     return false;
 }
 
+NotNull<Scope> Scope::findNarrowestScopeContaining(Location location)
+{
+    Scope* bestScope = this;
+
+    bool didNarrow;
+    do
+    {
+        didNarrow = false;
+        for (auto scope : bestScope->children)
+        {
+            if (scope->location.encloses(location))
+            {
+                bestScope = scope.get();
+                didNarrow = true;
+                break;
+            }
+        }
+    } while (didNarrow && bestScope->children.size() > 0);
+
+    return NotNull{bestScope};
+}
+
+
 bool subsumesStrict(Scope* left, Scope* right)
 {
     while (right)

Analysis/src/Subtyping.cpp

@@ -21,7 +21,7 @@ LUAU_FASTFLAGVARIABLE(DebugLuauSubtypingCheckPathValidity)
 LUAU_FASTINTVARIABLE(LuauSubtypingReasoningLimit, 100)
 LUAU_FASTFLAGVARIABLE(LuauSubtypeGenericsAndNegations)
 LUAU_FASTFLAG(LuauClipVariadicAnysFromArgsToGenericFuncs2)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 namespace Luau
 {
@@ -675,20 +675,21 @@ SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, TypeId sub
         result.isSubtype = ok;
         result.isCacheable = false;
     }
-    else if (auto superGeneric = get<GenericType>(superTy); FFlag::LuauSubtypeGenericsAndNegations && superGeneric && variance == Variance::Contravariant)
+    else if (auto superGeneric = get<GenericType>(superTy);
+             FFlag::LuauSubtypeGenericsAndNegations && superGeneric && variance == Variance::Contravariant)
     {
         bool ok = bindGeneric(env, subTy, superTy);
         result.isSubtype = ok;
         result.isCacheable = false;
     }
-    else if (auto pair = get2<FreeType, FreeType>(subTy, superTy); FFlag::LuauEagerGeneralization && pair)
+    else if (auto pair = get2<FreeType, FreeType>(subTy, superTy); FFlag::LuauEagerGeneralization2 && pair)
     {
         // Any two free types are potentially subtypes of one another because
         // both of them could be narrowed to never.
         result = {true};
         result.assumedConstraints.emplace_back(SubtypeConstraint{subTy, superTy});
     }
-    else if (auto superFree = get<FreeType>(superTy); superFree && FFlag::LuauEagerGeneralization)
+    else if (auto superFree = get<FreeType>(superTy); superFree && FFlag::LuauEagerGeneralization2)
     {
         // Given SubTy <: (LB <: SuperTy <: UB)
         //
@@ -703,7 +704,7 @@ SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, TypeId sub
         if (result.isSubtype)
             result.assumedConstraints.emplace_back(SubtypeConstraint{subTy, superTy});
     }
-    else if (auto subFree = get<FreeType>(subTy); subFree && FFlag::LuauEagerGeneralization)
+    else if (auto subFree = get<FreeType>(subTy); subFree && FFlag::LuauEagerGeneralization2)
     {
         // Given (LB <: SubTy <: UB) <: SuperTy
         //
@@ -767,7 +768,8 @@ SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, TypeId sub
         result.isSubtype = ok;
         result.isCacheable = false;
     }
-    else if (auto superGeneric = get<GenericType>(superTy); !FFlag::LuauSubtypeGenericsAndNegations && superGeneric && variance == Variance::Contravariant)
+    else if (auto superGeneric = get<GenericType>(superTy);
+             !FFlag::LuauSubtypeGenericsAndNegations && superGeneric && variance == Variance::Contravariant)
     {
         bool ok = bindGeneric(env, subTy, superTy);
         result.isSubtype = ok;
@@ -1450,7 +1452,7 @@ SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, const Tabl
 {
     SubtypingResult result{true};
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         if (subTable->props.empty() && !subTable->indexer && subTable->state == TableState::Sealed && superTable->indexer)
         {
@@ -1506,7 +1508,7 @@ SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, const Tabl
     {
         if (subTable->indexer)
             result.andAlso(isInvariantWith(env, *subTable->indexer, *superTable->indexer, scope));
-        else if (FFlag::LuauEagerGeneralization && subTable->state != TableState::Sealed)
+        else if (FFlag::LuauEagerGeneralization2 && subTable->state != TableState::Sealed)
         {
             // As above, we assume that {| |} <: {T} because the unsealed table
             // on the left will eventually gain the necessary indexer.
@@ -1548,7 +1550,12 @@ SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, const Meta
     }
 }
 
-SubtypingResult Subtyping::isCovariantWith(SubtypingEnvironment& env, const ExternType* subExternType, const ExternType* superExternType, NotNull<Scope> scope)
+SubtypingResult Subtyping::isCovariantWith(
+    SubtypingEnvironment& env,
+    const ExternType* subExternType,
+    const ExternType* superExternType,
+    NotNull<Scope> scope
+)
 {
     return {isSubclass(subExternType, superExternType)};
 }
@@ -1737,9 +1744,8 @@ SubtypingResult Subtyping::isCovariantWith(
 
     SubtypingResult result = isCovariantWith(env, subNorm->tops, superNorm->tops, scope);
     result.andAlso(isCovariantWith(env, subNorm->booleans, superNorm->booleans, scope));
-    result.andAlso(
-        isCovariantWith(env, subNorm->externTypes, superNorm->externTypes, scope).orElse(isCovariantWith(env, subNorm->externTypes, superNorm->tables, scope))
-    );
+    result.andAlso(isCovariantWith(env, subNorm->externTypes, superNorm->externTypes, scope)
+                       .orElse(isCovariantWith(env, subNorm->externTypes, superNorm->tables, scope)));
     result.andAlso(isCovariantWith(env, subNorm->errors, superNorm->errors, scope));
     result.andAlso(isCovariantWith(env, subNorm->nils, superNorm->nils, scope));
     result.andAlso(isCovariantWith(env, subNorm->numbers, superNorm->numbers, scope));

Analysis/src/TableLiteralInference.cpp

@@ -19,16 +19,6 @@ LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
 namespace Luau
 {
 
-static bool isRecord(const AstExprTable::Item& item)
-{
-    if (item.kind == AstExprTable::Item::Record)
-        return true;
-    else if (item.kind == AstExprTable::Item::General && item.key->is<AstExprConstantString>())
-        return true;
-    else
-        return false;
-}
-
 TypeId matchLiteralType(
     NotNull<DenseHashMap<const AstExpr*, TypeId>> astTypes,
     NotNull<DenseHashMap<const AstExpr*, TypeId>> astExpectedTypes,

Analysis/src/Transpiler.cpp

@@ -1381,7 +1381,11 @@ struct Printer
             LUAU_ASSERT(!forVarArg);
             if (const auto cstNode = lookupCstNode<CstTypePackExplicit>(explicitTp))
                 visualizeTypeList(
-                    explicitTp->typeList, FFlag::LuauStoreReturnTypesAsPackOnAst ? cstNode->hasParentheses : true, cstNode->openParenthesesPosition, cstNode->closeParenthesesPosition, cstNode->commaPositions
+                    explicitTp->typeList,
+                    FFlag::LuauStoreReturnTypesAsPackOnAst ? cstNode->hasParentheses : true,
+                    cstNode->openParenthesesPosition,
+                    cstNode->closeParenthesesPosition,
+                    cstNode->commaPositions
                 );
             else
                 visualizeTypeList(explicitTp->typeList, unconditionallyParenthesize);
@@ -1986,7 +1990,7 @@ struct Printer
             if (FFlag::LuauStoreLocalAnnotationColonPositions)
                 visualize(*a->var, cstNode ? cstNode->annotationColonPosition : Position{0, 0});
             else
-                visualize(*a->var, Position{0,0});
+                visualize(*a->var, Position{0, 0});
 
             if (cstNode)
                 advance(cstNode->equalsPosition);

Analysis/src/Type.cpp

@@ -1079,7 +1079,7 @@ void persist(TypeId ty)
                 queue.push_back(ttv->indexer->indexResultType);
             }
         }
-        else if (auto etv= get<ExternType>(t))
+        else if (auto etv = get<ExternType>(t))
         {
             for (const auto& [_name, prop] : etv->props)
                 queue.push_back(prop.type());

Analysis/src/TypeChecker2.cpp

@@ -34,6 +34,7 @@ LUAU_FASTFLAGVARIABLE(LuauTypeCheckerAcceptNumberConcats)
 LUAU_FASTFLAGVARIABLE(LuauTypeCheckerStricterIndexCheck)
 LUAU_FASTFLAG(LuauStoreReturnTypesAsPackOnAst)
 LUAU_FASTFLAG(LuauEnableWriteOnlyProperties)
+LUAU_FASTFLAG(LuauNewNonStrictFixGenericTypePacks)
 LUAU_FASTFLAGVARIABLE(LuauReportSubtypingErrors)
 LUAU_FASTFLAGVARIABLE(LuauSkipMalformedTypeAliases)
 LUAU_FASTFLAGVARIABLE(LuauTableLiteralSubtypeSpecificCheck)
@@ -782,7 +783,6 @@ void TypeChecker2::visit(AstStatReturn* ret)
 
     for (AstExpr* expr : ret->list)
         visit(expr, ValueContext::RValue);
-
 }
 
 void TypeChecker2::visit(AstStatExpr* expr)
@@ -2796,22 +2796,41 @@ void TypeChecker2::visit(AstTypePackGeneric* tp)
     Scope* scope = findInnermostScope(tp->location);
     LUAU_ASSERT(scope);
 
-    std::optional<TypePackId> alias = scope->lookupPack(tp->genericName.value);
-    if (!alias.has_value())
+    if (FFlag::LuauNewNonStrictFixGenericTypePacks)
     {
+        if (std::optional<TypePackId> alias = scope->lookupPack(tp->genericName.value))
+            return;
+
         if (scope->lookupType(tp->genericName.value))
-        {
-            reportError(
+            return reportError(
                 SwappedGenericTypeParameter{
                     tp->genericName.value,
                     SwappedGenericTypeParameter::Kind::Pack,
                 },
                 tp->location
             );
-        }
-        else
+
+        reportError(UnknownSymbol{tp->genericName.value, UnknownSymbol::Context::Type}, tp->location);
+    }
+    else
+    {
+        std::optional<TypePackId> alias = scope->lookupPack(tp->genericName.value);
+        if (!alias.has_value())
         {
-            reportError(UnknownSymbol{tp->genericName.value, UnknownSymbol::Context::Type}, tp->location);
+            if (scope->lookupType(tp->genericName.value))
+            {
+                reportError(
+                    SwappedGenericTypeParameter{
+                        tp->genericName.value,
+                        SwappedGenericTypeParameter::Kind::Pack,
+                    },
+                    tp->location
+                );
+            }
+            else
+            {
+                reportError(UnknownSymbol{tp->genericName.value, UnknownSymbol::Context::Type}, tp->location);
+            }
         }
     }
 }
@@ -2944,14 +2963,6 @@ void TypeChecker2::explainError(TypePackId subTy, TypePackId superTy, Location l
         reportError(TypePackMismatch{superTy, subTy, reasonings.toString()}, location);
 }
 
-namespace
-{
-bool isRecord(const AstExprTable::Item& item)
-{
-    return item.kind == AstExprTable::Item::Record || (item.kind == AstExprTable::Item::General && item.key->is<AstExprConstantString>());
-}
-}
-
 bool TypeChecker2::testPotentialLiteralIsSubtype(AstExpr* expr, TypeId expectedType)
 {
     auto exprType = follow(lookupType(expr));
@@ -2982,7 +2993,7 @@ bool TypeChecker2::testPotentialLiteralIsSubtype(AstExpr* expr, TypeId expectedT
         return testIsSubtype(exprType, expectedType, expr->location);
     }
 
-    Set<std::optional<std::string> > missingKeys{{}};
+    Set<std::optional<std::string>> missingKeys{{}};
     for (const auto& [name, prop] : expectedTableType->props)
     {
         if (FFlag::LuauEnableWriteOnlyProperties)

Analysis/src/TypeFunction.cpp

@@ -27,6 +27,7 @@
 #include "Luau/Unifier2.h"
 #include "Luau/VecDeque.h"
 #include "Luau/VisitType.h"
+#include "Luau/ApplyTypeFunction.h"
 
 #include "lua.h"
 #include "lualib.h"
@@ -47,8 +48,8 @@ LUAU_DYNAMIC_FASTINTVARIABLE(LuauTypeFamilyApplicationCartesianProductLimit, 5'0
 LUAU_DYNAMIC_FASTINTVARIABLE(LuauTypeFamilyUseGuesserDepth, -1);
 
 LUAU_FASTFLAG(DebugLuauEqSatSimplification)
-LUAU_FASTFLAG(LuauEagerGeneralization)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 LUAU_FASTFLAGVARIABLE(DebugLuauLogTypeFamilies)
 LUAU_FASTFLAG(LuauOptimizeFalsyAndTruthyIntersect)
@@ -56,6 +57,7 @@ LUAU_FASTFLAGVARIABLE(LuauNarrowIntersectionNevers)
 LUAU_FASTFLAGVARIABLE(LuauRefineWaitForBlockedTypesInTarget)
 LUAU_FASTFLAGVARIABLE(LuauNoMoreInjectiveTypeFunctions)
 LUAU_FASTFLAGVARIABLE(LuauNotAllBinaryTypeFunsHaveDefaults)
+LUAU_FASTFLAG(LuauUserTypeFunctionAliases)
 
 namespace Luau
 {
@@ -283,7 +285,7 @@ struct TypeFunctionReducer
         }
         else if (is<GenericType>(ty))
         {
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
                 return SkipTestResult::Generic;
             else
                 return SkipTestResult::Irreducible;
@@ -305,7 +307,7 @@ struct TypeFunctionReducer
         }
         else if (is<GenericTypePack>(ty))
         {
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
                 return SkipTestResult::Generic;
             else
                 return SkipTestResult::Irreducible;
@@ -569,6 +571,27 @@ struct LuauTempThreadPopper
     lua_State* L = nullptr;
 };
 
+template<typename T>
+class ScopedAssign
+{
+public:
+    ScopedAssign(T& target, const T& value)
+        : target(&target)
+        , oldValue(target)
+    {
+        target = value;
+    }
+
+    ~ScopedAssign()
+    {
+        *target = oldValue;
+    }
+
+private:
+    T* target = nullptr;
+    T oldValue;
+};
+
 static FunctionGraphReductionResult reduceFunctionsInternal(
     VecDeque<TypeId> queuedTys,
     VecDeque<TypePackId> queuedTps,
@@ -789,6 +812,97 @@ struct FindUserTypeFunctionBlockers : TypeOnceVisitor
     }
 };
 
+static int evaluateTypeAliasCall(lua_State* L)
+{
+    TypeFun* tf = (TypeFun*)lua_tolightuserdata(L, lua_upvalueindex(1));
+
+    TypeFunctionRuntime* runtime = getTypeFunctionRuntime(L);
+    TypeFunctionRuntimeBuilderState* runtimeBuilder = runtime->runtimeBuilder;
+
+    ApplyTypeFunction applyTypeFunction{runtimeBuilder->ctx->arena};
+
+    int argumentCount = lua_gettop(L);
+    std::vector<TypeId> rawTypeArguments;
+
+    for (int i = 0; i < argumentCount; i++)
+    {
+        TypeFunctionTypeId tfty = getTypeUserData(L, i + 1);
+        TypeId ty = deserialize(tfty, runtimeBuilder);
+
+        if (!runtimeBuilder->errors.empty())
+            luaL_error(L, "failed to deserialize type at argument %d", i + 1);
+
+        rawTypeArguments.push_back(ty);
+    }
+
+    // Check if we have enough arguments, by typical typechecking rules
+    size_t typesRequired = tf->typeParams.size();
+    size_t packsRequired = tf->typePackParams.size();
+
+    size_t typesProvided = rawTypeArguments.size() > typesRequired ? typesRequired : rawTypeArguments.size();
+    size_t extraTypes = rawTypeArguments.size() > typesRequired ? rawTypeArguments.size() - typesRequired : 0;
+    size_t packsProvided = 0;
+
+    if (extraTypes != 0 && packsProvided == 0)
+    {
+        // Extra types are only collected into a pack if a pack is expected
+        if (packsRequired != 0)
+            packsProvided += 1;
+        else
+            typesProvided += extraTypes;
+    }
+
+    for (size_t i = typesProvided; i < typesRequired; ++i)
+    {
+        if (tf->typeParams[i].defaultValue)
+            typesProvided += 1;
+    }
+
+    for (size_t i = packsProvided; i < packsRequired; ++i)
+    {
+        if (tf->typePackParams[i].defaultValue)
+            packsProvided += 1;
+    }
+
+    if (extraTypes == 0 && packsProvided + 1 == packsRequired)
+        packsProvided += 1;
+
+    if (typesProvided != typesRequired || packsProvided != packsRequired)
+        luaL_error(L, "not enough arguments to call");
+
+    // Prepare final types and packs
+    auto [types, packs] = saturateArguments(runtimeBuilder->ctx->arena, runtimeBuilder->ctx->builtins, *tf, rawTypeArguments, {});
+
+    for (size_t i = 0; i < types.size(); ++i)
+        applyTypeFunction.typeArguments[tf->typeParams[i].ty] = types[i];
+
+    for (size_t i = 0; i < packs.size(); ++i)
+        applyTypeFunction.typePackArguments[tf->typePackParams[i].tp] = packs[i];
+
+    std::optional<TypeId> maybeInstantiated = applyTypeFunction.substitute(tf->type);
+
+    if (!maybeInstantiated.has_value())
+    {
+        luaL_error(L, "failed to instantiate type alias");
+        return true;
+    }
+
+    TypeId target = follow(*maybeInstantiated);
+
+    FunctionGraphReductionResult result = reduceTypeFunctions(target, Location{}, *runtimeBuilder->ctx);
+
+    if (!result.errors.empty())
+        luaL_error(L, "failed to reduce type function with: %s", toString(result.errors.front()).c_str());
+
+    TypeFunctionTypeId serializedTy = serialize(follow(target), runtimeBuilder);
+
+    if (!runtimeBuilder->errors.empty())
+        luaL_error(L, "%s", runtimeBuilder->errors.front().c_str());
+
+    allocTypeUserData(L, serializedTy->type);
+    return 1;
+}
+
 TypeFunctionReductionResult<TypeId> userDefinedTypeFunction(
     TypeId instance,
     const std::vector<TypeId>& typeParams,
@@ -819,11 +933,21 @@ TypeFunctionReductionResult<TypeId> userDefinedTypeFunction(
     for (auto typeParam : typeParams)
         check.traverse(follow(typeParam));
 
+    if (FFlag::LuauUserTypeFunctionAliases)
+    {
+        // Check that our environment doesn't depend on any type aliases that are blocked
+        for (auto& [name, definition] : typeFunction->userFuncData.environmentAlias)
+        {
+            if (definition.first->typeParams.empty() && definition.first->typePackParams.empty())
+                check.traverse(follow(definition.first->type));
+        }
+    }
+
     if (!check.blockingTypes.empty())
         return {std::nullopt, Reduction::MaybeOk, check.blockingTypes, {}};
 
     // Ensure that whole type function environment is registered
-    for (auto& [name, definition] : typeFunction->userFuncData.environment)
+    for (auto& [name, definition] : typeFunction->userFuncData.environmentFunction)
     {
         // Cannot evaluate if a potential dependency couldn't be parsed
         if (definition.first->hasErrors)
@@ -849,8 +973,13 @@ TypeFunctionReductionResult<TypeId> userDefinedTypeFunction(
     lua_State* L = lua_newthread(global);
     LuauTempThreadPopper popper(global);
 
+    std::unique_ptr<TypeFunctionRuntimeBuilderState> runtimeBuilder = std::make_unique<TypeFunctionRuntimeBuilderState>(ctx);
+
+    ScopedAssign setRuntimeBuilder(ctx->typeFunctionRuntime->runtimeBuilder, runtimeBuilder.get());
+    ScopedAssign enableReduction(ctx->normalizer->sharedState->reentrantTypeReduction, false);
+
     // Build up the environment table of each function we have visible
-    for (auto& [_, curr] : typeFunction->userFuncData.environment)
+    for (auto& [_, curr] : typeFunction->userFuncData.environmentFunction)
     {
         // Environment table has to be filled only once in the current execution context
         if (ctx->typeFunctionRuntime->initialized.find(curr.first))
@@ -870,7 +999,7 @@ TypeFunctionReductionResult<TypeId> userDefinedTypeFunction(
         lua_getfenv(L, -1);
         lua_setreadonly(L, -1, false);
 
-        for (auto& [name, definition] : typeFunction->userFuncData.environment)
+        for (auto& [name, definition] : typeFunction->userFuncData.environmentFunction)
         {
             // Filter visibility based on original scope depth
             if (definition.second >= curr.second)
@@ -885,6 +1014,39 @@ TypeFunctionReductionResult<TypeId> userDefinedTypeFunction(
             }
         }
 
+        if (FFlag::LuauUserTypeFunctionAliases)
+        {
+            for (auto& [name, definition] : typeFunction->userFuncData.environmentAlias)
+            {
+                // Filter visibility based on original scope depth
+                if (definition.second >= curr.second)
+                {
+                    if (definition.first->typeParams.empty() && definition.first->typePackParams.empty())
+                    {
+                        TypeId ty = follow(definition.first->type);
+
+                        // This is checked at the top of the function, and should still be true.
+                        LUAU_ASSERT(!isPending(ty, ctx->solver));
+
+                        TypeFunctionTypeId serializedTy = serialize(ty, runtimeBuilder.get());
+
+                        // Only register aliases that are representable in type environment
+                        if (runtimeBuilder->errors.empty())
+                        {
+                            allocTypeUserData(L, serializedTy->type);
+                            lua_setfield(L, -2, name.c_str());
+                        }
+                    }
+                    else
+                    {
+                        lua_pushlightuserdata(L, definition.first);
+                        lua_pushcclosure(L, evaluateTypeAliasCall, name.c_str(), 1);
+                        lua_setfield(L, -2, name.c_str());
+                    }
+                }
+            }
+        }
+
         lua_setreadonly(L, -1, true);
         lua_pop(L, 2);
     }
@@ -901,8 +1063,6 @@ TypeFunctionReductionResult<TypeId> userDefinedTypeFunction(
 
     resetTypeFunctionState(L);
 
-    std::unique_ptr<TypeFunctionRuntimeBuilderState> runtimeBuilder = std::make_unique<TypeFunctionRuntimeBuilderState>(ctx);
-
     // Push serialized arguments onto the stack
     for (auto typeParam : typeParams)
     {
@@ -1101,7 +1261,7 @@ TypeFunctionReductionResult<TypeId> unmTypeFunction(
     if (isPending(operandTy, ctx->solver))
         return {std::nullopt, Reduction::MaybeOk, {operandTy}, {}};
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         operandTy = follow(operandTy);
 
     std::shared_ptr<const NormalizedType> normTy = ctx->normalizer->normalize(operandTy);
@@ -1698,7 +1858,7 @@ TypeFunctionReductionResult<TypeId> orTypeFunction(
         return {rhsTy, Reduction::MaybeOk, {}, {}};
 
     // check to see if both operand types are resolved enough, and wait to reduce if not
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         if (is<BlockedType, PendingExpansionType, TypeFunctionInstanceType>(lhsTy))
             return {std::nullopt, Reduction::MaybeOk, {lhsTy}, {}};
@@ -1745,7 +1905,7 @@ static TypeFunctionReductionResult<TypeId> comparisonTypeFunction(
     if (lhsTy == instance || rhsTy == instance)
         return {ctx->builtins->neverType, Reduction::MaybeOk, {}, {}};
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         if (is<BlockedType, PendingExpansionType, TypeFunctionInstanceType>(lhsTy))
             return {std::nullopt, Reduction::MaybeOk, {lhsTy}, {}};
@@ -2099,7 +2259,7 @@ bool isSimpleDiscriminant(TypeId ty)
     return isApproximateTruthy(ty) || isApproximateFalsy(ty);
 }
 
-}
+} // namespace
 
 TypeFunctionReductionResult<TypeId> refineTypeFunction(
     TypeId instance,
@@ -2119,9 +2279,8 @@ TypeFunctionReductionResult<TypeId> refineTypeFunction(
     for (size_t i = 1; i < typeParams.size(); i++)
         discriminantTypes.push_back(follow(typeParams.at(i)));
 
-    const bool targetIsPending = FFlag::LuauEagerGeneralization
-        ? is<BlockedType, PendingExpansionType, TypeFunctionInstanceType>(targetTy)
-        : isPending(targetTy, ctx->solver);
+    const bool targetIsPending = FFlag::LuauEagerGeneralization2 ? is<BlockedType, PendingExpansionType, TypeFunctionInstanceType>(targetTy)
+                                                                 : isPending(targetTy, ctx->solver);
 
     // check to see if both operand types are resolved enough, and wait to reduce if not
     if (targetIsPending)
@@ -2206,7 +2365,7 @@ TypeFunctionReductionResult<TypeId> refineTypeFunction(
                 if (is<TableType>(target) || isSimpleDiscriminant(discriminant))
                 {
                     SimplifyResult result = simplifyIntersection(ctx->builtins, ctx->arena, target, discriminant);
-                    if (FFlag::LuauEagerGeneralization)
+                    if (FFlag::LuauEagerGeneralization2)
                     {
                         // Simplification considers free and generic types to be
                         // 'blocking', but that's not suitable for refine<>.
@@ -2615,8 +2774,8 @@ TypeFunctionReductionResult<TypeId> keyofFunctionImpl(
     if (!normTy)
         return {std::nullopt, Reduction::MaybeOk, {}, {}};
 
-    // if we don't have either just tables or just extern types, we've got nothing to get keys of (at least until a future version perhaps adds extern types
-    // as well)
+    // if we don't have either just tables or just extern types, we've got nothing to get keys of (at least until a future version perhaps adds extern
+    // types as well)
     if (normTy->hasTables() == normTy->hasExternTypes())
         return {std::nullopt, Reduction::Erroneous, {}, {}};
 
@@ -2985,7 +3144,8 @@ TypeFunctionReductionResult<TypeId> indexFunctionImpl(
             return {std::nullopt, Reduction::Erroneous, {}, {}};
 
         // at least one class is guaranteed to be in the iterator by .hasExternTypes()
-        for (auto externTypeIter = indexeeNormTy->externTypes.ordering.begin(); externTypeIter != indexeeNormTy->externTypes.ordering.end(); ++externTypeIter)
+        for (auto externTypeIter = indexeeNormTy->externTypes.ordering.begin(); externTypeIter != indexeeNormTy->externTypes.ordering.end();
+             ++externTypeIter)
         {
             auto externTy = get<ExternType>(*externTypeIter);
             if (!externTy)
@@ -3335,7 +3495,7 @@ BuiltinTypeFunctions::BuiltinTypeFunctions()
     , ltFunc{"lt", ltTypeFunction}
     , leFunc{"le", leTypeFunction}
     , eqFunc{"eq", eqTypeFunction}
-    , refineFunc{"refine", refineTypeFunction, /*canReduceGenerics*/ FFlag::LuauEagerGeneralization}
+    , refineFunc{"refine", refineTypeFunction, /*canReduceGenerics*/ FFlag::LuauEagerGeneralization2}
     , singletonFunc{"singleton", singletonTypeFunction}
     , unionFunc{"union", unionTypeFunction}
     , intersectFunc{"intersect", intersectTypeFunction}

Analysis/src/TypeFunctionRuntime.cpp

@@ -63,7 +63,7 @@ std::optional<std::string> checkResultForError(lua_State* L, const char* typeFun
     }
 }
 
-static TypeFunctionRuntime* getTypeFunctionRuntime(lua_State* L)
+TypeFunctionRuntime* getTypeFunctionRuntime(lua_State* L)
 {
     return static_cast<TypeFunctionRuntime*>(lua_getthreaddata(lua_mainthread(L)));
 }

Analysis/src/TypeFunctionRuntimeBuilder.cpp

@@ -209,9 +209,7 @@ private:
         {
             // Since there aren't any new class types being created in type functions, we will deserialize by using a direct reference to the original
             // class
-            target = typeFunctionRuntime->typeArena.allocate(
-                TypeFunctionExternType{{}, std::nullopt, std::nullopt, std::nullopt, std::nullopt, ty}
-            );
+            target = typeFunctionRuntime->typeArena.allocate(TypeFunctionExternType{{}, std::nullopt, std::nullopt, std::nullopt, std::nullopt, ty});
         }
         else if (auto g = get<GenericType>(ty))
         {

Analysis/src/TypeIds.cpp

@@ -0,0 +1,153 @@
+// This file is part of the Luau programming language and is licensed under MIT License; see LICENSE.txt for details
+
+#include "Luau/Type.h"
+#include "Luau/TypeIds.h"
+
+namespace Luau
+{
+
+TypeIds::TypeIds(std::initializer_list<TypeId> tys)
+{
+    for (TypeId ty : tys)
+        insert(ty);
+}
+
+void TypeIds::insert(TypeId ty)
+{
+    ty = follow(ty);
+
+    // get a reference to the slot for `ty` in `types`
+    bool& entry = types[ty];
+
+    // if `ty` is fresh, we can set it to `true`, add it to the order and hash and be done.
+    if (!entry)
+    {
+        entry = true;
+        order.push_back(ty);
+        hash ^= std::hash<TypeId>{}(ty);
+    }
+}
+
+void TypeIds::clear()
+{
+    order.clear();
+    types.clear();
+    hash = 0;
+}
+
+TypeId TypeIds::front() const
+{
+    return order.at(0);
+}
+
+TypeIds::iterator TypeIds::begin()
+{
+    return order.begin();
+}
+
+TypeIds::iterator TypeIds::end()
+{
+    return order.end();
+}
+
+TypeIds::const_iterator TypeIds::begin() const
+{
+    return order.begin();
+}
+
+TypeIds::const_iterator TypeIds::end() const
+{
+    return order.end();
+}
+
+TypeIds::iterator TypeIds::erase(TypeIds::const_iterator it)
+{
+    TypeId ty = *it;
+    types[ty] = false;
+    hash ^= std::hash<TypeId>{}(ty);
+    return order.erase(it);
+}
+
+void TypeIds::erase(TypeId ty)
+{
+    const_iterator it = std::find(order.begin(), order.end(), ty);
+    if (it == order.end())
+        return;
+
+    erase(it);
+}
+
+size_t TypeIds::size() const
+{
+    return order.size();
+}
+
+bool TypeIds::empty() const
+{
+    return order.empty();
+}
+
+size_t TypeIds::count(TypeId ty) const
+{
+    ty = follow(ty);
+    const bool* val = types.find(ty);
+    return (val && *val) ? 1 : 0;
+}
+
+void TypeIds::retain(const TypeIds& tys)
+{
+    for (auto it = begin(); it != end();)
+    {
+        if (tys.count(*it))
+            it++;
+        else
+            it = erase(it);
+    }
+}
+
+size_t TypeIds::getHash() const
+{
+    return hash;
+}
+
+bool TypeIds::isNever() const
+{
+    return std::all_of(
+        begin(),
+        end(),
+        [&](TypeId i)
+        {
+            // If each typeid is never, then I guess typeid's is also never?
+            return get<NeverType>(i) != nullptr;
+        }
+    );
+}
+
+bool TypeIds::operator==(const TypeIds& there) const
+{
+    // we can early return if the hashes don't match.
+    if (hash != there.hash)
+        return false;
+
+    // we have to check equality of the sets themselves if not.
+
+    // if the sets are unequal sizes, then they cannot possibly be equal.
+    // it is important to use `order` here and not `types` since the mappings
+    // may have different sizes since removal is not possible, and so erase
+    // simply writes `false` into the map.
+    if (order.size() != there.order.size())
+        return false;
+
+    // otherwise, we'll need to check that every element we have here is in `there`.
+    for (auto ty : order)
+    {
+        // if it's not, we'll return `false`
+        if (there.count(ty) == 0)
+            return false;
+    }
+
+    // otherwise, we've proven the two equal!
+    return true;
+}
+
+}

Analysis/src/TypeInfer.cpp

@@ -34,7 +34,6 @@ LUAU_FASTFLAGVARIABLE(DebugLuauFreezeDuringUnification)
 LUAU_FASTFLAG(LuauInstantiateInSubtyping)
 LUAU_FASTFLAG(LuauStoreReturnTypesAsPackOnAst)
 
-LUAU_FASTFLAG(LuauRetainDefinitionAliasLocations)
 LUAU_FASTFLAGVARIABLE(LuauReduceCheckBinaryExprStackPressure)
 
 namespace Luau
@@ -1664,10 +1663,7 @@ void TypeChecker::prototype(const ScopePtr& scope, const AstStatTypeAlias& typea
             FreeType* ftv = getMutable<FreeType>(ty);
             LUAU_ASSERT(ftv);
             ftv->forwardedTypeAlias = true;
-            if (FFlag::LuauRetainDefinitionAliasLocations)
-                bindingsMap[name] = {std::move(generics), std::move(genericPacks), ty, typealias.location};
-            else
-                bindingsMap[name] = {std::move(generics), std::move(genericPacks), ty};
+            bindingsMap[name] = {std::move(generics), std::move(genericPacks), ty, typealias.location};
 
             scope->typeAliasLocations[name] = typealias.location;
             scope->typeAliasNameLocations[name] = typealias.nameLocation;
@@ -1712,10 +1708,7 @@ void TypeChecker::prototype(const ScopePtr& scope, const AstStatDeclareExternTyp
     TypeId metaTy = addType(TableType{TableState::Sealed, scope->level});
 
     etv->metatable = metaTy;
-    if (FFlag::LuauRetainDefinitionAliasLocations)
-        scope->exportedTypeBindings[className] = TypeFun{{}, classTy, declaredExternType.location};
-    else
-        scope->exportedTypeBindings[className] = TypeFun{{}, classTy};
+    scope->exportedTypeBindings[className] = TypeFun{{}, classTy, declaredExternType.location};
 }
 
 ControlFlow TypeChecker::check(const ScopePtr& scope, const AstStatDeclareExternType& declaredExternType)
@@ -4330,7 +4323,7 @@ void TypeChecker::checkArgumentList(
 
                     if (exceedsLoopCount())
                         return;
-        }
+                }
 
                 TypePackId varPack = addTypePack(TypePackVar{TypePack{rest, argIter.tail()}});
                 state.tryUnify(varPack, tail);

Analysis/src/TypeUtils.cpp

@@ -12,7 +12,7 @@
 #include <algorithm>
 
 LUAU_FASTFLAG(LuauSolverV2)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAGVARIABLE(LuauErrorSuppressionTypeFunctionArgs)
 
 namespace Luau
@@ -306,7 +306,7 @@ TypePack extendTypePack(
             TypePack newPack;
             newPack.tail = arena.freshTypePack(ftp->scope, ftp->polarity);
 
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
                 trackInteriorFreeTypePack(ftp->scope, *newPack.tail);
 
             if (FFlag::LuauSolverV2)
@@ -588,7 +588,7 @@ void trackInteriorFreeType(Scope* scope, TypeId ty)
 void trackInteriorFreeTypePack(Scope* scope, TypePackId tp)
 {
     LUAU_ASSERT(tp);
-    if (!FFlag::LuauEagerGeneralization)
+    if (!FFlag::LuauEagerGeneralization2)
         return;
 
     for (; scope; scope = scope->parent.get())
@@ -685,4 +685,15 @@ std::optional<TypeId> extractMatchingTableType(std::vector<TypeId>& tables, Type
     return std::nullopt;
 }
 
+bool isRecord(const AstExprTable::Item& item)
+{
+    if (item.kind == AstExprTable::Item::Record)
+        return true;
+    else if (item.kind == AstExprTable::Item::General && item.key->is<AstExprConstantString>())
+        return true;
+    else
+        return false;
+}
+
+
 } // namespace Luau

Analysis/src/Unifier2.cpp

@@ -19,7 +19,7 @@
 
 LUAU_FASTINT(LuauTypeInferRecursionLimit)
 LUAU_FASTFLAG(LuauEnableWriteOnlyProperties)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 namespace Luau
 {
@@ -329,12 +329,12 @@ bool Unifier2::unify(TypeId subTy, const FunctionType* superFn)
 
         for (TypePackId genericPack : subFn->genericPacks)
         {
-            if (FFlag::LuauEagerGeneralization)
+            if (FFlag::LuauEagerGeneralization2)
             {
-                if (FFlag::LuauEagerGeneralization)
+                if (FFlag::LuauEagerGeneralization2)
                     genericPack = follow(genericPack);
 
-                // TODO: Clip this follow() with LuauEagerGeneralization
+                // TODO: Clip this follow() with LuauEagerGeneralization2
                 const GenericTypePack* gen = get<GenericTypePack>(follow(genericPack));
                 if (gen)
                     genericPackSubstitutions[genericPack] = freshTypePack(scope, gen->polarity);
@@ -465,7 +465,7 @@ bool Unifier2::unify(TableType* subTable, const TableType* superTable)
     {
         result &= unify(subTable->indexer->indexType, superTable->indexer->indexType);
         result &= unify(subTable->indexer->indexResultType, superTable->indexer->indexResultType);
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             // FIXME: We can probably do something more efficient here.
             result &= unify(superTable->indexer->indexType, subTable->indexer->indexType);

Ast/include/Luau/Cst.h

@@ -393,7 +393,7 @@ public:
         std::optional<Position> separatorPosition;
 
         CstExprConstantString* stringInfo = nullptr; // only if Kind == StringProperty
-        Position stringPosition{0, 0}; // only if Kind == StringProperty
+        Position stringPosition{0, 0};               // only if Kind == StringProperty
     };
 
     CstTypeTable(AstArray<Item> items, bool isArray);

Ast/include/Luau/Parser.h

@@ -456,7 +456,7 @@ private:
         AstType* annotation;
         Position colonPosition;
 
-        explicit Binding(const Name& name, AstType* annotation = nullptr, Position colonPosition = {0,0})
+        explicit Binding(const Name& name, AstType* annotation = nullptr, Position colonPosition = {0, 0})
             : name(name)
             , annotation(annotation)
             , colonPosition(colonPosition)

Ast/src/Cst.cpp

@@ -94,7 +94,11 @@ CstStatReturn::CstStatReturn(AstArray<Position> commaPositions)
 {
 }
 
-CstStatLocal::CstStatLocal(AstArray<Position> varsAnnotationColonPositions, AstArray<Position> varsCommaPositions, AstArray<Position> valuesCommaPositions)
+CstStatLocal::CstStatLocal(
+    AstArray<Position> varsAnnotationColonPositions,
+    AstArray<Position> varsCommaPositions,
+    AstArray<Position> valuesCommaPositions
+)
     : CstNode(CstClassIndex())
     , varsAnnotationColonPositions(varsAnnotationColonPositions)
     , varsCommaPositions(varsCommaPositions)
@@ -102,7 +106,12 @@ CstStatLocal::CstStatLocal(AstArray<Position> varsAnnotationColonPositions, AstA
 {
 }
 
-CstStatFor::CstStatFor(Position annotationColonPosition, Position equalsPosition, Position endCommaPosition, std::optional<Position> stepCommaPosition)
+CstStatFor::CstStatFor(
+    Position annotationColonPosition,
+    Position equalsPosition,
+    Position endCommaPosition,
+    std::optional<Position> stepCommaPosition
+)
     : CstNode(CstClassIndex())
     , annotationColonPosition(annotationColonPosition)
     , equalsPosition(equalsPosition)
@@ -111,7 +120,11 @@ CstStatFor::CstStatFor(Position annotationColonPosition, Position equalsPosition
 {
 }
 
-CstStatForIn::CstStatForIn(AstArray<Position> varsAnnotationColonPositions, AstArray<Position> varsCommaPositions, AstArray<Position> valuesCommaPositions)
+CstStatForIn::CstStatForIn(
+    AstArray<Position> varsAnnotationColonPositions,
+    AstArray<Position> varsCommaPositions,
+    AstArray<Position> valuesCommaPositions
+)
     : CstNode(CstClassIndex())
     , varsAnnotationColonPositions(varsAnnotationColonPositions)
     , varsCommaPositions(varsCommaPositions)

Ast/src/Parser.cpp

@@ -709,7 +709,8 @@ AstStat* Parser::parseFor()
             if (options.storeCstData)
             {
                 if (FFlag::LuauStoreLocalAnnotationColonPositions)
-                    cstNodeMap[node] = allocator.alloc<CstStatForIn>(extractAnnotationColonPositions(names), varsCommaPosition, copy(valuesCommaPositions));
+                    cstNodeMap[node] =
+                        allocator.alloc<CstStatForIn>(extractAnnotationColonPositions(names), varsCommaPosition, copy(valuesCommaPositions));
                 else
                     cstNodeMap[node] = allocator.alloc<CstStatForIn>(AstArray<Position>{}, varsCommaPosition, copy(valuesCommaPositions));
             }
@@ -1009,7 +1010,8 @@ AstStat* Parser::parseLocal(const AstArray<AstAttr*>& attributes)
             if (options.storeCstData)
             {
                 if (FFlag::LuauStoreLocalAnnotationColonPositions)
-                    cstNodeMap[node] = allocator.alloc<CstStatLocal>(extractAnnotationColonPositions(names), varsCommaPositions, copy(valuesCommaPositions));
+                    cstNodeMap[node] =
+                        allocator.alloc<CstStatLocal>(extractAnnotationColonPositions(names), varsCommaPositions, copy(valuesCommaPositions));
                 else
                     cstNodeMap[node] = allocator.alloc<CstStatLocal>(AstArray<Position>{}, varsCommaPositions, copy(valuesCommaPositions));
             }
@@ -1333,7 +1335,9 @@ AstStat* Parser::parseDeclaration(const Location& start, const AstArray<AstAttr*
                 foundExtern = true;
                 nextLexeme();
                 if (AstName(lexer.current().name) != "type")
-                    return reportStatError(lexer.current().location, {}, {}, "Expected `type` keyword after `extern`, but got %s instead", lexer.current().name);
+                    return reportStatError(
+                        lexer.current().location, {}, {}, "Expected `type` keyword after `extern`, but got %s instead", lexer.current().name
+                    );
             }
         }
 
@@ -1354,7 +1358,11 @@ AstStat* Parser::parseDeclaration(const Location& start, const AstArray<AstAttr*
             if (foundExtern)
             {
                 if (AstName(lexer.current().name) != "with")
-                    report(lexer.current().location, "Expected `with` keyword before listing properties of the external type, but got %s instead", lexer.current().name);
+                    report(
+                        lexer.current().location,
+                        "Expected `with` keyword before listing properties of the external type, but got %s instead",
+                        lexer.current().name
+                    );
                 else
                     nextLexeme();
             }
@@ -1452,9 +1460,9 @@ AstStat* Parser::parseDeclaration(const Location& start, const AstArray<AstAttr*
 
                     expectAndConsume(':', "property type annotation");
                     AstType* propType = parseType();
-                    props.push_back(
-                        AstDeclaredExternTypeProperty{propName->name, propName->location, propType, false, Location(propStart, lexer.previousLocation())}
-                    );
+                    props.push_back(AstDeclaredExternTypeProperty{
+                        propName->name, propName->location, propType, false, Location(propStart, lexer.previousLocation())
+                    });
                 }
             }
             else
@@ -1533,9 +1541,9 @@ AstStat* Parser::parseDeclaration(const Location& start, const AstArray<AstAttr*
 
                     expectAndConsume(':', "property type annotation");
                     AstType* propType = parseType();
-                    props.push_back(
-                        AstDeclaredExternTypeProperty{propName->name, propName->location, propType, false, Location(propStart, lexer.previousLocation())}
-                    );
+                    props.push_back(AstDeclaredExternTypeProperty{
+                        propName->name, propName->location, propType, false, Location(propStart, lexer.previousLocation())
+                    });
                 }
             }
         }
@@ -2618,7 +2626,7 @@ AstType* Parser::parseTableType(bool inDeclarationContext)
                             tableSeparator(),
                             lexer.current().location.begin,
                             allocator.alloc<CstExprConstantString>(sourceString, style, blockDepth),
-                                stringPosition
+                            stringPosition
                         });
                 }
                 else

CLI/include/Luau/ReplRequirer.h

@@ -14,16 +14,11 @@ void requireConfigInit(luarequire_Configuration* config);
 
 struct ReplRequirer
 {
-    using CompileOptions = Luau::CompileOptions(*)();
-    using BoolCheck = bool(*)();
-    using Coverage = void(*)(lua_State*, int);
+    using CompileOptions = Luau::CompileOptions (*)();
+    using BoolCheck = bool (*)();
+    using Coverage = void (*)(lua_State*, int);
 
-    ReplRequirer(
-        CompileOptions copts,
-        BoolCheck coverageActive,
-        BoolCheck codegenEnabled,
-        Coverage coverageTrack
-    );
+    ReplRequirer(CompileOptions copts, BoolCheck coverageActive, BoolCheck codegenEnabled, Coverage coverageTrack);
 
     CompileOptions copts;
     BoolCheck coverageActive;

CodeGen/src/EmitCommonA64.h

@@ -39,8 +39,8 @@ inline constexpr RegisterA64 rBase = x25;      // StkId base
 
 // Native code is as stackless as the interpreter, so we can place some data on the stack once and have it accessible at any point
 // See CodeGenA64.cpp for layout
-inline constexpr unsigned kStashSlots = 9; // stashed non-volatile registers
-inline constexpr unsigned kTempSlots = 1;  // 8 bytes of temporary space, such luxury!
+inline constexpr unsigned kStashSlots = 9;  // stashed non-volatile registers
+inline constexpr unsigned kTempSlots = 1;   // 8 bytes of temporary space, such luxury!
 inline constexpr unsigned kSpillSlots = 22; // slots for spilling temporary registers
 
 inline constexpr unsigned kStackSize = (kStashSlots + kTempSlots + kSpillSlots) * 8;

Sources.cmake

@@ -189,6 +189,7 @@ target_sources(Luau.Analysis PRIVATE
     Analysis/include/Luau/Documentation.h
     Analysis/include/Luau/Error.h
     Analysis/include/Luau/EqSatSimplification.h
+    Analysis/include/Luau/ExpectedTypeVisitor.h
     Analysis/include/Luau/FileResolver.h
     Analysis/include/Luau/FragmentAutocomplete.h
     Analysis/include/Luau/Frontend.h
@@ -237,6 +238,7 @@ target_sources(Luau.Analysis PRIVATE
     Analysis/include/Luau/TypeFunctionRuntime.h
     Analysis/include/Luau/TypeFunctionRuntimeBuilder.h
     Analysis/include/Luau/TypeFwd.h
+    Analysis/include/Luau/TypeIds.h
     Analysis/include/Luau/TypeInfer.h
     Analysis/include/Luau/TypeOrPack.h
     Analysis/include/Luau/TypePack.h
@@ -267,6 +269,7 @@ target_sources(Luau.Analysis PRIVATE
     Analysis/src/EmbeddedBuiltinDefinitions.cpp
     Analysis/src/Error.cpp
     Analysis/src/EqSatSimplification.cpp
+    Analysis/src/ExpectedTypeVisitor.cpp
     Analysis/src/FileResolver.cpp
     Analysis/src/FragmentAutocomplete.cpp
     Analysis/src/Frontend.cpp
@@ -306,6 +309,7 @@ target_sources(Luau.Analysis PRIVATE
     Analysis/src/TypeFunctionReductionGuesser.cpp
     Analysis/src/TypeFunctionRuntime.cpp
     Analysis/src/TypeFunctionRuntimeBuilder.cpp
+    Analysis/src/TypeIds.cpp
     Analysis/src/TypeInfer.cpp
     Analysis/src/TypeOrPack.cpp
     Analysis/src/TypePack.cpp

VM/src/lapi.cpp

@@ -15,6 +15,8 @@
 
 #include <string.h>
 
+LUAU_DYNAMIC_FASTFLAGVARIABLE(LuauUnrefExisting, false)
+
 /*
  * This file contains most implementations of core Lua APIs from lua.h.
  *
@@ -1445,9 +1447,26 @@ void lua_unref(lua_State* L, int ref)
 
     global_State* g = L->global;
     LuaTable* reg = hvalue(registry(L));
-    TValue* slot = luaH_setnum(L, reg, ref);
-    setnvalue(slot, g->registryfree); // NB: no barrier needed because value isn't collectable
-    g->registryfree = ref;
+
+    if (DFFlag::LuauUnrefExisting)
+    {
+        const TValue* slot = luaH_getnum(reg, ref);
+        api_check(L, slot != luaO_nilobject);
+
+        // similar to how 'luaH_setnum' makes non-nil slot value mutable
+        TValue* mutableSlot = (TValue*)slot;
+
+        // NB: no barrier needed because value isn't collectable
+        setnvalue(mutableSlot, g->registryfree);
+
+        g->registryfree = ref;
+    }
+    else
+    {
+        TValue* slot = luaH_setnum(L, reg, ref);
+        setnvalue(slot, g->registryfree); // NB: no barrier needed because value isn't collectable
+        g->registryfree = ref;
+    }
 }
 
 void lua_setuserdatatag(lua_State* L, int idx, int tag)

tests/AstJsonEncoder.test.cpp

@@ -642,4 +642,3 @@ TEST_CASE_FIXTURE(JsonEncoderFixture, "encode_AstGenericTypePackWithDefault")
 }
 
 TEST_SUITE_END();
-

tests/Autocomplete.test.cpp

@@ -19,7 +19,8 @@
 LUAU_FASTFLAG(LuauTraceTypesInNonstrictMode2)
 LUAU_FASTFLAG(LuauSetMetatableDoesNotTimeTravel)
 LUAU_FASTINT(LuauTypeInferRecursionLimit)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
+LUAU_FASTFLAG(LuauExpectedTypeVisitor)
 
 using namespace Luau;
 
@@ -41,6 +42,9 @@ struct ACFixtureImpl : BaseType
         FrontendOptions opts;
         opts.forAutocomplete = true;
         opts.retainFullTypeGraphs = true;
+        // NOTE: Autocomplete does *not* require strict checking, meaning we should
+        // try to check all of these examples in `--!nocheck` mode.
+        this->configResolver.defaultConfig.mode = Mode::NoCheck;
         this->frontend.check("MainModule", opts);
 
         return Luau::autocomplete(this->frontend, "MainModule", Position{row, column}, nullCallback);
@@ -51,6 +55,9 @@ struct ACFixtureImpl : BaseType
         FrontendOptions opts;
         opts.forAutocomplete = true;
         opts.retainFullTypeGraphs = true;
+        // NOTE: Autocomplete does *not* require strict checking, meaning we should
+        // try to check all of these examples in `--!nocheck` mode.
+        this->configResolver.defaultConfig.mode = Mode::NoCheck;
         this->frontend.check("MainModule", opts);
 
         return Luau::autocomplete(this->frontend, "MainModule", getPosition(marker), callback);
@@ -61,6 +68,9 @@ struct ACFixtureImpl : BaseType
         FrontendOptions opts;
         opts.forAutocomplete = true;
         opts.retainFullTypeGraphs = true;
+        // NOTE: Autocomplete does *not* require strict checking, meaning we should
+        // try to check all of these examples in `--!nocheck` mode.
+        this->configResolver.defaultConfig.mode = Mode::NoCheck;
         this->frontend.check(name, opts);
 
         return Luau::autocomplete(this->frontend, name, pos, callback);
@@ -103,7 +113,9 @@ struct ACFixtureImpl : BaseType
         }
         LUAU_ASSERT("Digit expected after @ symbol" && prevChar != '@');
 
-        return BaseType::check(filteredSource);
+        // NOTE: Autocomplete does *not* require strict checking, meaning we should
+        // try to check all of these examples in `--!nocheck` mode.
+        return BaseType::check(Mode::NoCheck, filteredSource, std::nullopt);
     }
 
     LoadDefinitionFileResult loadDefinition(const std::string& source)
@@ -2191,7 +2203,10 @@ local fp: @1= f
     if (FFlag::LuauSolverV2)
         REQUIRE_EQ("({ x: number, y: number }) -> number", toString(requireType("f")));
     else
-        REQUIRE_EQ("({| x: number, y: number |}) -> number", toString(requireType("f")));
+    {
+        // NOTE: All autocomplete tests occur under no-check mode.
+        REQUIRE_EQ("({| x: number, y: number |}) -> (...any)", toString(requireType("f")));
+    }
     CHECK(ac.entryMap.count("({ x: number, y: number }) -> number"));
 }
 
@@ -3120,7 +3135,6 @@ TEST_CASE_FIXTURE(ACFixture, "autocomplete_string_singletons")
 
 TEST_CASE_FIXTURE(ACFixture, "string_singleton_as_table_key_iso")
 {
-
     check(R"(
         type Direction = "up" | "down"
         local b: {[Direction]: boolean} = {["@2"] = true}
@@ -4454,9 +4468,9 @@ TEST_CASE_FIXTURE(ACExternTypeFixture, "ac_dont_overflow_on_recursive_union")
 
     auto ac = autocomplete('1');
 
-    if (FFlag::LuauSolverV2 && FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauSolverV2 && FFlag::LuauEagerGeneralization2)
     {
-        // This `if` statement is because `LuauEagerGeneralization`
+        // This `if` statement is because `LuauEagerGeneralization2`
         // sets some flags
         CHECK(ac.entryMap.count("BaseMethod") > 0);
         CHECK(ac.entryMap.count("Method") > 0);
@@ -4466,7 +4480,6 @@ TEST_CASE_FIXTURE(ACExternTypeFixture, "ac_dont_overflow_on_recursive_union")
         // Otherwise, we don't infer anything for `value`, which is _fine_.
         CHECK(ac.entryMap.empty());
     }
-
 }
 
 TEST_CASE_FIXTURE(ACBuiltinsFixture, "type_function_has_types_definitions")
@@ -4536,4 +4549,62 @@ end
     CHECK_EQ(ac.entryMap.count("number"), 1);
 }
 
+TEST_CASE_FIXTURE(ACFixture, "autocomplete_for_assignment")
+{
+    ScopedFastFlag _{FFlag::LuauExpectedTypeVisitor, true};
+
+    check(R"(
+        local function foobar(tbl: { tag: "left" | "right" })
+            tbl.tag = "@1"
+        end
+    )");
+
+    auto ac = autocomplete('1');
+    CHECK_EQ(ac.entryMap.count("left"), 1);
+    CHECK_EQ(ac.entryMap.count("right"), 1);
+}
+
+TEST_CASE_FIXTURE(ACFixture, "autocomplete_in_local_table")
+{
+    ScopedFastFlag _{FFlag::LuauExpectedTypeVisitor, true};
+
+    check(R"(
+        type Entry = { field: number, prop: string }
+        local x : {Entry} = {}
+        x[1] = {
+           f@1,
+           p@2,
+        }
+
+        local t : { key1: boolean, thing2: CFrame, aaa3: vector } = {
+            k@3,
+            th@4,
+        }
+    )");
+
+    auto ac1 = autocomplete('1');
+    CHECK_EQ(ac1.entryMap.count("field"), 1);
+    auto ac2 = autocomplete('2');
+    CHECK_EQ(ac2.entryMap.count("prop"), 1);
+    auto ac3 = autocomplete('3');
+    CHECK_EQ(ac3.entryMap.count("key1"), 1);
+    auto ac4 = autocomplete('4');
+    CHECK_EQ(ac4.entryMap.count("thing2"), 1);
+}
+
+TEST_CASE_FIXTURE(ACFixture, "autocomplete_in_type_assertion")
+{
+    ScopedFastFlag _{FFlag::LuauExpectedTypeVisitor, true};
+
+    check(R"(
+        type Entry = { field: number, prop: string }
+        return ( { f@1, p@2 } :: Entry )
+    )");
+
+    auto ac1 = autocomplete('1');
+    CHECK_EQ(ac1.entryMap.count("field"), 1);
+    auto ac2 = autocomplete('2');
+    CHECK_EQ(ac2.entryMap.count("prop"), 1);
+}
+
 TEST_SUITE_END();

tests/DataFlowGraph.test.cpp

@@ -56,7 +56,6 @@ struct DataFlowGraphFixture
         CHECK(phi->operands.size() == operandSet.size());
         for (auto o : phi->operands)
             CHECK(operandSet.contains(o.get()));
-
     }
 };
 

tests/Fixture.h

@@ -29,6 +29,7 @@ LUAU_FASTFLAG(DebugLuauFreezeArena)
 LUAU_FASTFLAG(DebugLuauForceAllNewSolverTests)
 
 LUAU_FASTFLAG(LuauTypeFunOptional)
+LUAU_FASTFLAG(LuauUpdateSetMetatableTypeSignature)
 
 #define DOES_NOT_PASS_NEW_SOLVER_GUARD_IMPL(line) ScopedFastFlag sff_##line{FFlag::LuauSolverV2, FFlag::DebugLuauForceAllNewSolverTests};
 
@@ -148,6 +149,7 @@ struct Fixture
     // Most often those are changes related to builtin type definitions.
     // In that case, flag can be forced to 'true' using the example below:
     // ScopedFastFlag sff_LuauExampleFlagDefinition{FFlag::LuauExampleFlagDefinition, true};
+    ScopedFastFlag sff_LuauUpdateSetMetatableTypeSignature{FFlag::LuauUpdateSetMetatableTypeSignature, true};
 
     // Arena freezing marks the `TypeArena`'s underlying memory as read-only, raising an access violation whenever you mutate it.
     // This is useful for tracking down violations of Luau's memory model.

tests/FragmentAutocomplete.test.cpp

@@ -31,6 +31,7 @@ LUAU_FASTFLAG(LuauBlockDiffFragmentSelection)
 LUAU_FASTFLAG(LuauFragmentAcMemoryLeak)
 LUAU_FASTFLAG(LuauGlobalVariableModuleIsolation)
 LUAU_FASTFLAG(LuauFragmentAutocompleteIfRecommendations)
+LUAU_FASTFLAG(LuauPopulateRefinedTypesInFragmentFromOldSolver)
 
 static std::optional<AutocompleteEntryMap> nullCallback(std::string tag, std::optional<const ExternType*> ptr, std::optional<std::string> contents)
 {
@@ -65,6 +66,7 @@ struct FragmentAutocompleteFixtureImpl : BaseType
     ScopedFastFlag luauFragmentAcMemoryLeak{FFlag::LuauFragmentAcMemoryLeak, true};
     ScopedFastFlag luauGlobalVariableModuleIsolation{FFlag::LuauGlobalVariableModuleIsolation, true};
     ScopedFastFlag luauFragmentAutocompleteIfRecommendations{FFlag::LuauFragmentAutocompleteIfRecommendations, true};
+    ScopedFastFlag luauPopulateRefinedTypesInFragmentFromOldSolver{FFlag::LuauPopulateRefinedTypesInFragmentFromOldSolver, true};
 
     FragmentAutocompleteFixtureImpl()
         : BaseType(true)
@@ -146,6 +148,37 @@ struct FragmentAutocompleteFixtureImpl : BaseType
         return Luau::tryFragmentAutocomplete(this->frontend, "MainModule", cursorPos, context, nullCallback);
     }
 
+    void autocompleteFragmentInNewSolver(
+        const std::string& document,
+        const std::string& updated,
+        Position cursorPos,
+        std::function<void(FragmentAutocompleteStatusResult& result)> assertions,
+        std::optional<Position> fragmentEndPosition = std::nullopt
+        )
+    {
+        ScopedFastFlag sff{FFlag::LuauSolverV2, true};
+        this->check(document, getOptions());
+
+        FragmentAutocompleteStatusResult result = autocompleteFragment(updated, cursorPos, fragmentEndPosition);
+        CHECK(result.status != FragmentAutocompleteStatus::InternalIce);
+        assertions(result);
+    }
+
+    void autocompleteFragmentInOldSolver(
+        const std::string& document,
+        const std::string& updated,
+        Position cursorPos,
+        std::function<void(FragmentAutocompleteStatusResult& result)> assertions,
+        std::optional<Position> fragmentEndPosition = std::nullopt
+        )
+    {
+        ScopedFastFlag sff{FFlag::LuauSolverV2, false};
+        this->check(document, getOptions());
+
+        FragmentAutocompleteStatusResult result = autocompleteFragment(updated, cursorPos, fragmentEndPosition);
+        CHECK(result.status != FragmentAutocompleteStatus::InternalIce);
+        assertions(result);
+    }
 
     void autocompleteFragmentInBothSolvers(
         const std::string& document,
@@ -3702,6 +3735,138 @@ end
     );
 }
 
+TEST_CASE_FIXTURE(FragmentAutocompleteFixture, "tagged_union_completion_first_branch_of_union_old_solver")
+{
+    const std::string source = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "ok" then
+
+end
+)";
+
+    const std::string dest = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "ok" then
+    result.
+end
+)";
+    autocompleteFragmentInOldSolver(source, dest, Position{8, 11}, [](auto& result){
+        REQUIRE(result.result);
+        CHECK_EQ(result.result->acResults.entryMap.count("type"), 1);
+        CHECK_EQ(result.result->acResults.entryMap.count("value"), 1);
+    });
+}
+
+TEST_CASE_FIXTURE(FragmentAutocompleteFixture, "tagged_union_completion_second_branch_of_union_old_solver")
+{
+    const std::string source = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "err" then
+
+end
+)";
+
+    const std::string dest = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "err" then
+    result.
+end
+)";
+
+    autocompleteFragmentInOldSolver(source, dest, Position{8, 11}, [](auto& result){
+        REQUIRE(result.result);
+        CHECK_EQ(result.result->acResults.entryMap.count("type"), 1);
+        CHECK_EQ(result.result->acResults.entryMap.count("error"), 1);
+    });
+}
+
+TEST_CASE_FIXTURE(FragmentAutocompleteFixture, "tagged_union_completion_first_branch_of_union_new_solver" * doctest::skip(true))
+{
+    // TODO: CLI-155619 - Fragment autocomplete needs to use stale refinement information for modules typechecked in the new solver as well
+    const std::string source = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "ok" then
+
+end
+)";
+
+    const std::string dest = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "ok" then
+    result.
+end
+)";
+    autocompleteFragmentInNewSolver(source, dest, Position{8, 11}, [](auto& result){
+        REQUIRE(result.result);
+        CHECK_EQ(result.result->acResults.entryMap.count("type"), 1);
+        CHECK_EQ(result.result->acResults.entryMap.count("value"), 1);
+    });
+}
+
+TEST_CASE_FIXTURE(FragmentAutocompleteFixture, "tagged_union_completion_second_branch_of_union_new_solver" * doctest::skip(true))
+{
+    // TODO: CLI-155619 - Fragment autocomplete needs to use stale refinement information for modules typechecked in the new solver as well
+    const std::string source = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "err" then
+
+end
+)";
+
+    const std::string dest = R"(
+type Ok<T> = { type: "ok", value: T}
+type Err<E> = { type : "err", error : E}
+type Result<T,E> = Ok<T> | Err<E>
+
+local result = {} :: Result<number, string>
+
+if result.type == "err" then
+    result.
+end
+)";
+
+    autocompleteFragmentInNewSolver(source, dest, Position{8, 11}, [](auto& result){
+        REQUIRE(result.result);
+        CHECK_EQ(result.result->acResults.entryMap.count("type"), 1);
+        CHECK_EQ(result.result->acResults.entryMap.count("error"), 1);
+    });
+}
+
 // NOLINTEND(bugprone-unchecked-optional-access)
 
 TEST_SUITE_END();

tests/Frontend.test.cpp

@@ -897,7 +897,8 @@ TEST_CASE_FIXTURE(FrontendFixture, "it_should_be_safe_to_stringify_errors_when_f
     {
         CHECK_EQ(
             "Table type '{ count: string }' not compatible with type '{ Count: number }' because the former is missing field 'Count'",
-            toString(result.errors[0]));
+            toString(result.errors[0])
+        );
     }
     else
         REQUIRE_EQ(

tests/Generalization.test.cpp

@@ -15,7 +15,7 @@
 using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(DebugLuauForbidInternalTypes)
 LUAU_FASTFLAG(LuauTrackInferredFunctionTypeFromCall)
 
@@ -115,7 +115,8 @@ TEST_CASE_FIXTURE(GeneralizationFixture, "dont_traverse_into_class_types_when_ge
 {
     auto [propTy, _] = freshType();
 
-    TypeId cursedExternType = arena.addType(ExternType{"Cursed", {{"oh_no", Property::readonly(propTy)}}, std::nullopt, std::nullopt, {}, {}, "", {}});
+    TypeId cursedExternType =
+        arena.addType(ExternType{"Cursed", {{"oh_no", Property::readonly(propTy)}}, std::nullopt, std::nullopt, {}, {}, "", {}});
 
     auto genExternType = generalize(cursedExternType);
     REQUIRE(genExternType);
@@ -226,7 +227,7 @@ TEST_CASE_FIXTURE(GeneralizationFixture, "('a) -> 'a")
 
 TEST_CASE_FIXTURE(GeneralizationFixture, "(t1, (t1 <: 'b)) -> () where t1 = ('a <: (t1 <: 'b) & {number} & {number})")
 {
-    ScopedFastFlag sff{FFlag::LuauEagerGeneralization, true};
+    ScopedFastFlag sff{FFlag::LuauEagerGeneralization2, true};
 
     TableType tt;
     tt.indexer = TableIndexer{builtinTypes.numberType, builtinTypes.numberType};
@@ -260,7 +261,7 @@ TEST_CASE_FIXTURE(GeneralizationFixture, "(('a <: number | string)) -> string?")
 
 TEST_CASE_FIXTURE(GeneralizationFixture, "(('a <: {'b})) -> ()")
 {
-    ScopedFastFlag sff{FFlag::LuauEagerGeneralization, true};
+    ScopedFastFlag sff{FFlag::LuauEagerGeneralization2, true};
 
     auto [aTy, aFree] = freshType();
     auto [bTy, bFree] = freshType();
@@ -341,10 +342,7 @@ end
 
 TEST_CASE_FIXTURE(BuiltinsFixture, "generalization_should_not_leak_free_type")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::DebugLuauForbidInternalTypes, true},
-        {FFlag::LuauTrackInferredFunctionTypeFromCall, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::DebugLuauForbidInternalTypes, true}, {FFlag::LuauTrackInferredFunctionTypeFromCall, true}};
 
     // This test case should just not assert
     CheckResult result = check(R"(

tests/InferPolarity.test.cpp

@@ -8,13 +8,13 @@
 
 using namespace Luau;
 
-LUAU_FASTFLAG(LuauEagerGeneralization);
+LUAU_FASTFLAG(LuauEagerGeneralization2);
 
 TEST_SUITE_BEGIN("InferPolarity");
 
 TEST_CASE_FIXTURE(Fixture, "T where T = { m: <a>(a) -> T }")
 {
-    ScopedFastFlag sff{FFlag::LuauEagerGeneralization, true};
+    ScopedFastFlag sff{FFlag::LuauEagerGeneralization2, true};
 
     TypeArena arena;
     ScopePtr globalScope = std::make_shared<Scope>(builtinTypes->anyTypePack);

tests/Linter.test.cpp

@@ -10,7 +10,7 @@
 LUAU_FASTFLAG(LuauSolverV2);
 LUAU_FASTFLAG(LintRedundantNativeAttribute);
 LUAU_FASTFLAG(LuauDeprecatedAttribute);
-LUAU_FASTFLAG(LuauEagerGeneralization);
+LUAU_FASTFLAG(LuauEagerGeneralization2);
 
 using namespace Luau;
 
@@ -1942,7 +1942,7 @@ print(foo:bar(2.0))
 TEST_CASE_FIXTURE(BuiltinsFixture, "TableOperations")
 {
     // FIXME: For now this flag causes a stack overflow on Windows.
-    ScopedFastFlag _{FFlag::LuauEagerGeneralization, false};
+    ScopedFastFlag _{FFlag::LuauEagerGeneralization2, false};
 
     LintResult result = lint(R"(
 local t = {}

tests/NonStrictTypeChecker.test.cpp

@@ -16,6 +16,7 @@
 #include <iostream>
 
 LUAU_FASTFLAG(LuauNewNonStrictVisitTypes2)
+LUAU_FASTFLAG(LuauNewNonStrictFixGenericTypePacks)
 
 using namespace Luau;
 
@@ -560,6 +561,18 @@ optionalArgsAtTheEnd1("a", nil, 3)
     LUAU_REQUIRE_NO_ERRORS(result);
 }
 
+TEST_CASE_FIXTURE(NonStrictTypeCheckerFixture, "generic_type_packs_in_non_strict")
+{
+    ScopedFastFlag sff{FFlag::LuauNewNonStrictFixGenericTypePacks, true};
+
+    CheckResult result = checkNonStrict(R"(
+        --!nonstrict
+        local test: <T...>(T...) -> () -- TypeError: Unknown type 'T'
+    )");
+
+    LUAU_REQUIRE_NO_ERRORS(result);
+}
+
 TEST_CASE_FIXTURE(NonStrictTypeCheckerFixture, "optionals_in_checked_function_in_middle_cannot_be_omitted")
 {
     CheckResult result = checkNonStrict(R"(

tests/Normalize.test.cpp

@@ -14,7 +14,7 @@ LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTINT(LuauTypeInferRecursionLimit)
 LUAU_FASTINT(LuauNormalizeIntersectionLimit)
 LUAU_FASTINT(LuauNormalizeUnionLimit)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauRefineWaitForBlockedTypesInTarget)
 LUAU_FASTFLAG(LuauSimplifyOutOfLine)
 LUAU_FASTFLAG(LuauOptimizeFalsyAndTruthyIntersect)
@@ -1206,7 +1206,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "fuzz_union_type_pack_cycle")
         {FFlag::LuauNoMoreInjectiveTypeFunctions, true},
         {FFlag::LuauOptimizeFalsyAndTruthyIntersect, true},
         {FFlag::LuauClipVariadicAnysFromArgsToGenericFuncs2, true},
-        {FFlag::LuauEagerGeneralization, true}
+        {FFlag::LuauEagerGeneralization2, true}
     };
     ScopedFastInt sfi{FInt::LuauTypeInferRecursionLimit, 0};
 

tests/Parser.test.cpp

@@ -2086,7 +2086,8 @@ TEST_CASE_FIXTURE(Fixture, "parse_extern_type_declarations")
         declare extern type Bar extends Foo with
             prop2: string
         end
-    )").root;
+    )")
+                             .root;
 
     REQUIRE_EQ(stat->body.size, 2);
 
@@ -2194,7 +2195,8 @@ TEST_CASE_FIXTURE(Fixture, "parse_extern_type_declarations")
         declare extern type Bar extends Foo with
             prop2: string
         end
-    )").root;
+    )")
+                             .root;
 
     REQUIRE_EQ(stat->body.size, 2);
 
@@ -2355,9 +2357,7 @@ TEST_CASE_FIXTURE(Fixture, "class_indexer")
             [number]: number
         end
         )",
-        (FFlag::LuauDeclareExternType)
-        ? "Cannot have more than one indexer on an extern type"
-        : "Cannot have more than one class indexer"
+        (FFlag::LuauDeclareExternType) ? "Cannot have more than one indexer on an extern type" : "Cannot have more than one class indexer"
     );
 
     REQUIRE_EQ(1, p1.root->body.size);
@@ -2904,10 +2904,13 @@ TEST_CASE_FIXTURE(Fixture, "for_loop_with_single_var_has_comma_positions_of_size
     ParseOptions parseOptions;
     parseOptions.storeCstData = true;
 
-    ParseResult result = parseEx(R"(
+    ParseResult result = parseEx(
+        R"(
         for value in tbl do
         end
-    )", parseOptions);
+    )",
+        parseOptions
+    );
     REQUIRE(result.root);
     REQUIRE_EQ(1, result.root->body.size);
 
@@ -4188,7 +4191,7 @@ TEST_CASE_FIXTURE(Fixture, "grouped_function_type")
     CHECK_EQ(unionTy->types.size, 2);
     auto groupTy = unionTy->types.data[0]->as<AstTypeGroup>(); // (() -> ())
     REQUIRE(groupTy);
-    CHECK(groupTy->type->is<AstTypeFunction>()); // () -> ()
+    CHECK(groupTy->type->is<AstTypeFunction>());          // () -> ()
     CHECK(unionTy->types.data[1]->is<AstTypeOptional>()); // ?
 }
 

tests/Subtyping.test.cpp

@@ -17,7 +17,7 @@
 
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTFLAG(LuauSubtypeGenericsAndNegations)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 using namespace Luau;
 
@@ -1629,19 +1629,13 @@ TEST_CASE_FIXTURE(SubtypeFixture, "substitute_a_generic_for_a_negation")
     TypeId bTy = arena.addType(GenericType{"B"});
     getMutable<GenericType>(bTy)->scope = moduleScope.get();
 
-    TypeId genericFunctionTy = arena.addType(FunctionType{
-        {aTy, bTy},
-        {},
-        arena.addTypePack({aTy, bTy}),
-        arena.addTypePack({join(meet(aTy, builtinTypes->truthyType), bTy)})
-    });
+    TypeId genericFunctionTy =
+        arena.addType(FunctionType{{aTy, bTy}, {}, arena.addTypePack({aTy, bTy}), arena.addTypePack({join(meet(aTy, builtinTypes->truthyType), bTy)})}
+        );
 
     const TypeId truthyTy = builtinTypes->truthyType;
 
-    TypeId actualFunctionTy = fn(
-        {truthyTy, truthyTy},
-        {join(meet(truthyTy, builtinTypes->truthyType), truthyTy)}
-    );
+    TypeId actualFunctionTy = fn({truthyTy, truthyTy}, {join(meet(truthyTy, builtinTypes->truthyType), truthyTy)});
 
     SubtypingResult result = isSubtype(genericFunctionTy, actualFunctionTy);
 
@@ -1650,7 +1644,7 @@ TEST_CASE_FIXTURE(SubtypeFixture, "substitute_a_generic_for_a_negation")
 
 TEST_CASE_FIXTURE(SubtypeFixture, "free_types_might_be_subtypes")
 {
-    ScopedFastFlag sff{FFlag::LuauEagerGeneralization, true};
+    ScopedFastFlag sff{FFlag::LuauEagerGeneralization2, true};
 
     TypeId argTy = arena.freshType(builtinTypes, moduleScope.get());
     FreeType* freeArg = getMutable<FreeType>(argTy);

tests/ToString.test.cpp

@@ -878,7 +878,7 @@ TEST_CASE_FIXTURE(Fixture, "tostring_unsee_ttv_if_array")
 
 TEST_CASE_FIXTURE(Fixture, "tostring_error_mismatch")
 {
-    ScopedFastFlag _ {FFlag::LuauTableLiteralSubtypeSpecificCheck, true};
+    ScopedFastFlag _{FFlag::LuauTableLiteralSubtypeSpecificCheck, true};
 
     CheckResult result = check(R"(
         --!strict
@@ -889,26 +889,26 @@ TEST_CASE_FIXTURE(Fixture, "tostring_error_mismatch")
 
     std::string expected;
     if (FFlag::LuauSolverV2)
-        expected =  "Type\n\t"
-                    "'{ a: number, b: string, c: { d: string } }'\n"
-                    "could not be converted into\n\t"
-                    "'{ a: number, b: string, c: { d: number } }'; \n"
-                    "this is because accessing `c.d` results in `string` in the former type and `number` in the latter "
-                    "type, and `string` is not exactly `number`";
+        expected = "Type\n\t"
+                   "'{ a: number, b: string, c: { d: string } }'\n"
+                   "could not be converted into\n\t"
+                   "'{ a: number, b: string, c: { d: number } }'; \n"
+                   "this is because accessing `c.d` results in `string` in the former type and `number` in the latter "
+                   "type, and `string` is not exactly `number`";
     else
-        expected =  "Type\n\t"
-                    "'{| a: number, b: string, c: {| d: string |} |}'\n"
-                    "could not be converted into\n\t"
-                    "'{| a: number, b: string, c: {| d: number |} |}'\n"
-                    "caused by:\n  "
-                    "Property 'c' is not compatible.\n"
-                    "Type\n\t"
-                    "'{| d: string |}'\n"
-                    "could not be converted into\n\t"
-                    "'{| d: number |}'\n"
-                    "caused by:\n  "
-                    "Property 'd' is not compatible.\n"
-                    "Type 'string' could not be converted into 'number' in an invariant context";
+        expected = "Type\n\t"
+                   "'{| a: number, b: string, c: {| d: string |} |}'\n"
+                   "could not be converted into\n\t"
+                   "'{| a: number, b: string, c: {| d: number |} |}'\n"
+                   "caused by:\n  "
+                   "Property 'c' is not compatible.\n"
+                   "Type\n\t"
+                   "'{| d: string |}'\n"
+                   "could not be converted into\n\t"
+                   "'{| d: number |}'\n"
+                   "caused by:\n  "
+                   "Property 'd' is not compatible.\n"
+                   "Type 'string' could not be converted into 'number' in an invariant context";
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
     std::string actual = toString(result.errors[0]);

tests/TypeFunction.test.cpp

@@ -14,7 +14,7 @@ using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_DYNAMIC_FASTINT(LuauTypeFamilyApplicationCartesianProductLimit)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauHasPropProperBlock)
 LUAU_FASTFLAG(LuauSimplifyOutOfLine)
 LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
@@ -1725,7 +1725,7 @@ struct TFFixture
     TypeFunctionRuntime runtime{NotNull{&ice}, NotNull{&limits}};
 
     const ScopedFastFlag sff[1] = {
-        {FFlag::LuauEagerGeneralization, true},
+        {FFlag::LuauEagerGeneralization2, true},
     };
 
     BuiltinTypeFunctions builtinTypeFunctions;
@@ -1746,9 +1746,7 @@ TEST_CASE_FIXTURE(TFFixture, "refine<G, ~(false?)>")
 {
     TypeId g = arena->addType(GenericType{globalScope.get(), Polarity::Negative});
 
-    TypeId refineTy = arena->addType(TypeFunctionInstanceType{
-        builtinTypeFunctions.refineFunc, {g, builtinTypes->truthyType}
-    });
+    TypeId refineTy = arena->addType(TypeFunctionInstanceType{builtinTypeFunctions.refineFunc, {g, builtinTypes->truthyType}});
 
     FunctionGraphReductionResult res = reduceTypeFunctions(refineTy, Location{}, tfc);
 
@@ -1764,9 +1762,7 @@ TEST_CASE_FIXTURE(TFFixture, "or<'a, 'b>")
     TypeId aType = arena->freshType(builtinTypes, globalScope.get());
     TypeId bType = arena->freshType(builtinTypes, globalScope.get());
 
-    TypeId orType = arena->addType(TypeFunctionInstanceType{
-        builtinTypeFunctions.orFunc, {aType, bType}
-    });
+    TypeId orType = arena->addType(TypeFunctionInstanceType{builtinTypeFunctions.orFunc, {aType, bType}});
 
     FunctionGraphReductionResult res = reduceTypeFunctions(orType, Location{}, tfc);
 

tests/TypeFunction.user.test.cpp

@@ -9,8 +9,9 @@ using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTFLAG(DebugLuauEqSatSimplification)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
+LUAU_FASTFLAG(LuauUserTypeFunctionAliases)
 
 TEST_SUITE_BEGIN("UserDefinedTypeFunctionTests");
 
@@ -1987,7 +1988,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "udtf_singleton_equality_bool")
 {
     ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         // FIXME: CLI-151985
         // This test breaks because we can't see that eq<type?, b> is already fully reduced.
@@ -2010,7 +2011,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "udtf_singleton_equality_string")
 {
     ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         // FIXME: CLI-151985
         // This test breaks because we can't see that eq<type?, b> is already fully reduced.
@@ -2225,4 +2226,203 @@ TEST_CASE_FIXTURE(Fixture, "typeof_is_not_a_valid_type_function_name")
     CHECK("typeof cannot be used as an identifier for a type function or alias" == toString(result.errors[0]));
 }
 
+TEST_CASE_FIXTURE(BuiltinsFixture, "type_alias_call")
+{
+    ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type Test<T> = T?
+
+type function foo(t)
+    return Test(t)
+end
+
+local x: foo<{a: number}> = { a = 2 }
+local y: foo<{b: number}> = { b = 2 }
+    )");
+
+    LUAU_REQUIRE_NO_ERRORS(result);
+
+    CHECK(toString(requireType("x"), ToStringOptions{true}) == "{ a: number }?");
+    CHECK(toString(requireType("y"), ToStringOptions{true}) == "{ b: number }?");
+}
+
+TEST_CASE_FIXTURE(BuiltinsFixture, "type_alias_values")
+{
+    ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type Test = { a: number }
+
+type function foo(t)
+    return types.unionof(Test, t)
+end
+
+local x: foo<nil> = { a = 2 }
+local y: foo<string> = "a"
+    )");
+
+    LUAU_REQUIRE_NO_ERRORS(result);
+
+    CHECK(toString(requireType("x"), ToStringOptions{true}) == "{ a: number }?");
+    CHECK(toString(requireType("y"), ToStringOptions{true}) == "string | { a: number }");
+}
+
+TEST_CASE_FIXTURE(BuiltinsFixture, "type_alias_call_with_reduction")
+{
+    if (!FFlag::LuauSolverV2)
+        return;
+
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type Test<T> = rawget<T, "a">
+
+type function foo(t)
+    return Test(t)
+end
+
+local x: foo<{ a: number }> = 2
+local y: foo<{ a: string }> = "x"
+    )");
+
+    LUAU_REQUIRE_NO_ERRORS(result);
+
+    CHECK(toString(requireType("x"), ToStringOptions{true}) == "number");
+    CHECK(toString(requireType("y"), ToStringOptions{true}) == "string");
+}
+
+TEST_CASE_FIXTURE(BuiltinsFixture, "type_alias_implicit_export")
+{
+    if (!FFlag::LuauSolverV2)
+        return;
+
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    fileResolver.source["game/A"] = R"(
+type Test<T> = rawget<T, "a">
+
+export type function foo(t)
+    return Test(t)
+end
+local x: foo<{ a: number }> = 2
+return {}
+    )";
+
+    CheckResult aResult = frontend.check("game/A");
+    LUAU_REQUIRE_NO_ERRORS(aResult);
+
+    CHECK(toString(requireType("game/A", "x")) == R"(number)");
+
+    CheckResult bResult = check(R"(
+local Test = require(game.A);
+local y: Test.foo<{ a: string }> = "x"
+    )");
+    LUAU_REQUIRE_NO_ERRORS(bResult);
+
+    CHECK(toString(requireType("y")) == R"(string)");
+}
+
+TEST_CASE_FIXTURE(ExternTypeFixture, "type_alias_not_too_many_globals")
+{
+    ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type function get()
+    return number
+end
+local function ok(idx: get<>): number return idx end
+    )");
+
+    LUAU_REQUIRE_ERROR_COUNT(5, result);
+    CHECK(toString(result.errors[0]) == R"(Unknown global 'number')");
+}
+
+TEST_CASE_FIXTURE(ExternTypeFixture, "type_alias_not_enough_arguments")
+{
+    ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type Test<A, B> = (a: A, b: B) -> A
+
+type function get()
+    return Test(types.number)
+end
+
+local function ok(idx: get<>): number return idx end
+    )");
+
+    LUAU_REQUIRE_ERROR_COUNT(4, result);
+    CHECK(toString(result.errors[0]) == R"('get' type function errored at runtime: [string "get"]:5: not enough arguments to call)");
+}
+
+TEST_CASE_FIXTURE(BuiltinsFixture, "type_alias_can_call_packs")
+{
+    ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type Test<T, U...> = (U...) -> T
+
+type function foo(t)
+    return Test(types.number, types.string, t)
+end
+
+local x: foo<boolean>
+    )");
+
+    LUAU_REQUIRE_NO_ERRORS(result);
+
+    CHECK(toString(requireType("x"), ToStringOptions{true}) == "(string, boolean) -> number");
+}
+
+TEST_CASE_FIXTURE(ExternTypeFixture, "type_alias_reduction_errors")
+{
+    if (!FFlag::LuauSolverV2)
+        return;
+
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type Test<T, U> = setmetatable<T, U>
+
+type function get()
+    return Test(types.number, types.string)
+end
+
+local function ok(idx: get<>): number return idx end
+    )");
+
+    // TODO: type solving fails to complete in this test because of the blocked NameConstraint on the 'Test' alias
+    LUAU_REQUIRE_ERROR_COUNT(5, result);
+    CHECK(
+        toString(result.errors[1]) ==
+        R"('get' type function errored at runtime: [string "get"]:5: failed to reduce type function with: Type function instance setmetatable<number, string> is uninhabited)"
+    );
+}
+
+TEST_CASE_FIXTURE(BuiltinsFixture, "type_alias_unreferenced_do_not_block")
+{
+    ScopedFastFlag newSolver{FFlag::LuauSolverV2, true};
+    ScopedFastFlag luauUserTypeFunctionAliases{FFlag::LuauUserTypeFunctionAliases, true};
+
+    CheckResult result = check(R"(
+type function foo(t)
+    return types.unionof(types.number, t)
+end
+
+type Test = foo<string>
+
+local x: foo<boolean>
+    )");
+
+    LUAU_REQUIRE_NO_ERRORS(result);
+
+    CHECK(toString(requireType("x"), ToStringOptions{true}) == "boolean | number");
+}
+
 TEST_SUITE_END();

tests/TypeInfer.aliases.test.cpp

@@ -10,7 +10,6 @@
 using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
-LUAU_FASTFLAG(LuauRetainDefinitionAliasLocations)
 LUAU_FASTFLAG(LuauNewNonStrictVisitTypes2)
 LUAU_FASTFLAG(LuauGuardAgainstMalformedTypeAliasExpansion2)
 LUAU_FASTFLAG(LuauSkipMalformedTypeAliases)
@@ -1217,8 +1216,6 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "gh1632_no_infinite_recursion_in_normalizatio
 
 TEST_CASE_FIXTURE(Fixture, "exported_alias_location_is_accessible_on_module")
 {
-    ScopedFastFlag sff{FFlag::LuauRetainDefinitionAliasLocations, true};
-
     CheckResult result = check(R"(
         export type Value = string
     )");
@@ -1235,7 +1232,6 @@ TEST_CASE_FIXTURE(Fixture, "exported_type_function_location_is_accessible_on_mod
 {
     ScopedFastFlag flags[] = {
         {FFlag::LuauSolverV2, true},
-        {FFlag::LuauRetainDefinitionAliasLocations, true},
     };
 
     CheckResult result = check(R"(

tests/TypeInfer.anyerror.test.cpp

@@ -356,7 +356,6 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "replace_every_free_type_when_unifying_a_comp
 
     LUAU_REQUIRE_NO_ERRORS(result);
     CHECK_EQ("any", toString(requireType("b")));
-
 }
 
 TEST_CASE_FIXTURE(Fixture, "call_to_any_yields_any")

tests/TypeInfer.builtins.test.cpp

@@ -11,7 +11,7 @@ using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTFLAG(LuauTableCloneClonesType3)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauArityMismatchOnUndersaturatedUnknownArguments)
 
 TEST_SUITE_BEGIN("BuiltinTests");
@@ -146,20 +146,19 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "sort_with_bad_predicate")
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(number, number) -> boolean'"
-        "\ncould not be converted into\n\t"
-        "'((string, string) -> boolean)?'"
-        "\ncaused by:\n"
-        "  None of the union options are compatible. For example:\n"
-        "Type\n\t"
-        "'(number, number) -> boolean'"
-        "\ncould not be converted into\n\t"
-        "'(string, string) -> boolean'"
-        "\ncaused by:\n"
-        "  Argument #1 type is not compatible.\n"
-        "Type 'string' could not be converted into 'number'";
+    const std::string expected = "Type\n\t"
+                                 "'(number, number) -> boolean'"
+                                 "\ncould not be converted into\n\t"
+                                 "'((string, string) -> boolean)?'"
+                                 "\ncaused by:\n"
+                                 "  None of the union options are compatible. For example:\n"
+                                 "Type\n\t"
+                                 "'(number, number) -> boolean'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(string, string) -> boolean'"
+                                 "\ncaused by:\n"
+                                 "  Argument #1 type is not compatible.\n"
+                                 "Type 'string' could not be converted into 'number'";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -460,7 +459,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "table_pack_reduce")
     )");
 
     LUAU_REQUIRE_NO_ERRORS(result);
-    if (FFlag::LuauSolverV2 && FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauSolverV2 && FFlag::LuauEagerGeneralization2)
         CHECK("{ [number]: string | string | string, n: number }" == toString(requireType("t")));
     else if (FFlag::LuauSolverV2)
         CHECK_EQ("{ [number]: string, n: number }", toString(requireType("t")));

tests/TypeInfer.classes.test.cpp

@@ -822,7 +822,8 @@ TEST_CASE_FIXTURE(ExternTypeFixture, "cannot_index_a_class_with_no_indexer")
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
     CHECK_MESSAGE(
-        get<DynamicPropertyLookupOnExternTypesUnsafe>(result.errors[0]), "Expected DynamicPropertyLookupOnExternTypesUnsafe but got " << result.errors[0]
+        get<DynamicPropertyLookupOnExternTypesUnsafe>(result.errors[0]),
+        "Expected DynamicPropertyLookupOnExternTypesUnsafe but got " << result.errors[0]
     );
 
     CHECK(builtinTypes->errorType == requireType("c"));

tests/TypeInfer.functions.test.cpp

@@ -22,7 +22,7 @@ LUAU_FASTFLAG(LuauInstantiateInSubtyping)
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTINT(LuauTarjanChildLimit)
 LUAU_FASTFLAG(DebugLuauEqSatSimplification)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauArityMismatchOnUndersaturatedUnknownArguments)
 LUAU_FASTFLAG(LuauHasPropProperBlock)
 LUAU_FASTFLAG(LuauOptimizeFalsyAndTruthyIntersect)
@@ -1519,13 +1519,12 @@ local b: B = a
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(number, number) -> string'"
-        "\ncould not be converted into\n\t"
-        "'(number) -> string'"
-        "\ncaused by:\n"
-        "  Argument count mismatch. Function expects 2 arguments, but only 1 is specified";
+    const std::string expected = "Type\n\t"
+                                 "'(number, number) -> string'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number) -> string'"
+                                 "\ncaused by:\n"
+                                 "  Argument count mismatch. Function expects 2 arguments, but only 1 is specified";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -1543,14 +1542,13 @@ local b: B = a
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(number, number) -> string'"
-        "\ncould not be converted into\n\t"
-        "'(number, string) -> string'"
-        "\ncaused by:\n"
-        "  Argument #2 type is not compatible.\n"
-        "Type 'string' could not be converted into 'number'";
+    const std::string expected = "Type\n\t"
+                                 "'(number, number) -> string'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number, string) -> string'"
+                                 "\ncaused by:\n"
+                                 "  Argument #2 type is not compatible.\n"
+                                 "Type 'string' could not be converted into 'number'";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -1568,13 +1566,12 @@ local b: B = a
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(number, number) -> number'"
-        "\ncould not be converted into\n\t"
-        "'(number, number) -> (number, boolean)'"
-        "\ncaused by:\n"
-        "  Function only returns 1 value, but 2 are required here";
+    const std::string expected = "Type\n\t"
+                                 "'(number, number) -> number'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number, number) -> (number, boolean)'"
+                                 "\ncaused by:\n"
+                                 "  Function only returns 1 value, but 2 are required here";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -1592,14 +1589,13 @@ local b: B = a
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(number, number) -> string'"
-        "\ncould not be converted into\n\t"
-        "'(number, number) -> number'"
-        "\ncaused by:\n"
-        "  Return type is not compatible.\n"
-        "Type 'string' could not be converted into 'number'";
+    const std::string expected = "Type\n\t"
+                                 "'(number, number) -> string'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number, number) -> number'"
+                                 "\ncaused by:\n"
+                                 "  Return type is not compatible.\n"
+                                 "Type 'string' could not be converted into 'number'";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -1617,14 +1613,13 @@ local b: B = a
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(number, number) -> (number, string)'"
-        "\ncould not be converted into\n\t"
-        "'(number, number) -> (number, boolean)'"
-        "\ncaused by:\n"
-        "  Return #2 type is not compatible.\n"
-        "Type 'string' could not be converted into 'boolean'";
+    const std::string expected = "Type\n\t"
+                                 "'(number, number) -> (number, string)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number, number) -> (number, boolean)'"
+                                 "\ncaused by:\n"
+                                 "  Return #2 type is not compatible.\n"
+                                 "Type 'string' could not be converted into 'boolean'";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -1688,7 +1683,7 @@ t.f = function(x)
 end
     )");
 
-    if (FFlag::LuauEagerGeneralization && FFlag::LuauSolverV2)
+    if (FFlag::LuauEagerGeneralization2 && FFlag::LuauSolverV2)
     {
         // FIXME CLI-151985
         LUAU_CHECK_ERROR_COUNT(3, result);
@@ -1773,7 +1768,7 @@ t.f = function(x)
 end
     )");
 
-    if (FFlag::LuauEagerGeneralization && FFlag::LuauSolverV2)
+    if (FFlag::LuauEagerGeneralization2 && FFlag::LuauSolverV2)
     {
         // FIXME CLI-151985
         LUAU_CHECK_ERROR_COUNT(2, result);
@@ -1950,10 +1945,7 @@ TEST_CASE_FIXTURE(Fixture, "free_is_not_bound_to_unknown")
 
 TEST_CASE_FIXTURE(Fixture, "dont_infer_parameter_types_for_functions_from_their_call_site")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::LuauHasPropProperBlock, true},
-        {FFlag::LuauOptimizeFalsyAndTruthyIntersect, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::LuauHasPropProperBlock, true}, {FFlag::LuauOptimizeFalsyAndTruthyIntersect, true}};
 
     CheckResult result = check(R"(
         local t = {}
@@ -1975,7 +1967,7 @@ TEST_CASE_FIXTURE(Fixture, "dont_infer_parameter_types_for_functions_from_their_
 
     CHECK_EQ("<a>(a) -> a", toString(requireType("f")));
 
-    if (FFlag::LuauEagerGeneralization && FFlag::LuauSolverV2)
+    if (FFlag::LuauEagerGeneralization2 && FFlag::LuauSolverV2)
     {
         LUAU_CHECK_NO_ERRORS(result);
         CHECK("<a>({ read p: { read q: a } }) -> (a & ~(false?))?" == toString(requireType("g")));
@@ -2940,7 +2932,7 @@ TEST_CASE_FIXTURE(Fixture, "unifier_should_not_bind_free_types")
     {
         // The new solver should ideally be able to do better here, but this is no worse than the old solver.
 
-        if (FFlag::LuauEagerGeneralization)
+        if (FFlag::LuauEagerGeneralization2)
         {
             LUAU_REQUIRE_ERROR_COUNT(2, result);
             auto tm1 = get<TypeMismatch>(result.errors[0]);

tests/TypeInfer.intersectionTypes.test.cpp

@@ -357,13 +357,12 @@ TEST_CASE_FIXTURE(Fixture, "table_intersection_write_sealed_indirect")
     {
         LUAU_REQUIRE_ERROR_COUNT(4, result);
 
-        const std::string expected =
-            "Type\n\t"
-            "'(string, number) -> string'"
-            "\ncould not be converted into\n\t"
-            "'(string) -> string'\n"
-            "caused by:\n"
-            "  Argument count mismatch. Function expects 2 arguments, but only 1 is specified";
+        const std::string expected = "Type\n\t"
+                                     "'(string, number) -> string'"
+                                     "\ncould not be converted into\n\t"
+                                     "'(string) -> string'\n"
+                                     "caused by:\n"
+                                     "  Argument count mismatch. Function expects 2 arguments, but only 1 is specified";
 
         CHECK_EQ(expected, toString(result.errors[0]));
         CHECK_EQ(toString(result.errors[1]), "Cannot add property 'z' to table 'X & Y'");
@@ -389,13 +388,12 @@ TEST_CASE_FIXTURE(Fixture, "table_write_sealed_indirect")
     )");
 
     LUAU_REQUIRE_ERROR_COUNT(4, result);
-    const std::string expected =
-        "Type\n\t"
-        "'(string, number) -> string'"
-        "\ncould not be converted into\n\t"
-        "'(string) -> string'\n"
-        "caused by:\n"
-        "  Argument count mismatch. Function expects 2 arguments, but only 1 is specified";
+    const std::string expected = "Type\n\t"
+                                 "'(string, number) -> string'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(string) -> string'\n"
+                                 "caused by:\n"
+                                 "  Argument count mismatch. Function expects 2 arguments, but only 1 is specified";
     CHECK_EQ(expected, toString(result.errors[0]));
 
     CHECK_EQ(toString(result.errors[1]), "Cannot add property 'z' to table 'XY'");
@@ -428,15 +426,14 @@ local a: XYZ = 3
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type "
-            "'number'"
-            " could not be converted into "
-            "'X & Y & Z'; \n"
-            "this is because \n\t"
-            " * the 1st component of the intersection is `X`, and `number` is not a subtype of `X`\n\t"
-            " * the 2nd component of the intersection is `Y`, and `number` is not a subtype of `Y`\n\t"
-            " * the 3rd component of the intersection is `Z`, and `number` is not a subtype of `Z`";
+        const std::string expected = "Type "
+                                     "'number'"
+                                     " could not be converted into "
+                                     "'X & Y & Z'; \n"
+                                     "this is because \n\t"
+                                     " * the 1st component of the intersection is `X`, and `number` is not a subtype of `X`\n\t"
+                                     " * the 2nd component of the intersection is `Y`, and `number` is not a subtype of `Y`\n\t"
+                                     " * the 3rd component of the intersection is `Z`, and `number` is not a subtype of `Z`";
 
         CHECK_EQ(expected, toString(result.errors[0]));
     }
@@ -527,14 +524,13 @@ TEST_CASE_FIXTURE(Fixture, "intersect_bool_and_false")
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type "
-            "'boolean & false'"
-            " could not be converted into "
-            "'true'; \n"
-            "this is because \n\t"
-            " * the 1st component of the intersection is `boolean`, which is not a subtype of `true`\n\t"
-            " * the 2nd component of the intersection is `false`, which is not a subtype of `true`";
+        const std::string expected = "Type "
+                                     "'boolean & false'"
+                                     " could not be converted into "
+                                     "'true'; \n"
+                                     "this is because \n\t"
+                                     " * the 1st component of the intersection is `boolean`, which is not a subtype of `true`\n\t"
+                                     " * the 2nd component of the intersection is `false`, which is not a subtype of `true`";
         CHECK_EQ(expected, toString(result.errors[0]));
     }
     else
@@ -557,15 +553,14 @@ TEST_CASE_FIXTURE(Fixture, "intersect_false_and_bool_and_false")
     // TODO: odd stringification of `false & (boolean & false)`.)
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type "
-            "'boolean & false & false'"
-            " could not be converted into "
-            "'true'; \n"
-            "this is because \n\t"
-            " * the 1st component of the intersection is `false`, which is not a subtype of `true`\n\t"
-            " * the 2nd component of the intersection is `boolean`, which is not a subtype of `true`\n\t"
-            " * the 3rd component of the intersection is `false`, which is not a subtype of `true`";
+        const std::string expected = "Type "
+                                     "'boolean & false & false'"
+                                     " could not be converted into "
+                                     "'true'; \n"
+                                     "this is because \n\t"
+                                     " * the 1st component of the intersection is `false`, which is not a subtype of `true`\n\t"
+                                     " * the 2nd component of the intersection is `boolean`, which is not a subtype of `true`\n\t"
+                                     " * the 3rd component of the intersection is `false`, which is not a subtype of `true`";
         CHECK_EQ(expected, toString(result.errors[0]));
     }
     else
@@ -640,13 +635,11 @@ TEST_CASE_FIXTURE(Fixture, "union_saturate_overloaded_functions")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'((number) -> number) & ((string) -> string)'"
-        "\ncould not be converted into\n\t"
-        "'(boolean | number) -> boolean | number'; none of the intersection parts are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'((number) -> number) & ((string) -> string)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(boolean | number) -> boolean | number'; none of the intersection parts are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
-
 }
 
 TEST_CASE_FIXTURE(Fixture, "intersection_of_tables")
@@ -662,16 +655,15 @@ TEST_CASE_FIXTURE(Fixture, "intersection_of_tables")
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type "
-            "'{ p: number?, q: number?, r: number? } & { p: number?, q: string? }'"
-            " could not be converted into "
-            "'{ p: nil }'; \n"
-            "this is because \n\t"
-            " * in the 1st component of the intersection, accessing `p` has the 1st component of the union as `number` and "
-            "accessing `p` results in `nil`, and `number` is not exactly `nil`\n\t"
-            " * in the 2nd component of the intersection, accessing `p` has the 1st component of the union as `number` and "
-            "accessing `p` results in `nil`, and `number` is not exactly `nil`";
+        const std::string expected = "Type "
+                                     "'{ p: number?, q: number?, r: number? } & { p: number?, q: string? }'"
+                                     " could not be converted into "
+                                     "'{ p: nil }'; \n"
+                                     "this is because \n\t"
+                                     " * in the 1st component of the intersection, accessing `p` has the 1st component of the union as `number` and "
+                                     "accessing `p` results in `nil`, and `number` is not exactly `nil`\n\t"
+                                     " * in the 2nd component of the intersection, accessing `p` has the 1st component of the union as `number` and "
+                                     "accessing `p` results in `nil`, and `number` is not exactly `nil`";
         CHECK_EQ(expected, toString(result.errors[0]));
     }
     else
@@ -696,24 +688,23 @@ TEST_CASE_FIXTURE(Fixture, "intersection_of_tables_with_top_properties")
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type\n\t"
-            "'{ p: number?, q: any } & { p: unknown, q: string? }'"
-            "\ncould not be converted into\n\t"
-            "'{ p: string?, q: number? }'; \n"
-            "this is because \n\t"
-            " * in the 1st component of the intersection, accessing `p` has the 1st component of the union as `number` and "
-            "accessing `p` results in `string?`, and `number` is not exactly `string?`\n\t"
-            " * in the 1st component of the intersection, accessing `p` results in `number?` and accessing `p` has the 1st "
-            "component of the union as `string`, and `number?` is not exactly `string`\n\t"
-            " * in the 1st component of the intersection, accessing `q` results in `any` and accessing `q` results in "
-            "`number?`, and `any` is not exactly `number?`\n\t"
-            " * in the 2nd component of the intersection, accessing `p` results in `unknown` and accessing `p` results in "
-            "`string?`, and `unknown` is not exactly `string?`\n\t"
-            " * in the 2nd component of the intersection, accessing `q` has the 1st component of the union as `string` and "
-            "accessing `q` results in `number?`, and `string` is not exactly `number?`\n\t"
-            " * in the 2nd component of the intersection, accessing `q` results in `string?` and accessing `q` has the 1st "
-            "component of the union as `number`, and `string?` is not exactly `number`";
+        const std::string expected = "Type\n\t"
+                                     "'{ p: number?, q: any } & { p: unknown, q: string? }'"
+                                     "\ncould not be converted into\n\t"
+                                     "'{ p: string?, q: number? }'; \n"
+                                     "this is because \n\t"
+                                     " * in the 1st component of the intersection, accessing `p` has the 1st component of the union as `number` and "
+                                     "accessing `p` results in `string?`, and `number` is not exactly `string?`\n\t"
+                                     " * in the 1st component of the intersection, accessing `p` results in `number?` and accessing `p` has the 1st "
+                                     "component of the union as `string`, and `number?` is not exactly `string`\n\t"
+                                     " * in the 1st component of the intersection, accessing `q` results in `any` and accessing `q` results in "
+                                     "`number?`, and `any` is not exactly `number?`\n\t"
+                                     " * in the 2nd component of the intersection, accessing `p` results in `unknown` and accessing `p` results in "
+                                     "`string?`, and `unknown` is not exactly `string?`\n\t"
+                                     " * in the 2nd component of the intersection, accessing `q` has the 1st component of the union as `string` and "
+                                     "accessing `q` results in `number?`, and `string` is not exactly `number?`\n\t"
+                                     " * in the 2nd component of the intersection, accessing `q` results in `string?` and accessing `q` has the 1st "
+                                     "component of the union as `number`, and `string?` is not exactly `number`";
         CHECK_EQ(expected, toString(result.errors[0]));
     }
     else
@@ -924,9 +915,9 @@ TEST_CASE_FIXTURE(Fixture, "overloadeded_functions_with_unknown_result")
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
     const std::string expected = "Type\n\t"
-        "'((nil) -> unknown) & ((number) -> number)'"
-        "\ncould not be converted into\n\t"
-        "'(number?) -> number?'; none of the intersection parts are compatible";
+                                 "'((nil) -> unknown) & ((number) -> number)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number?) -> number?'; none of the intersection parts are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -946,11 +937,10 @@ TEST_CASE_FIXTURE(Fixture, "overloadeded_functions_with_unknown_arguments")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'((number) -> number?) & ((unknown) -> string?)'"
-        "\ncould not be converted into\n\t"
-        "'(number?) -> nil'; none of the intersection parts are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'((number) -> number?) & ((unknown) -> string?)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number?) -> nil'; none of the intersection parts are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -1075,9 +1065,9 @@ TEST_CASE_FIXTURE(Fixture, "overloadeded_functions_with_overlapping_results_and_
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
     const std::string expected = "Type\n\t"
-        "'((number?) -> (...number)) & ((string?) -> number | string)'"
-        "\ncould not be converted into\n\t"
-        "'(number | string) -> (number, number?)'; none of the intersection parts are compatible";
+                                 "'((number?) -> (...number)) & ((string?) -> number | string)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(number | string) -> (number, number?)'; none of the intersection parts are compatible";
     CHECK(expected == toString(result.errors[0]));
 }
 
@@ -1172,16 +1162,15 @@ TEST_CASE_FIXTURE(Fixture, "overloadeded_functions_with_weird_typepacks_4")
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type\n\t"
-            "'((a...) -> ()) & ((number, a...) -> number)'"
-            "\ncould not be converted into\n\t"
-            "'((a...) -> ()) & ((number, a...) -> number)'; \n"
-            "this is because \n\t"
-            " * in the 1st component of the intersection, the function returns is `()` in the former type and `number` in "
-            "the latter type, and `()` is not a subtype of `number`\n\t"
-            " * in the 2nd component of the intersection, the function takes a tail of `a...` and in the 1st component of "
-            "the intersection, the function takes a tail of `a...`, and `a...` is not a supertype of `a...`";
+        const std::string expected = "Type\n\t"
+                                     "'((a...) -> ()) & ((number, a...) -> number)'"
+                                     "\ncould not be converted into\n\t"
+                                     "'((a...) -> ()) & ((number, a...) -> number)'; \n"
+                                     "this is because \n\t"
+                                     " * in the 1st component of the intersection, the function returns is `()` in the former type and `number` in "
+                                     "the latter type, and `()` is not a subtype of `number`\n\t"
+                                     " * in the 2nd component of the intersection, the function takes a tail of `a...` and in the 1st component of "
+                                     "the intersection, the function takes a tail of `a...`, and `a...` is not a supertype of `a...`";
         CHECK(expected == toString(result.errors[0]));
     }
     else

tests/TypeInfer.loops.test.cpp

@@ -1519,7 +1519,6 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "repeat_is_linearish")
     )"));
 
     CHECK_EQ("nil", toString(requireType("y")));
-
 }
 
 TEST_CASE_FIXTURE(Fixture, "ensure_local_in_loop_does_not_escape")
@@ -1539,7 +1538,6 @@ TEST_CASE_FIXTURE(Fixture, "ensure_local_in_loop_does_not_escape")
     )"));
 
     CHECK_EQ("number", toString(requireType("y")));
-
 }
 
 TEST_SUITE_END();

tests/TypeInfer.modules.test.cpp

@@ -13,7 +13,7 @@
 LUAU_FASTFLAG(LuauInstantiateInSubtyping)
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTFLAG(LuauAddCallConstraintForIterableFunctions)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauOptimizeFalsyAndTruthyIntersect)
 LUAU_FASTFLAG(LuauClipVariadicAnysFromArgsToGenericFuncs2)
 
@@ -467,10 +467,9 @@ local b: B.T = a
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type 'T' from 'game/A' could not be converted into 'T' from 'game/B'; \n"
-            "this is because accessing `x` results in `number` in the former type and `string` in the latter type, and "
-            "`number` is not exactly `string`";
+        const std::string expected = "Type 'T' from 'game/A' could not be converted into 'T' from 'game/B'; \n"
+                                     "this is because accessing `x` results in `number` in the former type and `string` in the latter type, and "
+                                     "`number` is not exactly `string`";
         CHECK(expected == toString(result.errors[0]));
     }
     else
@@ -514,10 +513,9 @@ local b: B.T = a
 
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type 'T' from 'game/B' could not be converted into 'T' from 'game/C'; \n"
-            "this is because accessing `x` results in `number` in the former type and `string` in the latter type, and "
-            "`number` is not exactly `string`";
+        const std::string expected = "Type 'T' from 'game/B' could not be converted into 'T' from 'game/C'; \n"
+                                     "this is because accessing `x` results in `number` in the former type and `string` in the latter type, and "
+                                     "`number` is not exactly `string`";
         CHECK(expected == toString(result.errors[0]));
     }
     else
@@ -787,7 +785,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "leaky_generics")
 
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         CHECK_EQ("(unknown) -> unknown", toString(requireTypeAtPosition({13, 23})));
     }

tests/TypeInfer.operators.test.cpp

@@ -17,7 +17,7 @@
 using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 
 TEST_SUITE_BEGIN("TypeInferOperators");
 
@@ -29,7 +29,7 @@ TEST_CASE_FIXTURE(Fixture, "or_joins_types")
     )");
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         // FIXME: Regression
         CHECK("(string & ~(false?)) | number" == toString(*requireType("s")));
@@ -51,7 +51,7 @@ TEST_CASE_FIXTURE(Fixture, "or_joins_types_with_no_extras")
     )");
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         // FIXME: Regression.
         CHECK("(string & ~(false?)) | number" == toString(*requireType("s")));
@@ -72,7 +72,7 @@ TEST_CASE_FIXTURE(Fixture, "or_joins_types_with_no_superfluous_union")
     )");
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
         // FIXME: Regression
         CHECK("(string & ~(false?)) | string" == toString(requireType("s")));
@@ -634,7 +634,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "typecheck_unary_minus_error")
         local a = -foo
     )");
 
-    if (FFlag::LuauEagerGeneralization && FFlag::LuauSolverV2)
+    if (FFlag::LuauEagerGeneralization2 && FFlag::LuauSolverV2)
     {
         LUAU_REQUIRE_ERROR_COUNT(1, result);
 

tests/TypeInfer.refinements.test.cpp

@@ -10,7 +10,7 @@
 
 LUAU_FASTFLAG(LuauSolverV2)
 LUAU_FASTFLAG(DebugLuauEqSatSimplification)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauFunctionCallsAreNotNilable)
 LUAU_FASTFLAG(LuauWeakNilRefinementType)
 LUAU_FASTFLAG(LuauAddCallConstraintForIterableFunctions)
@@ -770,12 +770,12 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "nonoptional_type_can_narrow_to_nil_if_sense_
 
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
     {
-        CHECK("nil & string & unknown & unknown" == toString(requireTypeAtPosition({4, 24})));    // type(v) == "nil"
+        CHECK("nil & string & unknown & unknown" == toString(requireTypeAtPosition({4, 24})));  // type(v) == "nil"
         CHECK("string & unknown & unknown & ~nil" == toString(requireTypeAtPosition({6, 24}))); // type(v) ~= "nil"
 
-        CHECK("nil & string & unknown & unknown" == toString(requireTypeAtPosition({10, 24})));    // equivalent to type(v) == "nil"
+        CHECK("nil & string & unknown & unknown" == toString(requireTypeAtPosition({10, 24})));  // equivalent to type(v) == "nil"
         CHECK("string & unknown & unknown & ~nil" == toString(requireTypeAtPosition({12, 24}))); // equivalent to type(v) ~= "nil"
     }
     else
@@ -1273,7 +1273,10 @@ TEST_CASE_FIXTURE(Fixture, "discriminate_from_truthiness_of_x")
         // time, sometimes this is due to hitting the simplifier rather than
         // normalization.
         CHECK("{ tag: \"exists\", x: string } & { x: ~(false?) }" == toString(requireTypeAtPosition({5, 28})));
-        CHECK(R"(({ tag: "exists", x: string } & { x: false? }) | ({ tag: "missing", x: nil } & { x: false? }))" == toString(requireTypeAtPosition({7, 28})));
+        CHECK(
+            R"(({ tag: "exists", x: string } & { x: false? }) | ({ tag: "missing", x: nil } & { x: false? }))" ==
+            toString(requireTypeAtPosition({7, 28}))
+        );
     }
     else
     {
@@ -2514,7 +2517,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "remove_recursive_upper_bound_when_generalizi
         end
     )"));
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         CHECK_EQ("nil & string & unknown", toString(requireTypeAtPosition({4, 24})));
     else
         CHECK_EQ("nil", toString(requireTypeAtPosition({4, 24})));
@@ -2636,10 +2639,7 @@ TEST_CASE_FIXTURE(Fixture, "oss_1687_equality_shouldnt_leak_nil")
 
 TEST_CASE_FIXTURE(BuiltinsFixture, "oss_1451")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::LuauSolverV2, true},
-        {FFlag::LuauWeakNilRefinementType, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::LuauSolverV2, true}, {FFlag::LuauWeakNilRefinementType, true}};
 
     LUAU_REQUIRE_NO_ERRORS(check(R"(
         type Part = {
@@ -2682,10 +2682,17 @@ TEST_CASE_FIXTURE(RefinementExternTypeFixture, "cannot_call_a_function")
     {
         LUAU_REQUIRE_ERROR_COUNT(2, result);
 
-        CHECK_EQ(toString(result.errors[0]), "Key 'Disconnect' is missing from 't2 where t1 = ExternScriptConnection | t2 | { Disconnect: (t1) -> (...any) } ; t2 = { disconnect: (t1) -> (...any) }' in the type 't1 where t1 = ExternScriptConnection | { Disconnect: (t1) -> (...any) } | { disconnect: (t1) -> (...any) }'");
+        CHECK_EQ(
+            toString(result.errors[0]),
+            "Key 'Disconnect' is missing from 't2 where t1 = ExternScriptConnection | t2 | { Disconnect: (t1) -> (...any) } ; t2 = { disconnect: "
+            "(t1) -> (...any) }' in the type 't1 where t1 = ExternScriptConnection | { Disconnect: (t1) -> (...any) } | { disconnect: (t1) -> "
+            "(...any) }'"
+        );
 
         if (FFlag::LuauBetterCannotCallFunctionPrimitive)
-            CHECK_EQ(toString(result.errors[1]), "The type function is not precise enough for us to determine the appropriate result type of this call.");
+            CHECK_EQ(
+                toString(result.errors[1]), "The type function is not precise enough for us to determine the appropriate result type of this call."
+            );
         else
             CHECK_EQ(toString(result.errors[1]), "Cannot call a value of type function");
     }
@@ -2694,7 +2701,9 @@ TEST_CASE_FIXTURE(RefinementExternTypeFixture, "cannot_call_a_function")
         LUAU_REQUIRE_ERROR_COUNT(1, result);
 
         if (FFlag::LuauBetterCannotCallFunctionPrimitive)
-            CHECK_EQ(toString(result.errors[0]), "The type function is not precise enough for us to determine the appropriate result type of this call.");
+            CHECK_EQ(
+                toString(result.errors[0]), "The type function is not precise enough for us to determine the appropriate result type of this call."
+            );
         else
             CHECK_EQ(toString(result.errors[0]), "Cannot call a value of type function");
     }

tests/TypeInfer.singletons.test.cpp

@@ -389,7 +389,8 @@ TEST_CASE_FIXTURE(Fixture, "table_properties_type_error_escapes")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected = R"(Table type '{ ["\n"]: number }' not compatible with type '{ ["<>"]: number }' because the former is missing field '<>')";
+    const std::string expected =
+        R"(Table type '{ ["\n"]: number }' not compatible with type '{ ["<>"]: number }' because the former is missing field '<>')";
     CHECK(expected == toString(result.errors[0]));
 }
 
@@ -460,11 +461,10 @@ TEST_CASE_FIXTURE(Fixture, "parametric_tagged_union_alias")
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
     const std::string expectedError = "Type\n\t"
-        "'{ result: string, success: boolean }'"
-        "\ncould not be converted into\n\t"
-        "'Err<number> | Ok<string>'";
+                                      "'{ result: string, success: boolean }'"
+                                      "\ncould not be converted into\n\t"
+                                      "'Err<number> | Ok<string>'";
     CHECK(toString(result.errors[0]) == expectedError);
-
 }
 
 TEST_CASE_FIXTURE(Fixture, "if_then_else_expression_singleton_options")

tests/TypeInfer.tables.test.cpp

@@ -21,8 +21,8 @@ LUAU_FASTFLAG(LuauSolverV2)
 
 LUAU_FASTFLAG(LuauInstantiateInSubtyping)
 LUAU_FASTFLAG(LuauFixIndexerSubtypingOrdering)
-LUAU_FASTFLAG(LuauEagerGeneralization)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(DebugLuauAssertOnForcedConstraint)
 LUAU_FASTFLAG(LuauBidirectionalInferenceElideAssert)
 LUAU_FASTFLAG(LuauOptimizeFalsyAndTruthyIntersect)
@@ -702,7 +702,7 @@ TEST_CASE_FIXTURE(Fixture, "indexers_get_quantified_too")
 
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauSolverV2 && FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauSolverV2 && FFlag::LuauEagerGeneralization2)
         CHECK("<a>({a}) -> ()" == toString(requireType("swap")));
     else if (FFlag::LuauSolverV2)
         CHECK("({unknown}) -> ()" == toString(requireType("swap")));
@@ -925,9 +925,9 @@ TEST_CASE_FIXTURE(Fixture, "sealed_table_indexers_must_unify")
 
     if (FFlag::LuauSolverV2)
     {
-        std::string expected =  "Type '{number}' could not be converted into '{string}'; \n"
-                                "this is because the result of indexing is `number` in the former type and `string` in the latter type, "
-                                "and `number` is not exactly `string`";
+        std::string expected = "Type '{number}' could not be converted into '{string}'; \n"
+                               "this is because the result of indexing is `number` in the former type and `string` in the latter type, "
+                               "and `number` is not exactly `string`";
         auto actual = toString(result.errors[0]);
         CHECK_EQ(expected, actual);
     }
@@ -2379,7 +2379,7 @@ TEST_CASE_FIXTURE(Fixture, "invariant_table_properties_means_instantiating_table
         local c : string = t.m("hi")
     )");
 
-    if (FFlag::LuauEagerGeneralization && FFlag::LuauSolverV2)
+    if (FFlag::LuauEagerGeneralization2 && FFlag::LuauSolverV2)
     {
         // FIXME CLI-151985
         LUAU_CHECK_ERROR_COUNT(2, result);
@@ -3749,7 +3749,7 @@ TEST_CASE_FIXTURE(Fixture, "scalar_is_not_a_subtype_of_a_compatible_polymorphic_
 {
     ScopedFastFlag sff[] = {
         {FFlag::LuauReportSubtypingErrors, true},
-        {FFlag::LuauEagerGeneralization, true},
+        {FFlag::LuauEagerGeneralization2, true},
         {FFlag::LuauSubtypeGenericsAndNegations, true},
         {FFlag::LuauNoMoreInjectiveTypeFunctions, true}
     };
@@ -4298,7 +4298,7 @@ TEST_CASE_FIXTURE(Fixture, "cli_84607_missing_prop_in_array_or_dict")
 
     if (FFlag::LuauSolverV2)
     {
-        for (const auto& err: result.errors)
+        for (const auto& err : result.errors)
         {
             const auto* error = get<MissingProperties>(err);
             REQUIRE(error);
@@ -4644,9 +4644,7 @@ TEST_CASE_FIXTURE(Fixture, "table_writes_introduce_write_properties")
         return;
 
     ScopedFastFlag sff[] = {
-        {FFlag::LuauEagerGeneralization, true},
-        {FFlag::LuauSubtypeGenericsAndNegations, true},
-        {FFlag::LuauNoMoreInjectiveTypeFunctions, true}
+        {FFlag::LuauEagerGeneralization2, true}, {FFlag::LuauSubtypeGenericsAndNegations, true}, {FFlag::LuauNoMoreInjectiveTypeFunctions, true}
     };
 
     CheckResult result = check(R"(
@@ -4698,7 +4696,7 @@ TEST_CASE_FIXTURE(Fixture, "refined_thing_can_be_an_array")
         end
     )");
 
-    if (FFlag::LuauSolverV2 && !FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauSolverV2 && !FFlag::LuauEagerGeneralization2)
     {
         LUAU_CHECK_ERROR_COUNT(1, result);
         LUAU_CHECK_ERROR(result, NotATable);
@@ -4746,7 +4744,7 @@ TEST_CASE_FIXTURE(Fixture, "parameter_was_set_an_indexer_and_bounded_by_another_
     LUAU_REQUIRE_NO_ERRORS(result);
 
     // FIXME CLI-114134.  We need to simplify types more consistently.
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         CHECK("({number} & {number}, unknown) -> ()" == toString(requireType("f")));
     else
         CHECK_EQ("(unknown & {number} & {number}, unknown) -> ()", toString(requireType("f")));
@@ -5088,8 +5086,6 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "subtyping_with_a_metatable_table_path")
     if (!FFlag::LuauSolverV2)
         return;
 
-    ScopedFastFlag _{FFlag::LuauTableLiteralSubtypeSpecificCheck, true};
-
     CheckResult result = check(R"(
         type self = {} & {}
         type Class = typeof(setmetatable())
@@ -5098,18 +5094,20 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "subtyping_with_a_metatable_table_path")
         end
     )");
 
-    LUAU_REQUIRE_ERROR_COUNT(1, result);
+    LUAU_REQUIRE_ERROR_COUNT(3, result);
+
+    // We shouldn't allow `setmetatable()` to type check
+    CHECK_EQ(result.errors[0].location, Location{{2, 21}, {2, 43}});
+    CHECK_EQ("Type function instance setmetatable<nil, nil> is uninhabited", toString(result.errors[0]));
+
+    CHECK_EQ(result.errors[1].location, Location{{3, 8}, {5, 11}});
+    CHECK_EQ("Type function instance setmetatable<nil, nil> is uninhabited", toString(result.errors[1]));
 
     CHECK_EQ(
-        "Type pack '{ @metatable {  }, {  } & {  } }' could not be converted into 'Class'; \n"
-        "this is because \n\t"
-        " * in the 1st entry in the type pack, the metatable portion is `{  }` in the former type and `nil` in the latter type, and `{  }` "
-        "is not a subtype of `nil`\n\t"
-        " * in the 1st entry in the type pack, the table portion has the 1st component of the intersection as `{  }` and in the 1st entry "
-        "in the type pack, the table portion is `nil`, and `{  }` is not a subtype of `nil`\n\t"
-        " * in the 1st entry in the type pack, the table portion has the 2nd component of the intersection as `{  }` and in the 1st entry "
-        "in the type pack, the table portion is `nil`, and `{  }` is not a subtype of `nil`",
-        toString(result.errors[0])
+        "Type pack '{ @metatable {  }, {  } & {  } }' could not be converted into 'setmetatable<nil, nil>'; \n"
+        "this is because the 1st entry in the type pack is `{ @metatable {  }, {  } & {  } }` and in the 1st entry in the type packreduces to "
+        "`never`, and `{ @metatable {  }, {  } & {  } }` is not a subtype of `never`",
+        toString(result.errors[2])
     );
 }
 
@@ -5399,10 +5397,7 @@ TEST_CASE_FIXTURE(Fixture, "returning_mismatched_optional_in_table")
 
 TEST_CASE_FIXTURE(Fixture, "optional_function_in_table")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::LuauSolverV2, true},
-        {FFlag::LuauTableLiteralSubtypeSpecificCheck, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::LuauSolverV2, true}, {FFlag::LuauTableLiteralSubtypeSpecificCheck, true}};
 
     LUAU_CHECK_NO_ERRORS(check(R"(
         local t: { (() -> ())? } = {
@@ -5551,10 +5546,7 @@ TEST_CASE_FIXTURE(Fixture, "deeply_nested_classish_inference")
 
 TEST_CASE_FIXTURE(Fixture, "bigger_nested_table_causes_big_type_error")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::LuauSolverV2, true},
-        {FFlag::LuauTableLiteralSubtypeSpecificCheck, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::LuauSolverV2, true}, {FFlag::LuauTableLiteralSubtypeSpecificCheck, true}};
 
     auto result = check(R"(
         type File = {
@@ -5794,7 +5786,7 @@ TEST_CASE_FIXTURE(Fixture, "large_table_inference_does_not_bleed")
         local otherWords: { Word } = {"foo"}
     )");
     LUAU_REQUIRE_ERROR_COUNT(3, result);
-    for (const auto& err: result.errors)
+    for (const auto& err : result.errors)
         // Check that all of the errors are localized to `words`, not `otherWords`
         CHECK(err.location.begin.line == 2);
 }
@@ -5809,10 +5801,7 @@ TEST_CASE_FIXTURE(Fixture, "extremely_large_table" * doctest::timeout(2.0))
         {FFlag::LuauDisablePrimitiveInferenceInLargeTables, true},
     };
 
-    const std::string source = 
-        "local res = {\n" + 
-        rep("\"foo\",\n", 100'000) +
-        "}";
+    const std::string source = "local res = {\n" + rep("\"foo\",\n", 100'000) + "}";
     LUAU_REQUIRE_NO_ERRORS(check(source));
     CHECK_EQ("{string}", toString(requireType("res"), {true}));
 }

tests/TypeInfer.test.cpp

@@ -28,7 +28,7 @@ LUAU_FASTFLAG(LuauTypeCheckerAcceptNumberConcats)
 LUAU_FASTFLAG(LuauPreprocessTypestatedArgument)
 LUAU_FASTFLAG(LuauMagicFreezeCheckBlocked2)
 LUAU_FASTFLAG(LuauNoMoreInjectiveTypeFunctions)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauOptimizeFalsyAndTruthyIntersect)
 LUAU_FASTFLAG(LuauHasPropProperBlock)
 LUAU_FASTFLAG(LuauStringPartLengthLimit)
@@ -447,7 +447,7 @@ TEST_CASE_FIXTURE(Fixture, "check_expr_recursion_limit")
 #endif
     ScopedFastInt luauRecursionLimit{FInt::LuauRecursionLimit, limit + 100};
     ScopedFastInt luauCheckRecursionLimit{FInt::LuauCheckRecursionLimit, limit - 100};
-    ScopedFastFlag _{FFlag::LuauEagerGeneralization, false};
+    ScopedFastFlag _{FFlag::LuauEagerGeneralization2, false};
 
     CheckResult result = check(R"(("foo"))" + rep(":lower()", limit));
 
@@ -1990,10 +1990,7 @@ TEST_CASE_FIXTURE(Fixture, "assert_allows_singleton_union_or_intersection")
 
 TEST_CASE_FIXTURE(BuiltinsFixture, "assert_table_freeze_constraint_solving")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::LuauSolverV2, true},
-        {FFlag::LuauMagicFreezeCheckBlocked2, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::LuauSolverV2, true}, {FFlag::LuauMagicFreezeCheckBlocked2, true}};
     LUAU_REQUIRE_NO_ERRORS(check(R"(
         local f = table.freeze
         f(table)
@@ -2002,10 +1999,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "assert_table_freeze_constraint_solving")
 
 TEST_CASE_FIXTURE(BuiltinsFixture, "fuzz_assert_table_freeze_constraint_solving")
 {
-    ScopedFastFlag sffs[] = {
-        {FFlag::LuauSolverV2, true},
-        {FFlag::LuauMagicFreezeCheckBlocked2, true}
-    };
+    ScopedFastFlag sffs[] = {{FFlag::LuauSolverV2, true}, {FFlag::LuauMagicFreezeCheckBlocked2, true}};
     // This is the original fuzzer version of the above issue.
     CheckResult results = check(R"(
         local function l0()
@@ -2041,7 +2035,7 @@ TEST_CASE_FIXTURE(Fixture, "fuzz_generalize_one_remove_type_assert")
     ScopedFastFlag sffs[] = {
         {FFlag::LuauSolverV2, true},
         {FFlag::LuauHasPropProperBlock, true},
-        {FFlag::LuauEagerGeneralization, true},
+        {FFlag::LuauEagerGeneralization2, true},
         {FFlag::LuauOptimizeFalsyAndTruthyIntersect, true},
         {FFlag::LuauSubtypeGenericsAndNegations, true},
         {FFlag::LuauNoMoreInjectiveTypeFunctions, true},
@@ -2079,7 +2073,7 @@ TEST_CASE_FIXTURE(Fixture, "fuzz_generalize_one_remove_type_assert_2")
 {
     ScopedFastFlag sffs[] = {
         {FFlag::LuauSolverV2, true},
-        {FFlag::LuauEagerGeneralization, true},
+        {FFlag::LuauEagerGeneralization2, true},
         {FFlag::LuauOptimizeFalsyAndTruthyIntersect, true},
         {FFlag::LuauSubtypeGenericsAndNegations, true},
         {FFlag::LuauNoMoreInjectiveTypeFunctions, true},
@@ -2116,7 +2110,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "fuzz_simplify_combinatorial_explosion")
     ScopedFastFlag sffs[] = {
         {FFlag::LuauSolverV2, true},
         {FFlag::LuauHasPropProperBlock, true},
-        {FFlag::LuauEagerGeneralization, true},
+        {FFlag::LuauEagerGeneralization2, true},
         {FFlag::LuauOptimizeFalsyAndTruthyIntersect, true},
         {FFlag::LuauStringPartLengthLimit, true},
         {FFlag::LuauSimplificationRecheckAssumption, true},

tests/TypeInfer.typePacks.test.cpp

@@ -12,7 +12,7 @@ using namespace Luau;
 LUAU_FASTFLAG(LuauSolverV2)
 
 LUAU_FASTFLAG(LuauInstantiateInSubtyping)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauReportSubtypingErrors)
 LUAU_FASTFLAG(LuauTrackInferredFunctionTypeFromCall)
 LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
@@ -100,7 +100,7 @@ TEST_CASE_FIXTURE(Fixture, "higher_order_function")
 
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         CHECK_EQ("<a, b..., c...>((c...) -> (b...), (a) -> (c...), a) -> (b...)", toString(requireType("apply")));
     else
         CHECK_EQ("<a, b..., c...>((b...) -> (c...), (a) -> (b...), a) -> (c...)", toString(requireType("apply")));
@@ -966,13 +966,12 @@ a = b
     if (FFlag::LuauSolverV2)
     {
 
-        const std::string expected =
-            "Type\n\t"
-            "'() -> (number, ...boolean)'"
-            "\ncould not be converted into\n\t"
-            "'() -> (number, ...string)'; \n"
-            "this is because it returns a tail of the variadic `boolean` in the former type and `string` in the latter "
-            "type, and `boolean` is not a subtype of `string`";
+        const std::string expected = "Type\n\t"
+                                     "'() -> (number, ...boolean)'"
+                                     "\ncould not be converted into\n\t"
+                                     "'() -> (number, ...string)'; \n"
+                                     "this is because it returns a tail of the variadic `boolean` in the former type and `string` in the latter "
+                                     "type, and `boolean` is not a subtype of `string`";
 
         CHECK(expected == toString(result.errors[0]));
     }

tests/TypeInfer.typestates.test.cpp

@@ -8,7 +8,7 @@ LUAU_FASTFLAG(LuauRefineWaitForBlockedTypesInTarget)
 LUAU_FASTFLAG(LuauDoNotAddUpvalueTypesToLocalType)
 LUAU_FASTFLAG(LuauDfgIfBlocksShouldRespectControlFlow)
 LUAU_FASTFLAG(LuauReportSubtypingErrors)
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauPreprocessTypestatedArgument)
 LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
 LUAU_FASTFLAG(LuauDfgAllowUpdatesInLoops)
@@ -418,7 +418,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "prototyped_recursive_functions_but_has_futur
     ScopedFastFlag sffs[] = {
         {FFlag::LuauSolverV2, true},
         {FFlag::LuauReportSubtypingErrors, true},
-        {FFlag::LuauEagerGeneralization, true},
+        {FFlag::LuauEagerGeneralization2, true},
         {FFlag::LuauSubtypeGenericsAndNegations, true},
         {FFlag::LuauNoMoreInjectiveTypeFunctions, true},
     };
@@ -763,9 +763,7 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "refinement_through_erroring")
 TEST_CASE_FIXTURE(BuiltinsFixture, "refinement_through_erroring_in_loop")
 {
     ScopedFastFlag sffs[] = {
-        {FFlag::LuauSolverV2, true},
-        {FFlag::LuauDfgIfBlocksShouldRespectControlFlow, true},
-        {FFlag::LuauDfgAllowUpdatesInLoops,true}
+        {FFlag::LuauSolverV2, true}, {FFlag::LuauDfgIfBlocksShouldRespectControlFlow, true}, {FFlag::LuauDfgAllowUpdatesInLoops, true}
     };
 
     CheckResult result = check(R"(

tests/TypeInfer.unionTypes.test.cpp

@@ -10,7 +10,7 @@ using namespace Luau;
 
 LUAU_FASTFLAG(LuauSolverV2)
 
-LUAU_FASTFLAG(LuauEagerGeneralization)
+LUAU_FASTFLAG(LuauEagerGeneralization2)
 LUAU_FASTFLAG(LuauTableLiteralSubtypeSpecificCheck)
 
 TEST_SUITE_BEGIN("UnionTypes");
@@ -675,11 +675,10 @@ TEST_CASE_FIXTURE(BuiltinsFixture, "table_union_write_indirect")
     LUAU_REQUIRE_ERROR_COUNT(1, result);
     // NOTE: union normalization will improve this message
 
-    const std::string expected =
-        "Type\n\t"
-        "'(string) -> number'"
-        "\ncould not be converted into\n\t"
-        "'((number) -> string) | ((number) -> string)'; none of the union options are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'(string) -> number'"
+                                 "\ncould not be converted into\n\t"
+                                 "'((number) -> string) | ((number) -> string)'; none of the union options are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -767,11 +766,10 @@ TEST_CASE_FIXTURE(Fixture, "union_of_functions_mentioning_generic_typepacks")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'(number, a...) -> (number?, a...)'"
-        "\ncould not be converted into\n\t"
-        "'((number) -> number) | ((number?, a...) -> (number?, a...))'; none of the union options are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'(number, a...) -> (number?, a...)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'((number) -> number) | ((number?, a...) -> (number?, a...))'; none of the union options are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -788,11 +786,10 @@ TEST_CASE_FIXTURE(Fixture, "union_of_functions_with_mismatching_arg_arities")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'(number) -> number?'"
-        "\ncould not be converted into\n\t"
-        "'((number) -> nil) | ((number, string?) -> number)'; none of the union options are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'(number) -> number?'"
+                                 "\ncould not be converted into\n\t"
+                                 "'((number) -> nil) | ((number, string?) -> number)'; none of the union options are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -809,11 +806,10 @@ TEST_CASE_FIXTURE(Fixture, "union_of_functions_with_mismatching_result_arities")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'() -> number | string'"
-        "\ncould not be converted into\n\t"
-        "'(() -> (string, string)) | (() -> number)'; none of the union options are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'() -> number | string'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(() -> (string, string)) | (() -> number)'; none of the union options are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -830,11 +826,10 @@ TEST_CASE_FIXTURE(Fixture, "union_of_functions_with_variadics")
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'(...nil) -> (...number?)'"
-        "\ncould not be converted into\n\t"
-        "'((...string?) -> (...number)) | ((...string?) -> nil)'; none of the union options are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'(...nil) -> (...number?)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'((...string?) -> (...number)) | ((...string?) -> nil)'; none of the union options are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -850,11 +845,10 @@ TEST_CASE_FIXTURE(Fixture, "union_of_functions_with_mismatching_arg_variadics")
     LUAU_REQUIRE_ERROR_COUNT(1, result);
     if (FFlag::LuauSolverV2)
     {
-        const std::string expected =
-            "Type\n\t"
-            "'(number) -> ()'"
-            "\ncould not be converted into\n\t"
-            "'((...number?) -> ()) | ((number?) -> ())'";
+        const std::string expected = "Type\n\t"
+                                     "'(number) -> ()'"
+                                     "\ncould not be converted into\n\t"
+                                     "'((...number?) -> ()) | ((number?) -> ())'";
         CHECK(expected == toString(result.errors[0]));
     }
     else
@@ -880,11 +874,10 @@ TEST_CASE_FIXTURE(Fixture, "union_of_functions_with_mismatching_result_variadics
 
     LUAU_REQUIRE_ERROR_COUNT(1, result);
 
-    const std::string expected =
-        "Type\n\t"
-        "'() -> (number?, ...number)'"
-        "\ncould not be converted into\n\t"
-        "'(() -> (...number)) | (() -> number)'; none of the union options are compatible";
+    const std::string expected = "Type\n\t"
+                                 "'() -> (number?, ...number)'"
+                                 "\ncould not be converted into\n\t"
+                                 "'(() -> (...number)) | (() -> number)'; none of the union options are compatible";
     CHECK_EQ(expected, toString(result.errors[0]));
 }
 
@@ -902,13 +895,14 @@ TEST_CASE_FIXTURE(Fixture, "less_greedy_unification_with_union_types")
 
     LUAU_REQUIRE_NO_ERRORS(result);
 
-    if (FFlag::LuauEagerGeneralization)
+    if (FFlag::LuauEagerGeneralization2)
         CHECK_EQ(
             "<a>(({ read x: a } & { x: number }) | ({ read x: a } & { x: string })) -> { x: number } | { x: string }", toString(requireType("f"))
         );
     else
         CHECK_EQ(
-            "(({ read x: unknown } & { x: number }) | ({ read x: unknown } & { x: string })) -> { x: number } | { x: string }", toString(requireType("f"))
+            "(({ read x: unknown } & { x: number }) | ({ read x: unknown } & { x: string })) -> { x: number } | { x: string }",
+            toString(requireType("f"))
         );
 }